v8  8.4.371 (node 14.19.3)
V8 is Google's open source JavaScript engine
v8.h
Go to the documentation of this file.
1 // Copyright 2012 the V8 project authors. All rights reserved.
2 // Use of this source code is governed by a BSD-style license that can be
3 // found in the LICENSE file.
4 
5 /** \mainpage V8 API Reference Guide
6  *
7  * V8 is Google's open source JavaScript engine.
8  *
9  * This set of documents provides reference material generated from the
10  * V8 header file, include/v8.h.
11  *
12  * For other documentation see https://v8.dev/.
13  */
14 
15 #ifndef INCLUDE_V8_H_
16 #define INCLUDE_V8_H_
17 
18 #include <stddef.h>
19 #include <stdint.h>
20 #include <stdio.h>
21 
22 #include <memory>
23 #include <string>
24 #include <type_traits>
25 #include <utility>
26 #include <vector>
27 
28 #include "cppgc/common.h"
29 #include "v8-internal.h" // NOLINT(build/include_directory)
30 #include "v8-version.h" // NOLINT(build/include_directory)
31 #include "v8config.h" // NOLINT(build/include_directory)
32 
33 // We reserve the V8_* prefix for macros defined in V8 public API and
34 // assume there are no name conflicts with the embedder's code.
35 
36 /**
37  * The v8 JavaScript engine.
38  */
39 namespace v8 {
40 
41 class AccessorSignature;
42 class Array;
43 class ArrayBuffer;
44 class BigInt;
45 class BigIntObject;
46 class Boolean;
47 class BooleanObject;
48 class Context;
49 class Data;
50 class Date;
51 class External;
52 class Function;
53 class FunctionTemplate;
54 class HeapProfiler;
55 class ImplementationUtilities;
56 class Int32;
57 class Integer;
58 class Isolate;
59 template <class T>
60 class Maybe;
61 class MicrotaskQueue;
62 class Name;
63 class Number;
64 class NumberObject;
65 class Object;
66 class ObjectOperationDescriptor;
67 class ObjectTemplate;
68 class Platform;
69 class Primitive;
70 class Promise;
71 class PropertyDescriptor;
72 class Proxy;
73 class RawOperationDescriptor;
74 class Script;
75 class SharedArrayBuffer;
76 class Signature;
77 class StartupData;
78 class StackFrame;
79 class StackTrace;
80 class String;
81 class StringObject;
82 class Symbol;
83 class SymbolObject;
84 class PrimitiveArray;
85 class Private;
86 class Uint32;
87 class Utils;
88 class Value;
89 class WasmModuleObject;
90 template <class T> class Local;
91 template <class T>
92 class MaybeLocal;
93 template <class T> class Eternal;
94 template<class T> class NonCopyablePersistentTraits;
95 template<class T> class PersistentBase;
96 template <class T, class M = NonCopyablePersistentTraits<T> >
97 class Persistent;
98 template <class T>
99 class Global;
100 template <class T>
101 class TracedGlobal;
102 template <class T>
103 class TracedReference;
104 template <class T>
105 class TracedReferenceBase;
106 template<class K, class V, class T> class PersistentValueMap;
107 template <class K, class V, class T>
109 template <class K, class V, class T>
110 class GlobalValueMap;
111 template<class V, class T> class PersistentValueVector;
112 template<class T, class P> class WeakCallbackObject;
113 class FunctionTemplate;
114 class ObjectTemplate;
115 template<typename T> class FunctionCallbackInfo;
116 template<typename T> class PropertyCallbackInfo;
117 class StackTrace;
118 class StackFrame;
119 class Isolate;
120 class CallHandlerHelper;
122 template<typename T> class ReturnValue;
123 
124 namespace internal {
125 enum class ArgumentsType;
126 template <ArgumentsType>
127 class Arguments;
128 template <typename T>
130 class DeferredHandles;
131 class FunctionCallbackArguments;
132 class GlobalHandles;
133 class Heap;
134 class HeapObject;
135 class ExternalString;
136 class Isolate;
137 class LocalEmbedderHeapTracer;
138 class MicrotaskQueue;
139 class PropertyCallbackArguments;
140 class ReadOnlyHeap;
141 class ScopedExternalStringLock;
142 struct ScriptStreamingData;
143 class ThreadLocalTop;
144 
145 namespace wasm {
146 class NativeModule;
147 class StreamingDecoder;
148 } // namespace wasm
149 
150 } // namespace internal
151 
152 namespace debug {
153 class ConsoleCallArguments;
154 } // namespace debug
155 
156 // --- Handles ---
157 
158 /**
159  * An object reference managed by the v8 garbage collector.
160  *
161  * All objects returned from v8 have to be tracked by the garbage
162  * collector so that it knows that the objects are still alive. Also,
163  * because the garbage collector may move objects, it is unsafe to
164  * point directly to an object. Instead, all objects are stored in
165  * handles which are known by the garbage collector and updated
166  * whenever an object moves. Handles should always be passed by value
167  * (except in cases like out-parameters) and they should never be
168  * allocated on the heap.
169  *
170  * There are two types of handles: local and persistent handles.
171  *
172  * Local handles are light-weight and transient and typically used in
173  * local operations. They are managed by HandleScopes. That means that a
174  * HandleScope must exist on the stack when they are created and that they are
175  * only valid inside of the HandleScope active during their creation.
176  * For passing a local handle to an outer HandleScope, an EscapableHandleScope
177  * and its Escape() method must be used.
178  *
179  * Persistent handles can be used when storing objects across several
180  * independent operations and have to be explicitly deallocated when they're no
181  * longer used.
182  *
183  * It is safe to extract the object stored in the handle by
184  * dereferencing the handle (for instance, to extract the Object* from
185  * a Local<Object>); the value will still be governed by a handle
186  * behind the scenes and the same rules apply to these values as to
187  * their handles.
188  */
189 template <class T>
190 class Local {
191  public:
192  V8_INLINE Local() : val_(nullptr) {}
193  template <class S>
195  : val_(reinterpret_cast<T*>(*that)) {
196  /**
197  * This check fails when trying to convert between incompatible
198  * handles. For example, converting from a Local<String> to a
199  * Local<Number>.
200  */
201  static_assert(std::is_base_of<T, S>::value, "type check");
202  }
203 
204  /**
205  * Returns true if the handle is empty.
206  */
207  V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
208 
209  /**
210  * Sets the handle to be empty. IsEmpty() will then return true.
211  */
212  V8_INLINE void Clear() { val_ = nullptr; }
213 
214  V8_INLINE T* operator->() const { return val_; }
215 
216  V8_INLINE T* operator*() const { return val_; }
217 
218  /**
219  * Checks whether two handles are the same.
220  * Returns true if both are empty, or if the objects to which they refer
221  * are identical.
222  *
223  * If both handles refer to JS objects, this is the same as strict equality.
224  * For primitives, such as numbers or strings, a `false` return value does not
225  * indicate that the values aren't equal in the JavaScript sense.
226  * Use `Value::StrictEquals()` to check primitives for equality.
227  */
228  template <class S>
229  V8_INLINE bool operator==(const Local<S>& that) const {
230  internal::Address* a = reinterpret_cast<internal::Address*>(this->val_);
231  internal::Address* b = reinterpret_cast<internal::Address*>(that.val_);
232  if (a == nullptr) return b == nullptr;
233  if (b == nullptr) return false;
234  return *a == *b;
235  }
236 
237  template <class S> V8_INLINE bool operator==(
238  const PersistentBase<S>& that) const {
239  internal::Address* a = reinterpret_cast<internal::Address*>(this->val_);
240  internal::Address* b = reinterpret_cast<internal::Address*>(that.val_);
241  if (a == nullptr) return b == nullptr;
242  if (b == nullptr) return false;
243  return *a == *b;
244  }
245 
246  /**
247  * Checks whether two handles are different.
248  * Returns true if only one of the handles is empty, or if
249  * the objects to which they refer are different.
250  *
251  * If both handles refer to JS objects, this is the same as strict
252  * non-equality. For primitives, such as numbers or strings, a `true` return
253  * value does not indicate that the values aren't equal in the JavaScript
254  * sense. Use `Value::StrictEquals()` to check primitives for equality.
255  */
256  template <class S>
257  V8_INLINE bool operator!=(const Local<S>& that) const {
258  return !operator==(that);
259  }
260 
261  template <class S> V8_INLINE bool operator!=(
262  const Persistent<S>& that) const {
263  return !operator==(that);
264  }
265 
266  /**
267  * Cast a handle to a subclass, e.g. Local<Value> to Local<Object>.
268  * This is only valid if the handle actually refers to a value of the
269  * target type.
270  */
271  template <class S> V8_INLINE static Local<T> Cast(Local<S> that) {
272 #ifdef V8_ENABLE_CHECKS
273  // If we're going to perform the type check then we have to check
274  // that the handle isn't empty before doing the checked cast.
275  if (that.IsEmpty()) return Local<T>();
276 #endif
277  return Local<T>(T::Cast(*that));
278  }
279 
280  /**
281  * Calling this is equivalent to Local<S>::Cast().
282  * In particular, this is only valid if the handle actually refers to a value
283  * of the target type.
284  */
285  template <class S>
286  V8_INLINE Local<S> As() const {
287  return Local<S>::Cast(*this);
288  }
289 
290  /**
291  * Create a local handle for the content of another handle.
292  * The referee is kept alive by the local handle even when
293  * the original handle is destroyed/disposed.
294  */
295  V8_INLINE static Local<T> New(Isolate* isolate, Local<T> that);
296  V8_INLINE static Local<T> New(Isolate* isolate,
297  const PersistentBase<T>& that);
298  V8_INLINE static Local<T> New(Isolate* isolate,
299  const TracedReferenceBase<T>& that);
300 
301  private:
302  friend class Utils;
303  template<class F> friend class Eternal;
304  template<class F> friend class PersistentBase;
305  template<class F, class M> friend class Persistent;
306  template<class F> friend class Local;
307  template <class F>
308  friend class MaybeLocal;
309  template<class F> friend class FunctionCallbackInfo;
310  template<class F> friend class PropertyCallbackInfo;
311  friend class String;
312  friend class Object;
313  friend class Context;
314  friend class Isolate;
315  friend class Private;
316  template<class F> friend class internal::CustomArguments;
317  friend Local<Primitive> Undefined(Isolate* isolate);
318  friend Local<Primitive> Null(Isolate* isolate);
319  friend Local<Boolean> True(Isolate* isolate);
320  friend Local<Boolean> False(Isolate* isolate);
321  friend class HandleScope;
322  friend class EscapableHandleScope;
323  template <class F1, class F2, class F3>
325  template<class F1, class F2> friend class PersistentValueVector;
326  template <class F>
327  friend class ReturnValue;
328  template <class F>
329  friend class Traced;
330  template <class F>
331  friend class TracedGlobal;
332  template <class F>
333  friend class TracedReferenceBase;
334  template <class F>
335  friend class TracedReference;
336 
337  explicit V8_INLINE Local(T* that) : val_(that) {}
338  V8_INLINE static Local<T> New(Isolate* isolate, T* that);
339  T* val_;
340 };
341 
342 
343 #if !defined(V8_IMMINENT_DEPRECATION_WARNINGS)
344 // Handle is an alias for Local for historical reasons.
345 template <class T>
346 using Handle = Local<T>;
347 #endif
348 
349 
350 /**
351  * A MaybeLocal<> is a wrapper around Local<> that enforces a check whether
352  * the Local<> is empty before it can be used.
353  *
354  * If an API method returns a MaybeLocal<>, the API method can potentially fail
355  * either because an exception is thrown, or because an exception is pending,
356  * e.g. because a previous API call threw an exception that hasn't been caught
357  * yet, or because a TerminateExecution exception was thrown. In that case, an
358  * empty MaybeLocal is returned.
359  */
360 template <class T>
361 class MaybeLocal {
362  public:
363  V8_INLINE MaybeLocal() : val_(nullptr) {}
364  template <class S>
366  : val_(reinterpret_cast<T*>(*that)) {
367  static_assert(std::is_base_of<T, S>::value, "type check");
368  }
369 
370  V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
371 
372  /**
373  * Converts this MaybeLocal<> to a Local<>. If this MaybeLocal<> is empty,
374  * |false| is returned and |out| is left untouched.
375  */
376  template <class S>
378  out->val_ = IsEmpty() ? nullptr : this->val_;
379  return !IsEmpty();
380  }
381 
382  /**
383  * Converts this MaybeLocal<> to a Local<>. If this MaybeLocal<> is empty,
384  * V8 will crash the process.
385  */
387 
388  /**
389  * Converts this MaybeLocal<> to a Local<>, using a default value if this
390  * MaybeLocal<> is empty.
391  */
392  template <class S>
393  V8_INLINE Local<S> FromMaybe(Local<S> default_value) const {
394  return IsEmpty() ? default_value : Local<S>(val_);
395  }
396 
397  private:
398  T* val_;
399 };
400 
401 /**
402  * Eternal handles are set-once handles that live for the lifetime of the
403  * isolate.
404  */
405 template <class T> class Eternal {
406  public:
407  V8_INLINE Eternal() : val_(nullptr) {}
408  template <class S>
409  V8_INLINE Eternal(Isolate* isolate, Local<S> handle) : val_(nullptr) {
410  Set(isolate, handle);
411  }
412  // Can only be safely called if already set.
413  V8_INLINE Local<T> Get(Isolate* isolate) const;
414  V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
415  template<class S> V8_INLINE void Set(Isolate* isolate, Local<S> handle);
416 
417  private:
418  T* val_;
419 };
420 
421 
422 static const int kInternalFieldsInWeakCallback = 2;
423 static const int kEmbedderFieldsInWeakCallback = 2;
424 
425 template <typename T>
427  public:
428  typedef void (*Callback)(const WeakCallbackInfo<T>& data);
429 
430  WeakCallbackInfo(Isolate* isolate, T* parameter,
431  void* embedder_fields[kEmbedderFieldsInWeakCallback],
432  Callback* callback)
433  : isolate_(isolate), parameter_(parameter), callback_(callback) {
434  for (int i = 0; i < kEmbedderFieldsInWeakCallback; ++i) {
435  embedder_fields_[i] = embedder_fields[i];
436  }
437  }
438 
439  V8_INLINE Isolate* GetIsolate() const { return isolate_; }
440  V8_INLINE T* GetParameter() const { return parameter_; }
441  V8_INLINE void* GetInternalField(int index) const;
442 
443  // When first called, the embedder MUST Reset() the Global which triggered the
444  // callback. The Global itself is unusable for anything else. No v8 other api
445  // calls may be called in the first callback. Should additional work be
446  // required, the embedder must set a second pass callback, which will be
447  // called after all the initial callbacks are processed.
448  // Calling SetSecondPassCallback on the second pass will immediately crash.
449  void SetSecondPassCallback(Callback callback) const { *callback_ = callback; }
450 
451  private:
452  Isolate* isolate_;
453  T* parameter_;
454  Callback* callback_;
455  void* embedder_fields_[kEmbedderFieldsInWeakCallback];
456 };
457 
458 
459 // kParameter will pass a void* parameter back to the callback, kInternalFields
460 // will pass the first two internal fields back to the callback, kFinalizer
461 // will pass a void* parameter back, but is invoked before the object is
462 // actually collected, so it can be resurrected. In the last case, it is not
463 // possible to request a second pass callback.
465 
466 /**
467  * An object reference that is independent of any handle scope. Where
468  * a Local handle only lives as long as the HandleScope in which it was
469  * allocated, a PersistentBase handle remains valid until it is explicitly
470  * disposed using Reset().
471  *
472  * A persistent handle contains a reference to a storage cell within
473  * the V8 engine which holds an object value and which is updated by
474  * the garbage collector whenever the object is moved. A new storage
475  * cell can be created using the constructor or PersistentBase::Reset and
476  * existing handles can be disposed using PersistentBase::Reset.
477  *
478  */
479 template <class T> class PersistentBase {
480  public:
481  /**
482  * If non-empty, destroy the underlying storage cell
483  * IsEmpty() will return true after this call.
484  */
485  V8_INLINE void Reset();
486  /**
487  * If non-empty, destroy the underlying storage cell
488  * and create a new one with the contents of other if other is non empty
489  */
490  template <class S>
491  V8_INLINE void Reset(Isolate* isolate, const Local<S>& other);
492 
493  /**
494  * If non-empty, destroy the underlying storage cell
495  * and create a new one with the contents of other if other is non empty
496  */
497  template <class S>
498  V8_INLINE void Reset(Isolate* isolate, const PersistentBase<S>& other);
499 
500  V8_INLINE bool IsEmpty() const { return val_ == nullptr; }
501  V8_INLINE void Empty() { val_ = 0; }
502 
503  V8_INLINE Local<T> Get(Isolate* isolate) const {
504  return Local<T>::New(isolate, *this);
505  }
506 
507  template <class S>
508  V8_INLINE bool operator==(const PersistentBase<S>& that) const {
509  internal::Address* a = reinterpret_cast<internal::Address*>(this->val_);
510  internal::Address* b = reinterpret_cast<internal::Address*>(that.val_);
511  if (a == nullptr) return b == nullptr;
512  if (b == nullptr) return false;
513  return *a == *b;
514  }
515 
516  template <class S>
517  V8_INLINE bool operator==(const Local<S>& that) const {
518  internal::Address* a = reinterpret_cast<internal::Address*>(this->val_);
519  internal::Address* b = reinterpret_cast<internal::Address*>(that.val_);
520  if (a == nullptr) return b == nullptr;
521  if (b == nullptr) return false;
522  return *a == *b;
523  }
524 
525  template <class S>
526  V8_INLINE bool operator!=(const PersistentBase<S>& that) const {
527  return !operator==(that);
528  }
529 
530  template <class S>
531  V8_INLINE bool operator!=(const Local<S>& that) const {
532  return !operator==(that);
533  }
534 
535  /**
536  * Install a finalization callback on this object.
537  * NOTE: There is no guarantee as to *when* or even *if* the callback is
538  * invoked. The invocation is performed solely on a best effort basis.
539  * As always, GC-based finalization should *not* be relied upon for any
540  * critical form of resource management!
541  *
542  * The callback is supposed to reset the handle. No further V8 API may be
543  * called in this callback. In case additional work involving V8 needs to be
544  * done, a second callback can be scheduled using
545  * WeakCallbackInfo<void>::SetSecondPassCallback.
546  */
547  template <typename P>
548  V8_INLINE void SetWeak(P* parameter,
549  typename WeakCallbackInfo<P>::Callback callback,
550  WeakCallbackType type);
551 
552  /**
553  * Turns this handle into a weak phantom handle without finalization callback.
554  * The handle will be reset automatically when the garbage collector detects
555  * that the object is no longer reachable.
556  * A related function Isolate::NumberOfPhantomHandleResetsSinceLastCall
557  * returns how many phantom handles were reset by the garbage collector.
558  */
559  V8_INLINE void SetWeak();
560 
561  template<typename P>
563 
564  // TODO(dcarney): remove this.
565  V8_INLINE void ClearWeak() { ClearWeak<void>(); }
566 
567  /**
568  * Annotates the strong handle with the given label, which is then used by the
569  * heap snapshot generator as a name of the edge from the root to the handle.
570  * The function does not take ownership of the label and assumes that the
571  * label is valid as long as the handle is valid.
572  */
573  V8_INLINE void AnnotateStrongRetainer(const char* label);
574 
575  /** Returns true if the handle's reference is weak. */
576  V8_INLINE bool IsWeak() const;
577 
578  /**
579  * Assigns a wrapper class ID to the handle.
580  */
581  V8_INLINE void SetWrapperClassId(uint16_t class_id);
582 
583  /**
584  * Returns the class ID previously assigned to this handle or 0 if no class ID
585  * was previously assigned.
586  */
587  V8_INLINE uint16_t WrapperClassId() const;
588 
589  PersistentBase(const PersistentBase& other) = delete; // NOLINT
590  void operator=(const PersistentBase&) = delete;
591 
592  private:
593  friend class Isolate;
594  friend class Utils;
595  template<class F> friend class Local;
596  template<class F1, class F2> friend class Persistent;
597  template <class F>
598  friend class Global;
599  template<class F> friend class PersistentBase;
600  template<class F> friend class ReturnValue;
601  template <class F1, class F2, class F3>
603  template<class F1, class F2> friend class PersistentValueVector;
604  friend class Object;
605 
606  explicit V8_INLINE PersistentBase(T* val) : val_(val) {}
607  V8_INLINE static T* New(Isolate* isolate, T* that);
608 
609  T* val_;
610 };
611 
612 
613 /**
614  * Default traits for Persistent. This class does not allow
615  * use of the copy constructor or assignment operator.
616  * At present kResetInDestructor is not set, but that will change in a future
617  * version.
618  */
619 template<class T>
620 class NonCopyablePersistentTraits {
621  public:
622  typedef Persistent<T, NonCopyablePersistentTraits<T> > NonCopyablePersistent;
623  static const bool kResetInDestructor = false;
624  template<class S, class M>
625  V8_INLINE static void Copy(const Persistent<S, M>& source,
626  NonCopyablePersistent* dest) {
627  static_assert(sizeof(S) < 0,
628  "NonCopyablePersistentTraits::Copy is not instantiable");
629  }
630 };
631 
632 
633 /**
634  * Helper class traits to allow copying and assignment of Persistent.
635  * This will clone the contents of storage cell, but not any of the flags, etc.
636  */
637 template<class T>
640  static const bool kResetInDestructor = true;
641  template<class S, class M>
642  static V8_INLINE void Copy(const Persistent<S, M>& source,
643  CopyablePersistent* dest) {
644  // do nothing, just allow copy
645  }
646 };
647 
648 
649 /**
650  * A PersistentBase which allows copy and assignment.
651  *
652  * Copy, assignment and destructor behavior is controlled by the traits
653  * class M.
654  *
655  * Note: Persistent class hierarchy is subject to future changes.
656  */
657 template <class T, class M> class Persistent : public PersistentBase<T> {
658  public:
659  /**
660  * A Persistent with no storage cell.
661  */
663  /**
664  * Construct a Persistent from a Local.
665  * When the Local is non-empty, a new storage cell is created
666  * pointing to the same object, and no flags are set.
667  */
668  template <class S>
669  V8_INLINE Persistent(Isolate* isolate, Local<S> that)
670  : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
671  static_assert(std::is_base_of<T, S>::value, "type check");
672  }
673  /**
674  * Construct a Persistent from a Persistent.
675  * When the Persistent is non-empty, a new storage cell is created
676  * pointing to the same object, and no flags are set.
677  */
678  template <class S, class M2>
679  V8_INLINE Persistent(Isolate* isolate, const Persistent<S, M2>& that)
680  : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
681  static_assert(std::is_base_of<T, S>::value, "type check");
682  }
683  /**
684  * The copy constructors and assignment operator create a Persistent
685  * exactly as the Persistent constructor, but the Copy function from the
686  * traits class is called, allowing the setting of flags based on the
687  * copied Persistent.
688  */
689  V8_INLINE Persistent(const Persistent& that) : PersistentBase<T>(nullptr) {
690  Copy(that);
691  }
692  template <class S, class M2>
693  V8_INLINE Persistent(const Persistent<S, M2>& that) : PersistentBase<T>(0) {
694  Copy(that);
695  }
697  Copy(that);
698  return *this;
699  }
700  template <class S, class M2>
701  V8_INLINE Persistent& operator=(const Persistent<S, M2>& that) { // NOLINT
702  Copy(that);
703  return *this;
704  }
705  /**
706  * The destructor will dispose the Persistent based on the
707  * kResetInDestructor flags in the traits class. Since not calling dispose
708  * can result in a memory leak, it is recommended to always set this flag.
709  */
711  if (M::kResetInDestructor) this->Reset();
712  }
713 
714  // TODO(dcarney): this is pretty useless, fix or remove
715  template <class S>
716  V8_INLINE static Persistent<T>& Cast(const Persistent<S>& that) { // NOLINT
717 #ifdef V8_ENABLE_CHECKS
718  // If we're going to perform the type check then we have to check
719  // that the handle isn't empty before doing the checked cast.
720  if (!that.IsEmpty()) T::Cast(*that);
721 #endif
722  return reinterpret_cast<Persistent<T>&>(const_cast<Persistent<S>&>(that));
723  }
724 
725  // TODO(dcarney): this is pretty useless, fix or remove
726  template <class S>
727  V8_INLINE Persistent<S>& As() const { // NOLINT
728  return Persistent<S>::Cast(*this);
729  }
730 
731  private:
732  friend class Isolate;
733  friend class Utils;
734  template<class F> friend class Local;
735  template<class F1, class F2> friend class Persistent;
736  template<class F> friend class ReturnValue;
737 
738  explicit V8_INLINE Persistent(T* that) : PersistentBase<T>(that) {}
739  V8_INLINE T* operator*() const { return this->val_; }
740  template<class S, class M2>
741  V8_INLINE void Copy(const Persistent<S, M2>& that);
742 };
743 
744 
745 /**
746  * A PersistentBase which has move semantics.
747  *
748  * Note: Persistent class hierarchy is subject to future changes.
749  */
750 template <class T>
751 class Global : public PersistentBase<T> {
752  public:
753  /**
754  * A Global with no storage cell.
755  */
756  V8_INLINE Global() : PersistentBase<T>(nullptr) {}
757 
758  /**
759  * Construct a Global from a Local.
760  * When the Local is non-empty, a new storage cell is created
761  * pointing to the same object, and no flags are set.
762  */
763  template <class S>
764  V8_INLINE Global(Isolate* isolate, Local<S> that)
765  : PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
766  static_assert(std::is_base_of<T, S>::value, "type check");
767  }
768 
769  /**
770  * Construct a Global from a PersistentBase.
771  * When the Persistent is non-empty, a new storage cell is created
772  * pointing to the same object, and no flags are set.
773  */
774  template <class S>
775  V8_INLINE Global(Isolate* isolate, const PersistentBase<S>& that)
776  : PersistentBase<T>(PersistentBase<T>::New(isolate, that.val_)) {
777  static_assert(std::is_base_of<T, S>::value, "type check");
778  }
779 
780  /**
781  * Move constructor.
782  */
783  V8_INLINE Global(Global&& other);
784 
785  V8_INLINE ~Global() { this->Reset(); }
786 
787  /**
788  * Move via assignment.
789  */
790  template <class S>
792 
793  /**
794  * Pass allows returning uniques from functions, etc.
795  */
796  Global Pass() { return static_cast<Global&&>(*this); } // NOLINT
797 
798  /*
799  * For compatibility with Chromium's base::Bind (base::Passed).
800  */
801  typedef void MoveOnlyTypeForCPP03;
802 
803  Global(const Global&) = delete;
804  void operator=(const Global&) = delete;
805 
806  private:
807  template <class F>
808  friend class ReturnValue;
809  V8_INLINE T* operator*() const { return this->val_; }
810 };
811 
812 
813 // UniquePersistent is an alias for Global for historical reason.
814 template <class T>
815 using UniquePersistent = Global<T>;
816 
817 /**
818  * Deprecated. Use |TracedReference<T>| instead.
819  */
820 template <typename T>
822 
823 /**
824  * A traced handle with copy and move semantics. The handle is to be used
825  * together with |v8::EmbedderHeapTracer| and specifies edges from the embedder
826  * into V8's heap.
827  *
828  * The exact semantics are:
829  * - Tracing garbage collections use |v8::EmbedderHeapTracer|.
830  * - Non-tracing garbage collections refer to
831  * |v8::EmbedderHeapTracer::IsRootForNonTracingGC()| whether the handle should
832  * be treated as root or not.
833  *
834  * Note that the base class cannot be instantiated itself. Choose from
835  * - TracedGlobal
836  * - TracedReference
837  */
838 template <typename T>
840  public:
841  /**
842  * Returns true if this TracedReferenceBase is empty, i.e., has not been
843  * assigned an object.
844  */
845  bool IsEmpty() const { return val_ == nullptr; }
846 
847  /**
848  * If non-empty, destroy the underlying storage cell. |IsEmpty| will return
849  * true after this call.
850  */
851  V8_INLINE void Reset();
852 
853  /**
854  * Construct a Local<T> from this handle.
855  */
856  Local<T> Get(Isolate* isolate) const { return Local<T>::New(isolate, *this); }
857 
858  template <class S>
859  V8_INLINE bool operator==(const TracedReferenceBase<S>& that) const {
860  internal::Address* a = reinterpret_cast<internal::Address*>(val_);
861  internal::Address* b = reinterpret_cast<internal::Address*>(that.val_);
862  if (a == nullptr) return b == nullptr;
863  if (b == nullptr) return false;
864  return *a == *b;
865  }
866 
867  template <class S>
868  V8_INLINE bool operator==(const Local<S>& that) const {
869  internal::Address* a = reinterpret_cast<internal::Address*>(val_);
870  internal::Address* b = reinterpret_cast<internal::Address*>(that.val_);
871  if (a == nullptr) return b == nullptr;
872  if (b == nullptr) return false;
873  return *a == *b;
874  }
875 
876  template <class S>
877  V8_INLINE bool operator!=(const TracedReferenceBase<S>& that) const {
878  return !operator==(that);
879  }
880 
881  template <class S>
882  V8_INLINE bool operator!=(const Local<S>& that) const {
883  return !operator==(that);
884  }
885 
886  /**
887  * Assigns a wrapper class ID to the handle.
888  */
889  V8_INLINE void SetWrapperClassId(uint16_t class_id);
890 
891  /**
892  * Returns the class ID previously assigned to this handle or 0 if no class ID
893  * was previously assigned.
894  */
895  V8_INLINE uint16_t WrapperClassId() const;
896 
897  template <class S>
899  return reinterpret_cast<TracedReferenceBase<S>&>(
900  const_cast<TracedReferenceBase<T>&>(*this));
901  }
902 
903  private:
904  enum DestructionMode { kWithDestructor, kWithoutDestructor };
905 
906  /**
907  * An empty TracedReferenceBase without storage cell.
908  */
909  TracedReferenceBase() = default;
910 
911  V8_INLINE static T* New(Isolate* isolate, T* that, void* slot,
912  DestructionMode destruction_mode);
913 
914  T* val_ = nullptr;
915 
916  friend class EmbedderHeapTracer;
917  template <typename F>
918  friend class Local;
919  friend class Object;
920  template <typename F>
921  friend class TracedGlobal;
922  template <typename F>
923  friend class TracedReference;
924  template <typename F>
925  friend class ReturnValue;
926 };
927 
928 /**
929  * A traced handle with destructor that clears the handle. For more details see
930  * TracedReferenceBase.
931  */
932 template <typename T>
934  public:
935  using TracedReferenceBase<T>::Reset;
936 
937  /**
938  * Destructor resetting the handle.
939  */
940  ~TracedGlobal() { this->Reset(); }
941 
942  /**
943  * An empty TracedGlobal without storage cell.
944  */
946 
947  /**
948  * Construct a TracedGlobal from a Local.
949  *
950  * When the Local is non-empty, a new storage cell is created
951  * pointing to the same object.
952  */
953  template <class S>
954  TracedGlobal(Isolate* isolate, Local<S> that) : TracedReferenceBase<T>() {
955  this->val_ = this->New(isolate, that.val_, &this->val_,
956  TracedReferenceBase<T>::kWithDestructor);
957  static_assert(std::is_base_of<T, S>::value, "type check");
958  }
959 
960  /**
961  * Move constructor initializing TracedGlobal from an existing one.
962  */
964  // Forward to operator=.
965  *this = std::move(other);
966  }
967 
968  /**
969  * Move constructor initializing TracedGlobal from an existing one.
970  */
971  template <typename S>
973  // Forward to operator=.
974  *this = std::move(other);
975  }
976 
977  /**
978  * Copy constructor initializing TracedGlobal from an existing one.
979  */
981  // Forward to operator=;
982  *this = other;
983  }
984 
985  /**
986  * Copy constructor initializing TracedGlobal from an existing one.
987  */
988  template <typename S>
990  // Forward to operator=;
991  *this = other;
992  }
993 
994  /**
995  * Move assignment operator initializing TracedGlobal from an existing one.
996  */
998 
999  /**
1000  * Move assignment operator initializing TracedGlobal from an existing one.
1001  */
1002  template <class S>
1004 
1005  /**
1006  * Copy assignment operator initializing TracedGlobal from an existing one.
1007  *
1008  * Note: Prohibited when |other| has a finalization callback set through
1009  * |SetFinalizationCallback|.
1010  */
1012 
1013  /**
1014  * Copy assignment operator initializing TracedGlobal from an existing one.
1015  *
1016  * Note: Prohibited when |other| has a finalization callback set through
1017  * |SetFinalizationCallback|.
1018  */
1019  template <class S>
1021 
1022  /**
1023  * If non-empty, destroy the underlying storage cell and create a new one with
1024  * the contents of other if other is non empty
1025  */
1026  template <class S>
1027  V8_INLINE void Reset(Isolate* isolate, const Local<S>& other);
1028 
1029  template <class S>
1030  V8_INLINE TracedGlobal<S>& As() const {
1031  return reinterpret_cast<TracedGlobal<S>&>(
1032  const_cast<TracedGlobal<T>&>(*this));
1033  }
1034 
1035  /**
1036  * Adds a finalization callback to the handle. The type of this callback is
1037  * similar to WeakCallbackType::kInternalFields, i.e., it will pass the
1038  * parameter and the first two internal fields of the object.
1039  *
1040  * The callback is then supposed to reset the handle in the callback. No
1041  * further V8 API may be called in this callback. In case additional work
1042  * involving V8 needs to be done, a second callback can be scheduled using
1043  * WeakCallbackInfo<void>::SetSecondPassCallback.
1044  */
1046  void* parameter, WeakCallbackInfo<void>::Callback callback);
1047 };
1048 
1049 /**
1050  * A traced handle without destructor that clears the handle. The embedder needs
1051  * to ensure that the handle is not accessed once the V8 object has been
1052  * reclaimed. This can happen when the handle is not passed through the
1053  * EmbedderHeapTracer. For more details see TracedReferenceBase.
1054  *
1055  * The reference assumes the embedder has precise knowledge about references at
1056  * all times. In case V8 needs to separately handle on-stack references, the
1057  * embedder is required to set the stack start through
1058  * |EmbedderHeapTracer::SetStackStart|.
1059  */
1060 template <typename T>
1062  public:
1063  using TracedReferenceBase<T>::Reset;
1064 
1065  /**
1066  * An empty TracedReference without storage cell.
1067  */
1069 
1070  /**
1071  * Construct a TracedReference from a Local.
1072  *
1073  * When the Local is non-empty, a new storage cell is created
1074  * pointing to the same object.
1075  */
1076  template <class S>
1077  TracedReference(Isolate* isolate, Local<S> that) : TracedReferenceBase<T>() {
1078  this->val_ = this->New(isolate, that.val_, &this->val_,
1079  TracedReferenceBase<T>::kWithoutDestructor);
1080  static_assert(std::is_base_of<T, S>::value, "type check");
1081  }
1082 
1083  /**
1084  * Move constructor initializing TracedReference from an
1085  * existing one.
1086  */
1088  // Forward to operator=.
1089  *this = std::move(other);
1090  }
1091 
1092  /**
1093  * Move constructor initializing TracedReference from an
1094  * existing one.
1095  */
1096  template <typename S>
1098  // Forward to operator=.
1099  *this = std::move(other);
1100  }
1101 
1102  /**
1103  * Copy constructor initializing TracedReference from an
1104  * existing one.
1105  */
1107  // Forward to operator=;
1108  *this = other;
1109  }
1110 
1111  /**
1112  * Copy constructor initializing TracedReference from an
1113  * existing one.
1114  */
1115  template <typename S>
1117  // Forward to operator=;
1118  *this = other;
1119  }
1120 
1121  /**
1122  * Move assignment operator initializing TracedGlobal from an existing one.
1123  */
1125 
1126  /**
1127  * Move assignment operator initializing TracedGlobal from an existing one.
1128  */
1129  template <class S>
1131 
1132  /**
1133  * Copy assignment operator initializing TracedGlobal from an existing one.
1134  */
1136 
1137  /**
1138  * Copy assignment operator initializing TracedGlobal from an existing one.
1139  */
1140  template <class S>
1142 
1143  /**
1144  * If non-empty, destroy the underlying storage cell and create a new one with
1145  * the contents of other if other is non empty
1146  */
1147  template <class S>
1148  V8_INLINE void Reset(Isolate* isolate, const Local<S>& other);
1149 
1150  template <class S>
1152  return reinterpret_cast<TracedReference<S>&>(
1153  const_cast<TracedReference<T>&>(*this));
1154  }
1155 };
1156 
1157  /**
1158  * A stack-allocated class that governs a number of local handles.
1159  * After a handle scope has been created, all local handles will be
1160  * allocated within that handle scope until either the handle scope is
1161  * deleted or another handle scope is created. If there is already a
1162  * handle scope and a new one is created, all allocations will take
1163  * place in the new handle scope until it is deleted. After that,
1164  * new handles will again be allocated in the original handle scope.
1165  *
1166  * After the handle scope of a local handle has been deleted the
1167  * garbage collector will no longer track the object stored in the
1168  * handle and may deallocate it. The behavior of accessing a handle
1169  * for which the handle scope has been deleted is undefined.
1170  */
1172  public:
1173  explicit HandleScope(Isolate* isolate);
1174 
1176 
1177  /**
1178  * Counts the number of allocated handles.
1179  */
1180  static int NumberOfHandles(Isolate* isolate);
1181 
1183  return reinterpret_cast<Isolate*>(isolate_);
1184  }
1185 
1186  HandleScope(const HandleScope&) = delete;
1187  void operator=(const HandleScope&) = delete;
1188 
1189  protected:
1190  V8_INLINE HandleScope() = default;
1191 
1192  void Initialize(Isolate* isolate);
1193 
1194  static internal::Address* CreateHandle(internal::Isolate* isolate,
1195  internal::Address value);
1196 
1197  private:
1198  // Declaring operator new and delete as deleted is not spec compliant.
1199  // Therefore declare them private instead to disable dynamic alloc
1200  void* operator new(size_t size);
1201  void* operator new[](size_t size);
1202  void operator delete(void*, size_t);
1203  void operator delete[](void*, size_t);
1204 
1205  internal::Isolate* isolate_;
1206  internal::Address* prev_next_;
1207  internal::Address* prev_limit_;
1208 
1209  // Local::New uses CreateHandle with an Isolate* parameter.
1210  template<class F> friend class Local;
1211 
1212  // Object::GetInternalField and Context::GetEmbedderData use CreateHandle with
1213  // a HeapObject in their shortcuts.
1214  friend class Object;
1215  friend class Context;
1216 };
1217 
1218 
1219 /**
1220  * A HandleScope which first allocates a handle in the current scope
1221  * which will be later filled with the escape value.
1222  */
1224  public:
1225  explicit EscapableHandleScope(Isolate* isolate);
1227 
1228  /**
1229  * Pushes the value into the previous scope and returns a handle to it.
1230  * Cannot be called twice.
1231  */
1232  template <class T>
1233  V8_INLINE Local<T> Escape(Local<T> value) {
1234  internal::Address* slot =
1235  Escape(reinterpret_cast<internal::Address*>(*value));
1236  return Local<T>(reinterpret_cast<T*>(slot));
1237  }
1238 
1239  template <class T>
1241  return Escape(value.FromMaybe(Local<T>()));
1242  }
1243 
1245  void operator=(const EscapableHandleScope&) = delete;
1246 
1247  private:
1248  // Declaring operator new and delete as deleted is not spec compliant.
1249  // Therefore declare them private instead to disable dynamic alloc
1250  void* operator new(size_t size);
1251  void* operator new[](size_t size);
1252  void operator delete(void*, size_t);
1253  void operator delete[](void*, size_t);
1254 
1255  internal::Address* Escape(internal::Address* escape_value);
1256  internal::Address* escape_slot_;
1257 };
1258 
1259 /**
1260  * A SealHandleScope acts like a handle scope in which no handle allocations
1261  * are allowed. It can be useful for debugging handle leaks.
1262  * Handles can be allocated within inner normal HandleScopes.
1263  */
1265  public:
1266  explicit SealHandleScope(Isolate* isolate);
1268 
1270  void operator=(const SealHandleScope&) = delete;
1271 
1272  private:
1273  // Declaring operator new and delete as deleted is not spec compliant.
1274  // Therefore declare them private instead to disable dynamic alloc
1275  void* operator new(size_t size);
1276  void* operator new[](size_t size);
1277  void operator delete(void*, size_t);
1278  void operator delete[](void*, size_t);
1279 
1280  internal::Isolate* const isolate_;
1281  internal::Address* prev_limit_;
1282  int prev_sealed_level_;
1283 };
1284 
1285 
1286 // --- Special objects ---
1287 
1288 /**
1289  * The superclass of objects that can reside on V8's heap.
1290  */
1292  private:
1293  Data();
1294 };
1295 
1296 /**
1297  * A container type that holds relevant metadata for module loading.
1298  *
1299  * This is passed back to the embedder as part of
1300  * HostImportModuleDynamicallyCallback for module loading.
1301  */
1303  public:
1304  /**
1305  * The name that was passed by the embedder as ResourceName to the
1306  * ScriptOrigin. This can be either a v8::String or v8::Undefined.
1307  */
1309 
1310  /**
1311  * The options that were passed by the embedder as HostDefinedOptions to
1312  * the ScriptOrigin.
1313  */
1315 };
1316 
1317 /**
1318  * An array to hold Primitive values. This is used by the embedder to
1319  * pass host defined options to the ScriptOptions during compilation.
1320  *
1321  * This is passed back to the embedder as part of
1322  * HostImportModuleDynamicallyCallback for module loading.
1323  *
1324  */
1326  public:
1327  static Local<PrimitiveArray> New(Isolate* isolate, int length);
1328  int Length() const;
1329  void Set(Isolate* isolate, int index, Local<Primitive> item);
1330  Local<Primitive> Get(Isolate* isolate, int index);
1331 };
1332 
1333 /**
1334  * The optional attributes of ScriptOrigin.
1335  */
1337  public:
1338  V8_INLINE ScriptOriginOptions(bool is_shared_cross_origin = false,
1339  bool is_opaque = false, bool is_wasm = false,
1340  bool is_module = false)
1341  : flags_((is_shared_cross_origin ? kIsSharedCrossOrigin : 0) |
1342  (is_wasm ? kIsWasm : 0) | (is_opaque ? kIsOpaque : 0) |
1343  (is_module ? kIsModule : 0)) {}
1345  : flags_(flags &
1346  (kIsSharedCrossOrigin | kIsOpaque | kIsWasm | kIsModule)) {}
1347 
1348  bool IsSharedCrossOrigin() const {
1349  return (flags_ & kIsSharedCrossOrigin) != 0;
1350  }
1351  bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; }
1352  bool IsWasm() const { return (flags_ & kIsWasm) != 0; }
1353  bool IsModule() const { return (flags_ & kIsModule) != 0; }
1354 
1355  int Flags() const { return flags_; }
1356 
1357  private:
1358  enum {
1359  kIsSharedCrossOrigin = 1,
1360  kIsOpaque = 1 << 1,
1361  kIsWasm = 1 << 2,
1362  kIsModule = 1 << 3
1363  };
1364  const int flags_;
1365 };
1366 
1367 /**
1368  * The origin, within a file, of a script.
1369  */
1371  public:
1373  Local<Value> resource_name,
1374  Local<Integer> resource_line_offset = Local<Integer>(),
1375  Local<Integer> resource_column_offset = Local<Integer>(),
1376  Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(),
1377  Local<Integer> script_id = Local<Integer>(),
1378  Local<Value> source_map_url = Local<Value>(),
1379  Local<Boolean> resource_is_opaque = Local<Boolean>(),
1380  Local<Boolean> is_wasm = Local<Boolean>(),
1381  Local<Boolean> is_module = Local<Boolean>(),
1382  Local<PrimitiveArray> host_defined_options = Local<PrimitiveArray>());
1383 
1384  V8_INLINE Local<Value> ResourceName() const;
1387  V8_INLINE Local<Integer> ScriptID() const;
1388  V8_INLINE Local<Value> SourceMapUrl() const;
1390  V8_INLINE ScriptOriginOptions Options() const { return options_; }
1391 
1392  private:
1393  Local<Value> resource_name_;
1394  Local<Integer> resource_line_offset_;
1395  Local<Integer> resource_column_offset_;
1396  ScriptOriginOptions options_;
1397  Local<Integer> script_id_;
1398  Local<Value> source_map_url_;
1399  Local<PrimitiveArray> host_defined_options_;
1400 };
1401 
1402 /**
1403  * A compiled JavaScript script, not yet tied to a Context.
1404  */
1406  public:
1407  /**
1408  * Binds the script to the currently entered context.
1409  */
1411 
1412  int GetId();
1414 
1415  /**
1416  * Data read from magic sourceURL comments.
1417  */
1419  /**
1420  * Data read from magic sourceMappingURL comments.
1421  */
1423 
1424  /**
1425  * Returns zero based line number of the code_pos location in the script.
1426  * -1 will be returned if no information available.
1427  */
1428  int GetLineNumber(int code_pos);
1429 
1430  static const int kNoScriptId = 0;
1431 };
1432 
1433 /**
1434  * A compiled JavaScript module, not yet tied to a Context.
1435  */
1437  // Only used as a container for code caching.
1438 };
1439 
1440 /**
1441  * A location in JavaScript source.
1442  */
1444  public:
1445  int GetLineNumber() { return line_number_; }
1446  int GetColumnNumber() { return column_number_; }
1447 
1448  Location(int line_number, int column_number)
1449  : line_number_(line_number), column_number_(column_number) {}
1450 
1451  private:
1452  int line_number_;
1453  int column_number_;
1454 };
1455 
1456 /**
1457  * A compiled JavaScript module.
1458  */
1459 class V8_EXPORT Module : public Data {
1460  public:
1461  /**
1462  * The different states a module can be in.
1463  *
1464  * This corresponds to the states used in ECMAScript except that "evaluated"
1465  * is split into kEvaluated and kErrored, indicating success and failure,
1466  * respectively.
1467  */
1468  enum Status {
1474  kErrored
1475  };
1476 
1477  /**
1478  * Returns the module's current status.
1479  */
1481 
1482  /**
1483  * For a module in kErrored status, this returns the corresponding exception.
1484  */
1486 
1487  /**
1488  * Returns the number of modules requested by this module.
1489  */
1491 
1492  /**
1493  * Returns the ith module specifier in this module.
1494  * i must be < GetModuleRequestsLength() and >= 0.
1495  */
1497 
1498  /**
1499  * Returns the source location (line number and column number) of the ith
1500  * module specifier's first occurrence in this module.
1501  */
1503 
1504  /**
1505  * Returns the identity hash for this object.
1506  */
1507  int GetIdentityHash() const;
1508 
1510  Local<String> specifier,
1511  Local<Module> referrer);
1512 
1513  /**
1514  * Instantiates the module and its dependencies.
1515  *
1516  * Returns an empty Maybe<bool> if an exception occurred during
1517  * instantiation. (In the case where the callback throws an exception, that
1518  * exception is propagated.)
1519  */
1521  ResolveCallback callback);
1522 
1523  /**
1524  * Evaluates the module and its dependencies.
1525  *
1526  * If status is kInstantiated, run the module's code. On success, set status
1527  * to kEvaluated and return the completion value; on failure, set status to
1528  * kErrored and propagate the thrown exception (which is then also available
1529  * via |GetException|).
1530  */
1532 
1533  /**
1534  * Returns the namespace object of this module.
1535  *
1536  * The module's status must be at least kInstantiated.
1537  */
1539 
1540  /**
1541  * Returns the corresponding context-unbound module script.
1542  *
1543  * The module must be unevaluated, i.e. its status must not be kEvaluating,
1544  * kEvaluated or kErrored.
1545  */
1547 
1548  /*
1549  * Callback defined in the embedder. This is responsible for setting
1550  * the module's exported values with calls to SetSyntheticModuleExport().
1551  * The callback must return a Value to indicate success (where no
1552  * exception was thrown) and return an empy MaybeLocal to indicate falure
1553  * (where an exception was thrown).
1554  */
1556  Local<Context> context, Local<Module> module);
1557 
1558  /**
1559  * Creates a new SyntheticModule with the specified export names, where
1560  * evaluation_steps will be executed upon module evaluation.
1561  * export_names must not contain duplicates.
1562  * module_name is used solely for logging/debugging and doesn't affect module
1563  * behavior.
1564  */
1566  Isolate* isolate, Local<String> module_name,
1567  const std::vector<Local<String>>& export_names,
1568  SyntheticModuleEvaluationSteps evaluation_steps);
1569 
1570  /**
1571  * Set this module's exported value for the name export_name to the specified
1572  * export_value. This method must be called only on Modules created via
1573  * CreateSyntheticModule. An error will be thrown if export_name is not one
1574  * of the export_names that were passed in that CreateSyntheticModule call.
1575  * Returns Just(true) on success, Nothing<bool>() if an error was thrown.
1576  */
1578  Isolate* isolate, Local<String> export_name, Local<Value> export_value);
1580  "Use the preceding SetSyntheticModuleExport with an Isolate parameter, "
1581  "instead of the one that follows. The former will throw a runtime "
1582  "error if called for an export that doesn't exist (as per spec); "
1583  "the latter will crash with a failed CHECK().")
1584  void SetSyntheticModuleExport(Local<String> export_name,
1586 };
1587 
1588 /**
1589  * A compiled JavaScript script, tied to a Context which was active when the
1590  * script was compiled.
1591  */
1593  public:
1594  /**
1595  * A shorthand for ScriptCompiler::Compile().
1596  */
1598  Local<Context> context, Local<String> source,
1599  ScriptOrigin* origin = nullptr);
1600 
1601  /**
1602  * Runs the script returning the resulting value. It will be run in the
1603  * context in which it was created (ScriptCompiler::CompileBound or
1604  * UnboundScript::BindToCurrentContext()).
1605  */
1607 
1608  /**
1609  * Returns the corresponding context-unbound script.
1610  */
1612 };
1613 
1614 
1615 /**
1616  * For compiling scripts.
1617  */
1619  public:
1620  /**
1621  * Compilation data that the embedder can cache and pass back to speed up
1622  * future compilations. The data is produced if the CompilerOptions passed to
1623  * the compilation functions in ScriptCompiler contains produce_data_to_cache
1624  * = true. The data to cache can then can be retrieved from
1625  * UnboundScript.
1626  */
1630  BufferOwned
1631  };
1632 
1634  : data(nullptr),
1635  length(0),
1636  rejected(false),
1638 
1639  // If buffer_policy is BufferNotOwned, the caller keeps the ownership of
1640  // data and guarantees that it stays alive until the CachedData object is
1641  // destroyed. If the policy is BufferOwned, the given data will be deleted
1642  // (with delete[]) when the CachedData object is destroyed.
1643  CachedData(const uint8_t* data, int length,
1644  BufferPolicy buffer_policy = BufferNotOwned);
1646  // TODO(marja): Async compilation; add constructors which take a callback
1647  // which will be called when V8 no longer needs the data.
1648  const uint8_t* data;
1649  int length;
1650  bool rejected;
1652 
1653  // Prevent copying.
1654  CachedData(const CachedData&) = delete;
1655  CachedData& operator=(const CachedData&) = delete;
1656  };
1657 
1658  /**
1659  * Source code which can be then compiled to a UnboundScript or Script.
1660  */
1661  class Source {
1662  public:
1663  // Source takes ownership of CachedData.
1664  V8_INLINE Source(Local<String> source_string, const ScriptOrigin& origin,
1665  CachedData* cached_data = nullptr);
1666  V8_INLINE Source(Local<String> source_string,
1667  CachedData* cached_data = nullptr);
1668  V8_INLINE ~Source();
1669 
1670  // Ownership of the CachedData or its buffers is *not* transferred to the
1671  // caller. The CachedData object is alive as long as the Source object is
1672  // alive.
1673  V8_INLINE const CachedData* GetCachedData() const;
1674 
1676 
1677  // Prevent copying.
1678  Source(const Source&) = delete;
1679  Source& operator=(const Source&) = delete;
1680 
1681  private:
1682  friend class ScriptCompiler;
1683 
1684  Local<String> source_string;
1685 
1686  // Origin information
1687  Local<Value> resource_name;
1688  Local<Integer> resource_line_offset;
1689  Local<Integer> resource_column_offset;
1690  ScriptOriginOptions resource_options;
1691  Local<Value> source_map_url;
1692  Local<PrimitiveArray> host_defined_options;
1693 
1694  // Cached data from previous compilation (if a kConsume*Cache flag is
1695  // set), or hold newly generated cache data (kProduce*Cache flags) are
1696  // set when calling a compile method.
1697  CachedData* cached_data;
1698  };
1699 
1700  /**
1701  * For streaming incomplete script data to V8. The embedder should implement a
1702  * subclass of this class.
1703  */
1705  public:
1706  virtual ~ExternalSourceStream() = default;
1707 
1708  /**
1709  * V8 calls this to request the next chunk of data from the embedder. This
1710  * function will be called on a background thread, so it's OK to block and
1711  * wait for the data, if the embedder doesn't have data yet. Returns the
1712  * length of the data returned. When the data ends, GetMoreData should
1713  * return 0. Caller takes ownership of the data.
1714  *
1715  * When streaming UTF-8 data, V8 handles multi-byte characters split between
1716  * two data chunks, but doesn't handle multi-byte characters split between
1717  * more than two data chunks. The embedder can avoid this problem by always
1718  * returning at least 2 bytes of data.
1719  *
1720  * When streaming UTF-16 data, V8 does not handle characters split between
1721  * two data chunks. The embedder has to make sure that chunks have an even
1722  * length.
1723  *
1724  * If the embedder wants to cancel the streaming, they should make the next
1725  * GetMoreData call return 0. V8 will interpret it as end of data (and most
1726  * probably, parsing will fail). The streaming task will return as soon as
1727  * V8 has parsed the data it received so far.
1728  */
1729  virtual size_t GetMoreData(const uint8_t** src) = 0;
1730 
1731  /**
1732  * V8 calls this method to set a 'bookmark' at the current position in
1733  * the source stream, for the purpose of (maybe) later calling
1734  * ResetToBookmark. If ResetToBookmark is called later, then subsequent
1735  * calls to GetMoreData should return the same data as they did when
1736  * SetBookmark was called earlier.
1737  *
1738  * The embedder may return 'false' to indicate it cannot provide this
1739  * functionality.
1740  */
1741  virtual bool SetBookmark();
1742 
1743  /**
1744  * V8 calls this to return to a previously set bookmark.
1745  */
1746  virtual void ResetToBookmark();
1747  };
1748 
1749  /**
1750  * Source code which can be streamed into V8 in pieces. It will be parsed
1751  * while streaming and compiled after parsing has completed. StreamedSource
1752  * must be kept alive while the streaming task is run (see ScriptStreamingTask
1753  * below).
1754  */
1756  public:
1758 
1760  "This class takes ownership of source_stream, so use the constructor "
1761  "taking a unique_ptr to make these semantics clearer")
1762  StreamedSource(ExternalSourceStream* source_stream, Encoding encoding);
1763  StreamedSource(std::unique_ptr<ExternalSourceStream> source_stream,
1764  Encoding encoding);
1766 
1767  internal::ScriptStreamingData* impl() const { return impl_.get(); }
1768 
1769  // Prevent copying.
1770  StreamedSource(const StreamedSource&) = delete;
1772 
1773  private:
1774  std::unique_ptr<internal::ScriptStreamingData> impl_;
1775  };
1776 
1777  /**
1778  * A streaming task which the embedder must run on a background thread to
1779  * stream scripts into V8. Returned by ScriptCompiler::StartStreamingScript.
1780  */
1781  class V8_EXPORT ScriptStreamingTask final {
1782  public:
1783  void Run();
1784 
1785  private:
1786  friend class ScriptCompiler;
1787 
1788  explicit ScriptStreamingTask(internal::ScriptStreamingData* data)
1789  : data_(data) {}
1790 
1791  internal::ScriptStreamingData* data_;
1792  };
1793 
1798  };
1799 
1800  /**
1801  * The reason for which we are not requesting or providing a code cache.
1802  */
1819  };
1820 
1821  /**
1822  * Compiles the specified script (context-independent).
1823  * Cached data as part of the source object can be optionally produced to be
1824  * consumed later to speed up compilation of identical source scripts.
1825  *
1826  * Note that when producing cached data, the source must point to NULL for
1827  * cached data. When consuming cached data, the cached data must have been
1828  * produced by the same version of V8.
1829  *
1830  * \param source Script source code.
1831  * \return Compiled script object (context independent; for running it must be
1832  * bound to a context).
1833  */
1835  Isolate* isolate, Source* source,
1837  NoCacheReason no_cache_reason = kNoCacheNoReason);
1838 
1839  /**
1840  * Compiles the specified script (bound to current context).
1841  *
1842  * \param source Script source code.
1843  * \param pre_data Pre-parsing data, as obtained by ScriptData::PreCompile()
1844  * using pre_data speeds compilation if it's done multiple times.
1845  * Owned by caller, no references are kept when this function returns.
1846  * \return Compiled script object, bound to the context that was active
1847  * when this function was called. When run it will always use this
1848  * context.
1849  */
1851  Local<Context> context, Source* source,
1853  NoCacheReason no_cache_reason = kNoCacheNoReason);
1854 
1855  /**
1856  * Returns a task which streams script data into V8, or NULL if the script
1857  * cannot be streamed. The user is responsible for running the task on a
1858  * background thread and deleting it. When ran, the task starts parsing the
1859  * script, and it will request data from the StreamedSource as needed. When
1860  * ScriptStreamingTask::Run exits, all data has been streamed and the script
1861  * can be compiled (see Compile below).
1862  *
1863  * This API allows to start the streaming with as little data as possible, and
1864  * the remaining data (for example, the ScriptOrigin) is passed to Compile.
1865  */
1866  static ScriptStreamingTask* StartStreamingScript(
1867  Isolate* isolate, StreamedSource* source,
1868  CompileOptions options = kNoCompileOptions);
1869 
1870  /**
1871  * Compiles a streamed script (bound to current context).
1872  *
1873  * This can only be called after the streaming has finished
1874  * (ScriptStreamingTask has been run). V8 doesn't construct the source string
1875  * during streaming, so the embedder needs to pass the full source here.
1876  */
1878  Local<Context> context, StreamedSource* source,
1879  Local<String> full_source_string, const ScriptOrigin& origin);
1880 
1881  /**
1882  * Return a version tag for CachedData for the current V8 version & flags.
1883  *
1884  * This value is meant only for determining whether a previously generated
1885  * CachedData instance is still valid; the tag has no other meaing.
1886  *
1887  * Background: The data carried by CachedData may depend on the exact
1888  * V8 version number or current compiler flags. This means that when
1889  * persisting CachedData, the embedder must take care to not pass in
1890  * data from another V8 version, or the same version with different
1891  * features enabled.
1892  *
1893  * The easiest way to do so is to clear the embedder's cache on any
1894  * such change.
1895  *
1896  * Alternatively, this tag can be stored alongside the cached data and
1897  * compared when it is being used.
1898  */
1899  static uint32_t CachedDataVersionTag();
1900 
1901  /**
1902  * Compile an ES module, returning a Module that encapsulates
1903  * the compiled code.
1904  *
1905  * Corresponds to the ParseModule abstract operation in the
1906  * ECMAScript specification.
1907  */
1909  Isolate* isolate, Source* source,
1911  NoCacheReason no_cache_reason = kNoCacheNoReason);
1912 
1913  /**
1914  * Compile a function for a given context. This is equivalent to running
1915  *
1916  * with (obj) {
1917  * return function(args) { ... }
1918  * }
1919  *
1920  * It is possible to specify multiple context extensions (obj in the above
1921  * example).
1922  */
1924  Local<Context> context, Source* source, size_t arguments_count,
1925  Local<String> arguments[], size_t context_extension_count,
1926  Local<Object> context_extensions[],
1928  NoCacheReason no_cache_reason = kNoCacheNoReason,
1929  Local<ScriptOrModule>* script_or_module_out = nullptr);
1930 
1931  /**
1932  * Creates and returns code cache for the specified unbound_script.
1933  * This will return nullptr if the script cannot be serialized. The
1934  * CachedData returned by this function should be owned by the caller.
1935  */
1936  static CachedData* CreateCodeCache(Local<UnboundScript> unbound_script);
1937 
1938  /**
1939  * Creates and returns code cache for the specified unbound_module_script.
1940  * This will return nullptr if the script cannot be serialized. The
1941  * CachedData returned by this function should be owned by the caller.
1942  */
1944  Local<UnboundModuleScript> unbound_module_script);
1945 
1946  /**
1947  * Creates and returns code cache for the specified function that was
1948  * previously produced by CompileFunctionInContext.
1949  * This will return nullptr if the script cannot be serialized. The
1950  * CachedData returned by this function should be owned by the caller.
1951  */
1953 
1954  private:
1955  static V8_WARN_UNUSED_RESULT MaybeLocal<UnboundScript> CompileUnboundInternal(
1956  Isolate* isolate, Source* source, CompileOptions options,
1957  NoCacheReason no_cache_reason);
1958 };
1959 
1960 
1961 /**
1962  * An error message.
1963  */
1965  public:
1966  Local<String> Get() const;
1967 
1968  /**
1969  * Return the isolate to which the Message belongs.
1970  */
1972 
1974  Local<Context> context) const;
1975 
1976  /**
1977  * Returns the origin for the script from where the function causing the
1978  * error originates.
1979  */
1981 
1982  /**
1983  * Returns the resource name for the script from where the function causing
1984  * the error originates.
1985  */
1987 
1988  /**
1989  * Exception stack trace. By default stack traces are not captured for
1990  * uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows
1991  * to change this option.
1992  */
1994 
1995  /**
1996  * Returns the number, 1-based, of the line where the error occurred.
1997  */
1999 
2000  /**
2001  * Returns the index within the script of the first character where
2002  * the error occurred.
2003  */
2004  int GetStartPosition() const;
2005 
2006  /**
2007  * Returns the index within the script of the last character where
2008  * the error occurred.
2009  */
2010  int GetEndPosition() const;
2011 
2012  /**
2013  * Returns the Wasm function index where the error occurred. Returns -1 if
2014  * message is not from a Wasm script.
2015  */
2017 
2018  /**
2019  * Returns the error level of the message.
2020  */
2021  int ErrorLevel() const;
2022 
2023  /**
2024  * Returns the index within the line of the first character where
2025  * the error occurred.
2026  */
2027  int GetStartColumn() const;
2029 
2030  /**
2031  * Returns the index within the line of the last character where
2032  * the error occurred.
2033  */
2034  int GetEndColumn() const;
2036 
2037  /**
2038  * Passes on the value set by the embedder when it fed the script from which
2039  * this Message was generated to V8.
2040  */
2041  bool IsSharedCrossOrigin() const;
2042  bool IsOpaque() const;
2043 
2044  // TODO(1245381): Print to a string instead of on a FILE.
2045  static void PrintCurrentStackTrace(Isolate* isolate, FILE* out);
2046 
2047  static const int kNoLineNumberInfo = 0;
2048  static const int kNoColumnInfo = 0;
2049  static const int kNoScriptIdInfo = 0;
2050  static const int kNoWasmFunctionIndexInfo = -1;
2051 };
2052 
2053 
2054 /**
2055  * Representation of a JavaScript stack trace. The information collected is a
2056  * snapshot of the execution stack and the information remains valid after
2057  * execution continues.
2058  */
2060  public:
2061  /**
2062  * Flags that determine what information is placed captured for each
2063  * StackFrame when grabbing the current stack trace.
2064  * Note: these options are deprecated and we always collect all available
2065  * information (kDetailed).
2066  */
2070  kScriptName = 1 << 2,
2071  kFunctionName = 1 << 3,
2072  kIsEval = 1 << 4,
2073  kIsConstructor = 1 << 5,
2075  kScriptId = 1 << 7,
2079  };
2080 
2081  /**
2082  * Returns a StackFrame at a particular index.
2083  */
2084  Local<StackFrame> GetFrame(Isolate* isolate, uint32_t index) const;
2085 
2086  /**
2087  * Returns the number of StackFrames.
2088  */
2089  int GetFrameCount() const;
2090 
2091  /**
2092  * Grab a snapshot of the current JavaScript execution stack.
2093  *
2094  * \param frame_limit The maximum number of stack frames we want to capture.
2095  * \param options Enumerates the set of things we will capture for each
2096  * StackFrame.
2097  */
2099  Isolate* isolate, int frame_limit, StackTraceOptions options = kDetailed);
2100 };
2101 
2102 
2103 /**
2104  * A single JavaScript stack frame.
2105  */
2107  public:
2108  /**
2109  * Returns the number, 1-based, of the line for the associate function call.
2110  * This method will return Message::kNoLineNumberInfo if it is unable to
2111  * retrieve the line number, or if kLineNumber was not passed as an option
2112  * when capturing the StackTrace.
2113  */
2114  int GetLineNumber() const;
2115 
2116  /**
2117  * Returns the 1-based column offset on the line for the associated function
2118  * call.
2119  * This method will return Message::kNoColumnInfo if it is unable to retrieve
2120  * the column number, or if kColumnOffset was not passed as an option when
2121  * capturing the StackTrace.
2122  */
2123  int GetColumn() const;
2124 
2125  /**
2126  * Returns the id of the script for the function for this StackFrame.
2127  * This method will return Message::kNoScriptIdInfo if it is unable to
2128  * retrieve the script id, or if kScriptId was not passed as an option when
2129  * capturing the StackTrace.
2130  */
2131  int GetScriptId() const;
2132 
2133  /**
2134  * Returns the name of the resource that contains the script for the
2135  * function for this StackFrame.
2136  */
2138 
2139  /**
2140  * Returns the name of the resource that contains the script for the
2141  * function for this StackFrame or sourceURL value if the script name
2142  * is undefined and its source ends with //# sourceURL=... string or
2143  * deprecated //@ sourceURL=... string.
2144  */
2146 
2147  /**
2148  * Returns the name of the function associated with this stack frame.
2149  */
2151 
2152  /**
2153  * Returns whether or not the associated function is compiled via a call to
2154  * eval().
2155  */
2156  bool IsEval() const;
2157 
2158  /**
2159  * Returns whether or not the associated function is called as a
2160  * constructor via "new".
2161  */
2162  bool IsConstructor() const;
2163 
2164  /**
2165  * Returns whether or not the associated functions is defined in wasm.
2166  */
2167  bool IsWasm() const;
2168 
2169  /**
2170  * Returns whether or not the associated function is defined by the user.
2171  */
2172  bool IsUserJavaScript() const;
2173 };
2174 
2175 
2176 // A StateTag represents a possible state of the VM.
2177 enum StateTag {
2186  IDLE
2187 };
2188 
2189 // A RegisterState represents the current state of registers used
2190 // by the sampling profiler API.
2192  RegisterState() : pc(nullptr), sp(nullptr), fp(nullptr), lr(nullptr) {}
2193  void* pc; // Instruction pointer.
2194  void* sp; // Stack pointer.
2195  void* fp; // Frame pointer.
2196  void* lr; // Link register (or nullptr on platforms without a link register).
2197 };
2198 
2199 // The output structure filled up by GetStackSample API function.
2200 struct SampleInfo {
2201  size_t frames_count; // Number of frames collected.
2202  StateTag vm_state; // Current VM state.
2203  void* external_callback_entry; // External callback address if VM is
2204  // executing an external callback.
2205  void* top_context; // Incumbent native context address.
2206 };
2207 
2208 struct MemoryRange {
2209  const void* start = nullptr;
2210  size_t length_in_bytes = 0;
2211 };
2212 
2213 struct JSEntryStub {
2215 };
2216 
2217 struct UnwindState {
2223 };
2224 
2229 };
2230 
2231 /**
2232  * A JSON Parser and Stringifier.
2233  */
2235  public:
2236  /**
2237  * Tries to parse the string |json_string| and returns it as value if
2238  * successful.
2239  *
2240  * \param the context in which to parse and create the value.
2241  * \param json_string The string to parse.
2242  * \return The corresponding value if successfully parsed.
2243  */
2245  Local<Context> context, Local<String> json_string);
2246 
2247  /**
2248  * Tries to stringify the JSON-serializable object |json_object| and returns
2249  * it as string if successful.
2250  *
2251  * \param json_object The JSON-serializable object to stringify.
2252  * \return The corresponding string if successfully stringified.
2253  */
2255  Local<Context> context, Local<Value> json_object,
2256  Local<String> gap = Local<String>());
2257 };
2258 
2259 /**
2260  * Value serialization compatible with the HTML structured clone algorithm.
2261  * The format is backward-compatible (i.e. safe to store to disk).
2262  */
2264  public:
2266  public:
2267  virtual ~Delegate() = default;
2268 
2269  /**
2270  * Handles the case where a DataCloneError would be thrown in the structured
2271  * clone spec. Other V8 embedders may throw some other appropriate exception
2272  * type.
2273  */
2274  virtual void ThrowDataCloneError(Local<String> message) = 0;
2275 
2276  /**
2277  * The embedder overrides this method to write some kind of host object, if
2278  * possible. If not, a suitable exception should be thrown and
2279  * Nothing<bool>() returned.
2280  */
2281  virtual Maybe<bool> WriteHostObject(Isolate* isolate, Local<Object> object);
2282 
2283  /**
2284  * Called when the ValueSerializer is going to serialize a
2285  * SharedArrayBuffer object. The embedder must return an ID for the
2286  * object, using the same ID if this SharedArrayBuffer has already been
2287  * serialized in this buffer. When deserializing, this ID will be passed to
2288  * ValueDeserializer::GetSharedArrayBufferFromId as |clone_id|.
2289  *
2290  * If the object cannot be serialized, an
2291  * exception should be thrown and Nothing<uint32_t>() returned.
2292  */
2293  virtual Maybe<uint32_t> GetSharedArrayBufferId(
2294  Isolate* isolate, Local<SharedArrayBuffer> shared_array_buffer);
2295 
2296  virtual Maybe<uint32_t> GetWasmModuleTransferId(
2297  Isolate* isolate, Local<WasmModuleObject> module);
2298  /**
2299  * Allocates memory for the buffer of at least the size provided. The actual
2300  * size (which may be greater or equal) is written to |actual_size|. If no
2301  * buffer has been allocated yet, nullptr will be provided.
2302  *
2303  * If the memory cannot be allocated, nullptr should be returned.
2304  * |actual_size| will be ignored. It is assumed that |old_buffer| is still
2305  * valid in this case and has not been modified.
2306  *
2307  * The default implementation uses the stdlib's `realloc()` function.
2308  */
2309  virtual void* ReallocateBufferMemory(void* old_buffer, size_t size,
2310  size_t* actual_size);
2311 
2312  /**
2313  * Frees a buffer allocated with |ReallocateBufferMemory|.
2314  *
2315  * The default implementation uses the stdlib's `free()` function.
2316  */
2317  virtual void FreeBufferMemory(void* buffer);
2318  };
2319 
2320  explicit ValueSerializer(Isolate* isolate);
2321  ValueSerializer(Isolate* isolate, Delegate* delegate);
2323 
2324  /**
2325  * Writes out a header, which includes the format version.
2326  */
2327  void WriteHeader();
2328 
2329  /**
2330  * Serializes a JavaScript value into the buffer.
2331  */
2333  Local<Value> value);
2334 
2335  /**
2336  * Returns the stored data (allocated using the delegate's
2337  * ReallocateBufferMemory) and its size. This serializer should not be used
2338  * once the buffer is released. The contents are undefined if a previous write
2339  * has failed. Ownership of the buffer is transferred to the caller.
2340  */
2341  V8_WARN_UNUSED_RESULT std::pair<uint8_t*, size_t> Release();
2342 
2343  /**
2344  * Marks an ArrayBuffer as havings its contents transferred out of band.
2345  * Pass the corresponding ArrayBuffer in the deserializing context to
2346  * ValueDeserializer::TransferArrayBuffer.
2347  */
2348  void TransferArrayBuffer(uint32_t transfer_id,
2349  Local<ArrayBuffer> array_buffer);
2350 
2351 
2352  /**
2353  * Indicate whether to treat ArrayBufferView objects as host objects,
2354  * i.e. pass them to Delegate::WriteHostObject. This should not be
2355  * called when no Delegate was passed.
2356  *
2357  * The default is not to treat ArrayBufferViews as host objects.
2358  */
2360 
2361  /**
2362  * Write raw data in various common formats to the buffer.
2363  * Note that integer types are written in base-128 varint format, not with a
2364  * binary copy. For use during an override of Delegate::WriteHostObject.
2365  */
2366  void WriteUint32(uint32_t value);
2367  void WriteUint64(uint64_t value);
2368  void WriteDouble(double value);
2369  void WriteRawBytes(const void* source, size_t length);
2370 
2372  void operator=(const ValueSerializer&) = delete;
2373 
2374  private:
2375  struct PrivateData;
2376  PrivateData* private_;
2377 };
2378 
2379 /**
2380  * Deserializes values from data written with ValueSerializer, or a compatible
2381  * implementation.
2382  */
2384  public:
2386  public:
2387  virtual ~Delegate() = default;
2388 
2389  /**
2390  * The embedder overrides this method to read some kind of host object, if
2391  * possible. If not, a suitable exception should be thrown and
2392  * MaybeLocal<Object>() returned.
2393  */
2395 
2396  /**
2397  * Get a WasmModuleObject given a transfer_id previously provided
2398  * by ValueSerializer::GetWasmModuleTransferId
2399  */
2401  Isolate* isolate, uint32_t transfer_id);
2402 
2403  /**
2404  * Get a SharedArrayBuffer given a clone_id previously provided
2405  * by ValueSerializer::GetSharedArrayBufferId
2406  */
2408  Isolate* isolate, uint32_t clone_id);
2409  };
2410 
2411  ValueDeserializer(Isolate* isolate, const uint8_t* data, size_t size);
2412  ValueDeserializer(Isolate* isolate, const uint8_t* data, size_t size,
2413  Delegate* delegate);
2415 
2416  /**
2417  * Reads and validates a header (including the format version).
2418  * May, for example, reject an invalid or unsupported wire format.
2419  */
2421 
2422  /**
2423  * Deserializes a JavaScript value from the buffer.
2424  */
2426 
2427  /**
2428  * Accepts the array buffer corresponding to the one passed previously to
2429  * ValueSerializer::TransferArrayBuffer.
2430  */
2431  void TransferArrayBuffer(uint32_t transfer_id,
2432  Local<ArrayBuffer> array_buffer);
2433 
2434  /**
2435  * Similar to TransferArrayBuffer, but for SharedArrayBuffer.
2436  * The id is not necessarily in the same namespace as unshared ArrayBuffer
2437  * objects.
2438  */
2439  void TransferSharedArrayBuffer(uint32_t id,
2440  Local<SharedArrayBuffer> shared_array_buffer);
2441 
2442  /**
2443  * Must be called before ReadHeader to enable support for reading the legacy
2444  * wire format (i.e., which predates this being shipped).
2445  *
2446  * Don't use this unless you need to read data written by previous versions of
2447  * blink::ScriptValueSerializer.
2448  */
2449  void SetSupportsLegacyWireFormat(bool supports_legacy_wire_format);
2450 
2451  /**
2452  * Reads the underlying wire format version. Likely mostly to be useful to
2453  * legacy code reading old wire format versions. Must be called after
2454  * ReadHeader.
2455  */
2456  uint32_t GetWireFormatVersion() const;
2457 
2458  /**
2459  * Reads raw data in various common formats to the buffer.
2460  * Note that integer types are read in base-128 varint format, not with a
2461  * binary copy. For use during an override of Delegate::ReadHostObject.
2462  */
2463  V8_WARN_UNUSED_RESULT bool ReadUint32(uint32_t* value);
2464  V8_WARN_UNUSED_RESULT bool ReadUint64(uint64_t* value);
2465  V8_WARN_UNUSED_RESULT bool ReadDouble(double* value);
2466  V8_WARN_UNUSED_RESULT bool ReadRawBytes(size_t length, const void** data);
2467 
2469  void operator=(const ValueDeserializer&) = delete;
2470 
2471  private:
2472  struct PrivateData;
2473  PrivateData* private_;
2474 };
2475 
2476 
2477 // --- Value ---
2478 
2479 
2480 /**
2481  * The superclass of all JavaScript values and objects.
2482  */
2483 class V8_EXPORT Value : public Data {
2484  public:
2485  /**
2486  * Returns true if this value is the undefined value. See ECMA-262
2487  * 4.3.10.
2488  *
2489  * This is equivalent to `value === undefined` in JS.
2490  */
2491  V8_INLINE bool IsUndefined() const;
2492 
2493  /**
2494  * Returns true if this value is the null value. See ECMA-262
2495  * 4.3.11.
2496  *
2497  * This is equivalent to `value === null` in JS.
2498  */
2499  V8_INLINE bool IsNull() const;
2500 
2501  /**
2502  * Returns true if this value is either the null or the undefined value.
2503  * See ECMA-262
2504  * 4.3.11. and 4.3.12
2505  *
2506  * This is equivalent to `value == null` in JS.
2507  */
2508  V8_INLINE bool IsNullOrUndefined() const;
2509 
2510  /**
2511  * Returns true if this value is true.
2512  *
2513  * This is not the same as `BooleanValue()`. The latter performs a
2514  * conversion to boolean, i.e. the result of `Boolean(value)` in JS, whereas
2515  * this checks `value === true`.
2516  */
2517  bool IsTrue() const;
2518 
2519  /**
2520  * Returns true if this value is false.
2521  *
2522  * This is not the same as `!BooleanValue()`. The latter performs a
2523  * conversion to boolean, i.e. the result of `!Boolean(value)` in JS, whereas
2524  * this checks `value === false`.
2525  */
2526  bool IsFalse() const;
2527 
2528  /**
2529  * Returns true if this value is a symbol or a string.
2530  *
2531  * This is equivalent to
2532  * `typeof value === 'string' || typeof value === 'symbol'` in JS.
2533  */
2534  bool IsName() const;
2535 
2536  /**
2537  * Returns true if this value is an instance of the String type.
2538  * See ECMA-262 8.4.
2539  *
2540  * This is equivalent to `typeof value === 'string'` in JS.
2541  */
2542  V8_INLINE bool IsString() const;
2543 
2544  /**
2545  * Returns true if this value is a symbol.
2546  *
2547  * This is equivalent to `typeof value === 'symbol'` in JS.
2548  */
2549  bool IsSymbol() const;
2550 
2551  /**
2552  * Returns true if this value is a function.
2553  *
2554  * This is equivalent to `typeof value === 'function'` in JS.
2555  */
2556  bool IsFunction() const;
2557 
2558  /**
2559  * Returns true if this value is an array. Note that it will return false for
2560  * an Proxy for an array.
2561  */
2562  bool IsArray() const;
2563 
2564  /**
2565  * Returns true if this value is an object.
2566  */
2567  bool IsObject() const;
2568 
2569  /**
2570  * Returns true if this value is a bigint.
2571  *
2572  * This is equivalent to `typeof value === 'bigint'` in JS.
2573  */
2574  bool IsBigInt() const;
2575 
2576  /**
2577  * Returns true if this value is boolean.
2578  *
2579  * This is equivalent to `typeof value === 'boolean'` in JS.
2580  */
2581  bool IsBoolean() const;
2582 
2583  /**
2584  * Returns true if this value is a number.
2585  *
2586  * This is equivalent to `typeof value === 'number'` in JS.
2587  */
2588  bool IsNumber() const;
2589 
2590  /**
2591  * Returns true if this value is an `External` object.
2592  */
2593  bool IsExternal() const;
2594 
2595  /**
2596  * Returns true if this value is a 32-bit signed integer.
2597  */
2598  bool IsInt32() const;
2599 
2600  /**
2601  * Returns true if this value is a 32-bit unsigned integer.
2602  */
2603  bool IsUint32() const;
2604 
2605  /**
2606  * Returns true if this value is a Date.
2607  */
2608  bool IsDate() const;
2609 
2610  /**
2611  * Returns true if this value is an Arguments object.
2612  */
2613  bool IsArgumentsObject() const;
2614 
2615  /**
2616  * Returns true if this value is a BigInt object.
2617  */
2618  bool IsBigIntObject() const;
2619 
2620  /**
2621  * Returns true if this value is a Boolean object.
2622  */
2623  bool IsBooleanObject() const;
2624 
2625  /**
2626  * Returns true if this value is a Number object.
2627  */
2628  bool IsNumberObject() const;
2629 
2630  /**
2631  * Returns true if this value is a String object.
2632  */
2633  bool IsStringObject() const;
2634 
2635  /**
2636  * Returns true if this value is a Symbol object.
2637  */
2638  bool IsSymbolObject() const;
2639 
2640  /**
2641  * Returns true if this value is a NativeError.
2642  */
2643  bool IsNativeError() const;
2644 
2645  /**
2646  * Returns true if this value is a RegExp.
2647  */
2648  bool IsRegExp() const;
2649 
2650  /**
2651  * Returns true if this value is an async function.
2652  */
2653  bool IsAsyncFunction() const;
2654 
2655  /**
2656  * Returns true if this value is a Generator function.
2657  */
2658  bool IsGeneratorFunction() const;
2659 
2660  /**
2661  * Returns true if this value is a Generator object (iterator).
2662  */
2663  bool IsGeneratorObject() const;
2664 
2665  /**
2666  * Returns true if this value is a Promise.
2667  */
2668  bool IsPromise() const;
2669 
2670  /**
2671  * Returns true if this value is a Map.
2672  */
2673  bool IsMap() const;
2674 
2675  /**
2676  * Returns true if this value is a Set.
2677  */
2678  bool IsSet() const;
2679 
2680  /**
2681  * Returns true if this value is a Map Iterator.
2682  */
2683  bool IsMapIterator() const;
2684 
2685  /**
2686  * Returns true if this value is a Set Iterator.
2687  */
2688  bool IsSetIterator() const;
2689 
2690  /**
2691  * Returns true if this value is a WeakMap.
2692  */
2693  bool IsWeakMap() const;
2694 
2695  /**
2696  * Returns true if this value is a WeakSet.
2697  */
2698  bool IsWeakSet() const;
2699 
2700  /**
2701  * Returns true if this value is an ArrayBuffer.
2702  */
2703  bool IsArrayBuffer() const;
2704 
2705  /**
2706  * Returns true if this value is an ArrayBufferView.
2707  */
2708  bool IsArrayBufferView() const;
2709 
2710  /**
2711  * Returns true if this value is one of TypedArrays.
2712  */
2713  bool IsTypedArray() const;
2714 
2715  /**
2716  * Returns true if this value is an Uint8Array.
2717  */
2718  bool IsUint8Array() const;
2719 
2720  /**
2721  * Returns true if this value is an Uint8ClampedArray.
2722  */
2723  bool IsUint8ClampedArray() const;
2724 
2725  /**
2726  * Returns true if this value is an Int8Array.
2727  */
2728  bool IsInt8Array() const;
2729 
2730  /**
2731  * Returns true if this value is an Uint16Array.
2732  */
2733  bool IsUint16Array() const;
2734 
2735  /**
2736  * Returns true if this value is an Int16Array.
2737  */
2738  bool IsInt16Array() const;
2739 
2740  /**
2741  * Returns true if this value is an Uint32Array.
2742  */
2743  bool IsUint32Array() const;
2744 
2745  /**
2746  * Returns true if this value is an Int32Array.
2747  */
2748  bool IsInt32Array() const;
2749 
2750  /**
2751  * Returns true if this value is a Float32Array.
2752  */
2753  bool IsFloat32Array() const;
2754 
2755  /**
2756  * Returns true if this value is a Float64Array.
2757  */
2758  bool IsFloat64Array() const;
2759 
2760  /**
2761  * Returns true if this value is a BigInt64Array.
2762  */
2763  bool IsBigInt64Array() const;
2764 
2765  /**
2766  * Returns true if this value is a BigUint64Array.
2767  */
2768  bool IsBigUint64Array() const;
2769 
2770  /**
2771  * Returns true if this value is a DataView.
2772  */
2773  bool IsDataView() const;
2774 
2775  /**
2776  * Returns true if this value is a SharedArrayBuffer.
2777  */
2778  bool IsSharedArrayBuffer() const;
2779 
2780  /**
2781  * Returns true if this value is a JavaScript Proxy.
2782  */
2783  bool IsProxy() const;
2784 
2785  /**
2786  * Returns true if this value is a WasmModuleObject.
2787  */
2788  bool IsWasmModuleObject() const;
2789 
2790  /**
2791  * Returns true if the value is a Module Namespace Object.
2792  */
2794 
2795  /**
2796  * Perform the equivalent of `BigInt(value)` in JS.
2797  */
2799  Local<Context> context) const;
2800  /**
2801  * Perform the equivalent of `Number(value)` in JS.
2802  */
2804  Local<Context> context) const;
2805  /**
2806  * Perform the equivalent of `String(value)` in JS.
2807  */
2809  Local<Context> context) const;
2810  /**
2811  * Provide a string representation of this value usable for debugging.
2812  * This operation has no observable side effects and will succeed
2813  * unless e.g. execution is being terminated.
2814  */
2816  Local<Context> context) const;
2817  /**
2818  * Perform the equivalent of `Object(value)` in JS.
2819  */
2821  Local<Context> context) const;
2822  /**
2823  * Perform the equivalent of `Number(value)` in JS and convert the result
2824  * to an integer. Negative values are rounded up, positive values are rounded
2825  * down. NaN is converted to 0. Infinite values yield undefined results.
2826  */
2828  Local<Context> context) const;
2829  /**
2830  * Perform the equivalent of `Number(value)` in JS and convert the result
2831  * to an unsigned 32-bit integer by performing the steps in
2832  * https://tc39.es/ecma262/#sec-touint32.
2833  */
2835  Local<Context> context) const;
2836  /**
2837  * Perform the equivalent of `Number(value)` in JS and convert the result
2838  * to a signed 32-bit integer by performing the steps in
2839  * https://tc39.es/ecma262/#sec-toint32.
2840  */
2842 
2843  /**
2844  * Perform the equivalent of `Boolean(value)` in JS. This can never fail.
2845  */
2846  Local<Boolean> ToBoolean(Isolate* isolate) const;
2847 
2848  /**
2849  * Attempts to convert a string to an array index.
2850  * Returns an empty handle if the conversion fails.
2851  */
2853  Local<Context> context) const;
2854 
2855  /** Returns the equivalent of `ToBoolean()->Value()`. */
2856  bool BooleanValue(Isolate* isolate) const;
2857 
2858  /** Returns the equivalent of `ToNumber()->Value()`. */
2860  /** Returns the equivalent of `ToInteger()->Value()`. */
2862  Local<Context> context) const;
2863  /** Returns the equivalent of `ToUint32()->Value()`. */
2865  Local<Context> context) const;
2866  /** Returns the equivalent of `ToInt32()->Value()`. */
2868 
2869  /** JS == */
2871  Local<Value> that) const;
2872  bool StrictEquals(Local<Value> that) const;
2873  bool SameValue(Local<Value> that) const;
2874 
2875  template <class T> V8_INLINE static Value* Cast(T* value);
2876 
2878 
2879  Maybe<bool> InstanceOf(Local<Context> context, Local<Object> object);
2880 
2881  private:
2882  V8_INLINE bool QuickIsUndefined() const;
2883  V8_INLINE bool QuickIsNull() const;
2884  V8_INLINE bool QuickIsNullOrUndefined() const;
2885  V8_INLINE bool QuickIsString() const;
2886  bool FullIsUndefined() const;
2887  bool FullIsNull() const;
2888  bool FullIsString() const;
2889 };
2890 
2891 
2892 /**
2893  * The superclass of primitive values. See ECMA-262 4.3.2.
2894  */
2895 class V8_EXPORT Primitive : public Value { };
2896 
2897 
2898 /**
2899  * A primitive boolean value (ECMA-262, 4.3.14). Either the true
2900  * or false value.
2901  */
2902 class V8_EXPORT Boolean : public Primitive {
2903  public:
2904  bool Value() const;
2905  V8_INLINE static Boolean* Cast(v8::Value* obj);
2906  V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value);
2907 
2908  private:
2909  static void CheckCast(v8::Value* obj);
2910 };
2911 
2912 
2913 /**
2914  * A superclass for symbols and strings.
2915  */
2916 class V8_EXPORT Name : public Primitive {
2917  public:
2918  /**
2919  * Returns the identity hash for this object. The current implementation
2920  * uses an inline property on the object to store the identity hash.
2921  *
2922  * The return value will never be 0. Also, it is not guaranteed to be
2923  * unique.
2924  */
2926 
2927  V8_INLINE static Name* Cast(Value* obj);
2928 
2929  private:
2930  static void CheckCast(Value* obj);
2931 };
2932 
2933 /**
2934  * A flag describing different modes of string creation.
2935  *
2936  * Aside from performance implications there are no differences between the two
2937  * creation modes.
2938  */
2939 enum class NewStringType {
2940  /**
2941  * Create a new string, always allocating new storage memory.
2942  */
2943  kNormal,
2944 
2945  /**
2946  * Acts as a hint that the string should be created in the
2947  * old generation heap space and be deduplicated if an identical string
2948  * already exists.
2949  */
2951 };
2952 
2953 /**
2954  * A JavaScript string value (ECMA-262, 4.3.17).
2955  */
2956 class V8_EXPORT String : public Name {
2957  public:
2958  static constexpr int kMaxLength =
2959  internal::kApiSystemPointerSize == 4 ? (1 << 28) - 16 : (1 << 29) - 24;
2960 
2961  enum Encoding {
2964  ONE_BYTE_ENCODING = 0x8
2965  };
2966  /**
2967  * Returns the number of characters (UTF-16 code units) in this string.
2968  */
2969  int Length() const;
2970 
2971  /**
2972  * Returns the number of bytes in the UTF-8 encoded
2973  * representation of this string.
2974  */
2975  int Utf8Length(Isolate* isolate) const;
2976 
2977  /**
2978  * Returns whether this string is known to contain only one byte data,
2979  * i.e. ISO-8859-1 code points.
2980  * Does not read the string.
2981  * False negatives are possible.
2982  */
2983  bool IsOneByte() const;
2984 
2985  /**
2986  * Returns whether this string contain only one byte data,
2987  * i.e. ISO-8859-1 code points.
2988  * Will read the entire string in some cases.
2989  */
2990  bool ContainsOnlyOneByte() const;
2991 
2992  /**
2993  * Write the contents of the string to an external buffer.
2994  * If no arguments are given, expects the buffer to be large
2995  * enough to hold the entire string and NULL terminator. Copies
2996  * the contents of the string and the NULL terminator into the
2997  * buffer.
2998  *
2999  * WriteUtf8 will not write partial UTF-8 sequences, preferring to stop
3000  * before the end of the buffer.
3001  *
3002  * Copies up to length characters into the output buffer.
3003  * Only null-terminates if there is enough space in the buffer.
3004  *
3005  * \param buffer The buffer into which the string will be copied.
3006  * \param start The starting position within the string at which
3007  * copying begins.
3008  * \param length The number of characters to copy from the string. For
3009  * WriteUtf8 the number of bytes in the buffer.
3010  * \param nchars_ref The number of characters written, can be NULL.
3011  * \param options Various options that might affect performance of this or
3012  * subsequent operations.
3013  * \return The number of characters copied to the buffer excluding the null
3014  * terminator. For WriteUtf8: The number of bytes copied to the buffer
3015  * including the null terminator (if written).
3016  */
3022  // Used by WriteUtf8 to replace orphan surrogate code units with the
3023  // unicode replacement character. Needs to be set to guarantee valid UTF-8
3024  // output.
3026  };
3027 
3028  // 16-bit character codes.
3029  int Write(Isolate* isolate, uint16_t* buffer, int start = 0, int length = -1,
3030  int options = NO_OPTIONS) const;
3031  // One byte characters.
3032  int WriteOneByte(Isolate* isolate, uint8_t* buffer, int start = 0,
3033  int length = -1, int options = NO_OPTIONS) const;
3034  // UTF-8 encoded characters.
3035  int WriteUtf8(Isolate* isolate, char* buffer, int length = -1,
3036  int* nchars_ref = nullptr, int options = NO_OPTIONS) const;
3037 
3038  /**
3039  * A zero length string.
3040  */
3041  V8_INLINE static Local<String> Empty(Isolate* isolate);
3042 
3043  /**
3044  * Returns true if the string is external
3045  */
3046  bool IsExternal() const;
3047 
3048  /**
3049  * Returns true if the string is both external and one-byte.
3050  */
3051  bool IsExternalOneByte() const;
3052 
3054  public:
3055  virtual ~ExternalStringResourceBase() = default;
3056 
3057  /**
3058  * If a string is cacheable, the value returned by
3059  * ExternalStringResource::data() may be cached, otherwise it is not
3060  * expected to be stable beyond the current top-level task.
3061  */
3062  virtual bool IsCacheable() const { return true; }
3063 
3064  // Disallow copying and assigning.
3066  void operator=(const ExternalStringResourceBase&) = delete;
3067 
3068  protected:
3070 
3071  /**
3072  * Internally V8 will call this Dispose method when the external string
3073  * resource is no longer needed. The default implementation will use the
3074  * delete operator. This method can be overridden in subclasses to
3075  * control how allocated external string resources are disposed.
3076  */
3077  virtual void Dispose() { delete this; }
3078 
3079  /**
3080  * For a non-cacheable string, the value returned by
3081  * |ExternalStringResource::data()| has to be stable between |Lock()| and
3082  * |Unlock()|, that is the string must behave as is |IsCacheable()| returned
3083  * true.
3084  *
3085  * These two functions must be thread-safe, and can be called from anywhere.
3086  * They also must handle lock depth, in the sense that each can be called
3087  * several times, from different threads, and unlocking should only happen
3088  * when the balance of Lock() and Unlock() calls is 0.
3089  */
3090  virtual void Lock() const {}
3091 
3092  /**
3093  * Unlocks the string.
3094  */
3095  virtual void Unlock() const {}
3096 
3097  private:
3098  friend class internal::ExternalString;
3099  friend class v8::String;
3100  friend class internal::ScopedExternalStringLock;
3101  };
3102 
3103  /**
3104  * An ExternalStringResource is a wrapper around a two-byte string
3105  * buffer that resides outside V8's heap. Implement an
3106  * ExternalStringResource to manage the life cycle of the underlying
3107  * buffer. Note that the string data must be immutable.
3108  */
3110  : public ExternalStringResourceBase {
3111  public:
3112  /**
3113  * Override the destructor to manage the life cycle of the underlying
3114  * buffer.
3115  */
3116  ~ExternalStringResource() override = default;
3117 
3118  /**
3119  * The string data from the underlying buffer.
3120  */
3121  virtual const uint16_t* data() const = 0;
3122 
3123  /**
3124  * The length of the string. That is, the number of two-byte characters.
3125  */
3126  virtual size_t length() const = 0;
3127 
3128  protected:
3130  };
3131 
3132  /**
3133  * An ExternalOneByteStringResource is a wrapper around an one-byte
3134  * string buffer that resides outside V8's heap. Implement an
3135  * ExternalOneByteStringResource to manage the life cycle of the
3136  * underlying buffer. Note that the string data must be immutable
3137  * and that the data must be Latin-1 and not UTF-8, which would require
3138  * special treatment internally in the engine and do not allow efficient
3139  * indexing. Use String::New or convert to 16 bit data for non-Latin1.
3140  */
3141 
3143  : public ExternalStringResourceBase {
3144  public:
3145  /**
3146  * Override the destructor to manage the life cycle of the underlying
3147  * buffer.
3148  */
3149  ~ExternalOneByteStringResource() override = default;
3150  /** The string data from the underlying buffer.*/
3151  virtual const char* data() const = 0;
3152  /** The number of Latin-1 characters in the string.*/
3153  virtual size_t length() const = 0;
3154  protected:
3156  };
3157 
3158  /**
3159  * If the string is an external string, return the ExternalStringResourceBase
3160  * regardless of the encoding, otherwise return NULL. The encoding of the
3161  * string is returned in encoding_out.
3162  */
3164  Encoding* encoding_out) const;
3165 
3166  /**
3167  * Get the ExternalStringResource for an external string. Returns
3168  * NULL if IsExternal() doesn't return true.
3169  */
3171 
3172  /**
3173  * Get the ExternalOneByteStringResource for an external one-byte string.
3174  * Returns NULL if IsExternalOneByte() doesn't return true.
3175  */
3177 
3178  V8_INLINE static String* Cast(v8::Value* obj);
3179 
3180  /**
3181  * Allocates a new string from a UTF-8 literal. This is equivalent to calling
3182  * String::NewFromUtf(isolate, "...").ToLocalChecked(), but without the check
3183  * overhead.
3184  *
3185  * When called on a string literal containing '\0', the inferred length is the
3186  * length of the input array minus 1 (for the final '\0') and not the value
3187  * returned by strlen.
3188  **/
3189  template <int N>
3191  Isolate* isolate, const char (&literal)[N],
3193  static_assert(N <= kMaxLength, "String is too long");
3194  return NewFromUtf8Literal(isolate, literal, type, N - 1);
3195  }
3196 
3197  /** Allocates a new string from UTF-8 data. Only returns an empty value when
3198  * length > kMaxLength. **/
3200  Isolate* isolate, const char* data,
3201  NewStringType type = NewStringType::kNormal, int length = -1);
3202 
3203  /** Allocates a new string from Latin-1 data. Only returns an empty value
3204  * when length > kMaxLength. **/
3206  Isolate* isolate, const uint8_t* data,
3207  NewStringType type = NewStringType::kNormal, int length = -1);
3208 
3209  /** Allocates a new string from UTF-16 data. Only returns an empty value when
3210  * length > kMaxLength. **/
3212  Isolate* isolate, const uint16_t* data,
3213  NewStringType type = NewStringType::kNormal, int length = -1);
3214 
3215  /**
3216  * Creates a new string by concatenating the left and the right strings
3217  * passed in as parameters.
3218  */
3219  static Local<String> Concat(Isolate* isolate, Local<String> left,
3220  Local<String> right);
3221 
3222  /**
3223  * Creates a new external string using the data defined in the given
3224  * resource. When the external string is no longer live on V8's heap the
3225  * resource will be disposed by calling its Dispose method. The caller of
3226  * this function should not otherwise delete or modify the resource. Neither
3227  * should the underlying buffer be deallocated or modified except through the
3228  * destructor of the external string resource.
3229  */
3231  Isolate* isolate, ExternalStringResource* resource);
3232 
3233  /**
3234  * Associate an external string resource with this string by transforming it
3235  * in place so that existing references to this string in the JavaScript heap
3236  * will use the external string resource. The external string resource's
3237  * character contents need to be equivalent to this string.
3238  * Returns true if the string has been changed to be an external string.
3239  * The string is not modified if the operation fails. See NewExternal for
3240  * information on the lifetime of the resource.
3241  */
3243 
3244  /**
3245  * Creates a new external string using the one-byte data defined in the given
3246  * resource. When the external string is no longer live on V8's heap the
3247  * resource will be disposed by calling its Dispose method. The caller of
3248  * this function should not otherwise delete or modify the resource. Neither
3249  * should the underlying buffer be deallocated or modified except through the
3250  * destructor of the external string resource.
3251  */
3253  Isolate* isolate, ExternalOneByteStringResource* resource);
3254 
3255  /**
3256  * Associate an external string resource with this string by transforming it
3257  * in place so that existing references to this string in the JavaScript heap
3258  * will use the external string resource. The external string resource's
3259  * character contents need to be equivalent to this string.
3260  * Returns true if the string has been changed to be an external string.
3261  * The string is not modified if the operation fails. See NewExternal for
3262  * information on the lifetime of the resource.
3263  */
3265 
3266  /**
3267  * Returns true if this string can be made external.
3268  */
3270 
3271  /**
3272  * Returns true if the strings values are equal. Same as JS ==/===.
3273  */
3275 
3276  /**
3277  * Converts an object to a UTF-8-encoded character array. Useful if
3278  * you want to print the object. If conversion to a string fails
3279  * (e.g. due to an exception in the toString() method of the object)
3280  * then the length() method returns 0 and the * operator returns
3281  * NULL.
3282  */
3284  public:
3285  Utf8Value(Isolate* isolate, Local<v8::Value> obj);
3287  char* operator*() { return str_; }
3288  const char* operator*() const { return str_; }
3289  int length() const { return length_; }
3290 
3291  // Disallow copying and assigning.
3292  Utf8Value(const Utf8Value&) = delete;
3293  void operator=(const Utf8Value&) = delete;
3294 
3295  private:
3296  char* str_;
3297  int length_;
3298  };
3299 
3300  /**
3301  * Converts an object to a two-byte (UTF-16-encoded) string.
3302  * If conversion to a string fails (eg. due to an exception in the toString()
3303  * method of the object) then the length() method returns 0 and the * operator
3304  * returns NULL.
3305  */
3307  public:
3308  Value(Isolate* isolate, Local<v8::Value> obj);
3309  ~Value();
3310  uint16_t* operator*() { return str_; }
3311  const uint16_t* operator*() const { return str_; }
3312  int length() const { return length_; }
3313 
3314  // Disallow copying and assigning.
3315  Value(const Value&) = delete;
3316  void operator=(const Value&) = delete;
3317 
3318  private:
3319  uint16_t* str_;
3320  int length_;
3321  };
3322 
3323  private:
3324  void VerifyExternalStringResourceBase(ExternalStringResourceBase* v,
3325  Encoding encoding) const;
3326  void VerifyExternalStringResource(ExternalStringResource* val) const;
3327  ExternalStringResource* GetExternalStringResourceSlow() const;
3328  ExternalStringResourceBase* GetExternalStringResourceBaseSlow(
3329  String::Encoding* encoding_out) const;
3330 
3331  static Local<v8::String> NewFromUtf8Literal(Isolate* isolate,
3332  const char* literal,
3333  NewStringType type, int length);
3334 
3335  static void CheckCast(v8::Value* obj);
3336 };
3337 
3338 // Zero-length string specialization (templated string size includes
3339 // terminator).
3340 template <>
3342  Isolate* isolate, const char (&literal)[1], NewStringType type) {
3343  return String::Empty(isolate);
3344 }
3345 
3346 /**
3347  * A JavaScript symbol (ECMA-262 edition 6)
3348  */
3349 class V8_EXPORT Symbol : public Name {
3350  public:
3351  /**
3352  * Returns the description string of the symbol, or undefined if none.
3353  */
3355 
3356  V8_DEPRECATE_SOON("Use Symbol::Description()")
3357  Local<Value> Name() const { return Description(); }
3358 
3359  /**
3360  * Create a symbol. If description is not empty, it will be used as the
3361  * description.
3362  */
3363  static Local<Symbol> New(Isolate* isolate,
3364  Local<String> description = Local<String>());
3365 
3366  /**
3367  * Access global symbol registry.
3368  * Note that symbols created this way are never collected, so
3369  * they should only be used for statically fixed properties.
3370  * Also, there is only one global name space for the descriptions used as
3371  * keys.
3372  * To minimize the potential for clashes, use qualified names as keys.
3373  */
3374  static Local<Symbol> For(Isolate* isolate, Local<String> description);
3375 
3376  /**
3377  * Retrieve a global symbol. Similar to |For|, but using a separate
3378  * registry that is not accessible by (and cannot clash with) JavaScript code.
3379  */
3380  static Local<Symbol> ForApi(Isolate* isolate, Local<String> description);
3381 
3382  // Well-known symbols
3384  static Local<Symbol> GetHasInstance(Isolate* isolate);
3386  static Local<Symbol> GetIterator(Isolate* isolate);
3387  static Local<Symbol> GetMatch(Isolate* isolate);
3388  static Local<Symbol> GetReplace(Isolate* isolate);
3389  static Local<Symbol> GetSearch(Isolate* isolate);
3390  static Local<Symbol> GetSplit(Isolate* isolate);
3391  static Local<Symbol> GetToPrimitive(Isolate* isolate);
3392  static Local<Symbol> GetToStringTag(Isolate* isolate);
3393  static Local<Symbol> GetUnscopables(Isolate* isolate);
3394 
3395  V8_INLINE static Symbol* Cast(Value* obj);
3396 
3397  private:
3398  Symbol();
3399  static void CheckCast(Value* obj);
3400 };
3401 
3402 
3403 /**
3404  * A private symbol
3405  *
3406  * This is an experimental feature. Use at your own risk.
3407  */
3408 class V8_EXPORT Private : public Data {
3409  public:
3410  /**
3411  * Returns the print name string of the private symbol, or undefined if none.
3412  */
3413  Local<Value> Name() const;
3414 
3415  /**
3416  * Create a private symbol. If name is not empty, it will be the description.
3417  */
3418  static Local<Private> New(Isolate* isolate,
3419  Local<String> name = Local<String>());
3420 
3421  /**
3422  * Retrieve a global private symbol. If a symbol with this name has not
3423  * been retrieved in the same isolate before, it is created.
3424  * Note that private symbols created this way are never collected, so
3425  * they should only be used for statically fixed properties.
3426  * Also, there is only one global name space for the names used as keys.
3427  * To minimize the potential for clashes, use qualified names as keys,
3428  * e.g., "Class#property".
3429  */
3430  static Local<Private> ForApi(Isolate* isolate, Local<String> name);
3431 
3432  V8_INLINE static Private* Cast(Data* data);
3433 
3434  private:
3435  Private();
3436 
3437  static void CheckCast(Data* that);
3438 };
3439 
3440 
3441 /**
3442  * A JavaScript number value (ECMA-262, 4.3.20)
3443  */
3444 class V8_EXPORT Number : public Primitive {
3445  public:
3446  double Value() const;
3447  static Local<Number> New(Isolate* isolate, double value);
3448  V8_INLINE static Number* Cast(v8::Value* obj);
3449  private:
3450  Number();
3451  static void CheckCast(v8::Value* obj);
3452 };
3453 
3454 
3455 /**
3456  * A JavaScript value representing a signed integer.
3457  */
3458 class V8_EXPORT Integer : public Number {
3459  public:
3460  static Local<Integer> New(Isolate* isolate, int32_t value);
3461  static Local<Integer> NewFromUnsigned(Isolate* isolate, uint32_t value);
3462  int64_t Value() const;
3463  V8_INLINE static Integer* Cast(v8::Value* obj);
3464  private:
3465  Integer();
3466  static void CheckCast(v8::Value* obj);
3467 };
3468 
3469 
3470 /**
3471  * A JavaScript value representing a 32-bit signed integer.
3472  */
3473 class V8_EXPORT Int32 : public Integer {
3474  public:
3475  int32_t Value() const;
3476  V8_INLINE static Int32* Cast(v8::Value* obj);
3477 
3478  private:
3479  Int32();
3480  static void CheckCast(v8::Value* obj);
3481 };
3482 
3483 
3484 /**
3485  * A JavaScript value representing a 32-bit unsigned integer.
3486  */
3487 class V8_EXPORT Uint32 : public Integer {
3488  public:
3489  uint32_t Value() const;
3490  V8_INLINE static Uint32* Cast(v8::Value* obj);
3491 
3492  private:
3493  Uint32();
3494  static void CheckCast(v8::Value* obj);
3495 };
3496 
3497 /**
3498  * A JavaScript BigInt value (https://tc39.github.io/proposal-bigint)
3499  */
3500 class V8_EXPORT BigInt : public Primitive {
3501  public:
3502  static Local<BigInt> New(Isolate* isolate, int64_t value);
3503  static Local<BigInt> NewFromUnsigned(Isolate* isolate, uint64_t value);
3504  /**
3505  * Creates a new BigInt object using a specified sign bit and a
3506  * specified list of digits/words.
3507  * The resulting number is calculated as:
3508  *
3509  * (-1)^sign_bit * (words[0] * (2^64)^0 + words[1] * (2^64)^1 + ...)
3510  */
3511  static MaybeLocal<BigInt> NewFromWords(Local<Context> context, int sign_bit,
3512  int word_count, const uint64_t* words);
3513 
3514  /**
3515  * Returns the value of this BigInt as an unsigned 64-bit integer.
3516  * If `lossless` is provided, it will reflect whether the return value was
3517  * truncated or wrapped around. In particular, it is set to `false` if this
3518  * BigInt is negative.
3519  */
3520  uint64_t Uint64Value(bool* lossless = nullptr) const;
3521 
3522  /**
3523  * Returns the value of this BigInt as a signed 64-bit integer.
3524  * If `lossless` is provided, it will reflect whether this BigInt was
3525  * truncated or not.
3526  */
3527  int64_t Int64Value(bool* lossless = nullptr) const;
3528 
3529  /**
3530  * Returns the number of 64-bit words needed to store the result of
3531  * ToWordsArray().
3532  */
3533  int WordCount() const;
3534 
3535  /**
3536  * Writes the contents of this BigInt to a specified memory location.
3537  * `sign_bit` must be provided and will be set to 1 if this BigInt is
3538  * negative.
3539  * `*word_count` has to be initialized to the length of the `words` array.
3540  * Upon return, it will be set to the actual number of words that would
3541  * be needed to store this BigInt (i.e. the return value of `WordCount()`).
3542  */
3543  void ToWordsArray(int* sign_bit, int* word_count, uint64_t* words) const;
3544 
3545  V8_INLINE static BigInt* Cast(v8::Value* obj);
3546 
3547  private:
3548  BigInt();
3549  static void CheckCast(v8::Value* obj);
3550 };
3551 
3552 /**
3553  * PropertyAttribute.
3554  */
3556  /** None. **/
3557  None = 0,
3558  /** ReadOnly, i.e., not writable. **/
3559  ReadOnly = 1 << 0,
3560  /** DontEnum, i.e., not enumerable. **/
3561  DontEnum = 1 << 1,
3562  /** DontDelete, i.e., not configurable. **/
3563  DontDelete = 1 << 2
3564 };
3565 
3566 /**
3567  * Accessor[Getter|Setter] are used as callback functions when
3568  * setting|getting a particular property. See Object and ObjectTemplate's
3569  * method SetAccessor.
3570  */
3571 typedef void (*AccessorGetterCallback)(
3572  Local<String> property,
3573  const PropertyCallbackInfo<Value>& info);
3575  Local<Name> property,
3576  const PropertyCallbackInfo<Value>& info);
3577 
3578 
3579 typedef void (*AccessorSetterCallback)(
3580  Local<String> property,
3581  Local<Value> value,
3582  const PropertyCallbackInfo<void>& info);
3584  Local<Name> property,
3585  Local<Value> value,
3586  const PropertyCallbackInfo<void>& info);
3587 
3588 
3589 /**
3590  * Access control specifications.
3591  *
3592  * Some accessors should be accessible across contexts. These
3593  * accessors have an explicit access control parameter which specifies
3594  * the kind of cross-context access that should be allowed.
3595  *
3596  * TODO(dcarney): Remove PROHIBITS_OVERWRITING as it is now unused.
3597  */
3599  DEFAULT = 0,
3601  ALL_CAN_WRITE = 1 << 1,
3602  PROHIBITS_OVERWRITING = 1 << 2
3603 };
3604 
3605 /**
3606  * Property filter bits. They can be or'ed to build a composite filter.
3607  */
3614  SKIP_SYMBOLS = 16
3615 };
3616 
3617 /**
3618  * Options for marking whether callbacks may trigger JS-observable side effects.
3619  * Side-effect-free callbacks are whitelisted during debug evaluation with
3620  * throwOnSideEffect. It applies when calling a Function, FunctionTemplate,
3621  * or an Accessor callback. For Interceptors, please see
3622  * PropertyHandlerFlags's kHasNoSideEffect.
3623  * Callbacks that only cause side effects to the receiver are whitelisted if
3624  * invoked on receiver objects that are created within the same debug-evaluate
3625  * call, as these objects are temporary and the side effect does not escape.
3626  */
3627 enum class SideEffectType {
3631 };
3632 
3633 /**
3634  * Keys/Properties filter enums:
3635  *
3636  * KeyCollectionMode limits the range of collected properties. kOwnOnly limits
3637  * the collected properties to the given Object only. kIncludesPrototypes will
3638  * include all keys of the objects's prototype chain as well.
3639  */
3641 
3642 /**
3643  * kIncludesIndices allows for integer indices to be collected, while
3644  * kSkipIndices will exclude integer indices from being collected.
3645  */
3647 
3648 /**
3649  * kConvertToString will convert integer indices to strings.
3650  * kKeepNumbers will return numbers for integer indices.
3651  */
3653 
3654 /**
3655  * Integrity level for objects.
3656  */
3658 
3659 /**
3660  * A JavaScript object (ECMA-262, 4.3.3)
3661  */
3662 class V8_EXPORT Object : public Value {
3663  public:
3664  /**
3665  * Set only return Just(true) or Empty(), so if it should never fail, use
3666  * result.Check().
3667  */
3669  Local<Value> key, Local<Value> value);
3670 
3671  V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index,
3672  Local<Value> value);
3673 
3674  // Implements CreateDataProperty (ECMA-262, 7.3.4).
3675  //
3676  // Defines a configurable, writable, enumerable property with the given value
3677  // on the object unless the property already exists and is not configurable
3678  // or the object is not extensible.
3679  //
3680  // Returns true on success.
3682  Local<Name> key,
3683  Local<Value> value);
3685  uint32_t index,
3686  Local<Value> value);
3687 
3688  // Implements DefineOwnProperty.
3689  //
3690  // In general, CreateDataProperty will be faster, however, does not allow
3691  // for specifying attributes.
3692  //
3693  // Returns true on success.
3695  Local<Context> context, Local<Name> key, Local<Value> value,
3696  PropertyAttribute attributes = None);
3697 
3698  // Implements Object.DefineProperty(O, P, Attributes), see Ecma-262 19.1.2.4.
3699  //
3700  // The defineProperty function is used to add an own property or
3701  // update the attributes of an existing own property of an object.
3702  //
3703  // Both data and accessor descriptors can be used.
3704  //
3705  // In general, CreateDataProperty is faster, however, does not allow
3706  // for specifying attributes or an accessor descriptor.
3707  //
3708  // The PropertyDescriptor can change when redefining a property.
3709  //
3710  // Returns true on success.
3712  Local<Context> context, Local<Name> key,
3713  PropertyDescriptor& descriptor); // NOLINT(runtime/references)
3714 
3716  Local<Value> key);
3717 
3719  uint32_t index);
3720 
3721  /**
3722  * Gets the property attributes of a property which can be None or
3723  * any combination of ReadOnly, DontEnum and DontDelete. Returns
3724  * None when the property doesn't exist.
3725  */
3727  Local<Context> context, Local<Value> key);
3728 
3729  /**
3730  * Returns Object.getOwnPropertyDescriptor as per ES2016 section 19.1.2.6.
3731  */
3733  Local<Context> context, Local<Name> key);
3734 
3735  /**
3736  * Object::Has() calls the abstract operation HasProperty(O, P) described
3737  * in ECMA-262, 7.3.10. Has() returns
3738  * true, if the object has the property, either own or on the prototype chain.
3739  * Interceptors, i.e., PropertyQueryCallbacks, are called if present.
3740  *
3741  * Has() has the same side effects as JavaScript's `variable in object`.
3742  * For example, calling Has() on a revoked proxy will throw an exception.
3743  *
3744  * \note Has() converts the key to a name, which possibly calls back into
3745  * JavaScript.
3746  *
3747  * See also v8::Object::HasOwnProperty() and
3748  * v8::Object::HasRealNamedProperty().
3749  */
3751  Local<Value> key);
3752 
3754  Local<Value> key);
3755 
3756  V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context, uint32_t index);
3757 
3759  uint32_t index);
3760 
3761  /**
3762  * Note: SideEffectType affects the getter only, not the setter.
3763  */
3765  Local<Context> context, Local<Name> name,
3767  AccessorNameSetterCallback setter = nullptr,
3769  AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
3770  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
3771  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
3772 
3774  Local<Function> setter = Local<Function>(),
3775  PropertyAttribute attribute = None,
3776  AccessControl settings = DEFAULT);
3777 
3778  /**
3779  * Sets a native data property like Template::SetNativeDataProperty, but
3780  * this method sets on this object directly.
3781  */
3783  Local<Context> context, Local<Name> name,
3785  AccessorNameSetterCallback setter = nullptr,
3786  Local<Value> data = Local<Value>(), PropertyAttribute attributes = None,
3787  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
3788  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
3789 
3790  /**
3791  * Attempts to create a property with the given name which behaves like a data
3792  * property, except that the provided getter is invoked (and provided with the
3793  * data value) to supply its value the first time it is read. After the
3794  * property is accessed once, it is replaced with an ordinary data property.
3795  *
3796  * Analogous to Template::SetLazyDataProperty.
3797  */
3799  Local<Context> context, Local<Name> name,
3801  PropertyAttribute attributes = None,
3802  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
3803  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
3804 
3805  /**
3806  * Functionality for private properties.
3807  * This is an experimental feature, use at your own risk.
3808  * Note: Private properties are not inherited. Do not rely on this, since it
3809  * may change.
3810  */
3811  Maybe<bool> HasPrivate(Local<Context> context, Local<Private> key);
3812  Maybe<bool> SetPrivate(Local<Context> context, Local<Private> key,
3813  Local<Value> value);
3816 
3817  /**
3818  * Returns an array containing the names of the enumerable properties
3819  * of this object, including properties from prototype objects. The
3820  * array returned by this method contains the same values as would
3821  * be enumerated by a for-in statement over this object.
3822  */
3824  Local<Context> context);
3826  Local<Context> context, KeyCollectionMode mode,
3827  PropertyFilter property_filter, IndexFilter index_filter,
3829 
3830  /**
3831  * This function has the same functionality as GetPropertyNames but
3832  * the returned array doesn't contain the names of properties from
3833  * prototype objects.
3834  */
3836  Local<Context> context);
3837 
3838  /**
3839  * Returns an array containing the names of the filtered properties
3840  * of this object, including properties from prototype objects. The
3841  * array returned by this method contains the same values as would
3842  * be enumerated by a for-in statement over this object.
3843  */
3845  Local<Context> context, PropertyFilter filter,
3847 
3848  /**
3849  * Get the prototype object. This does not skip objects marked to
3850  * be skipped by __proto__ and it does not consult the security
3851  * handler.
3852  */
3854 
3855  /**
3856  * Set the prototype object. This does not skip objects marked to
3857  * be skipped by __proto__ and it does not consult the security
3858  * handler.
3859  */
3861  Local<Value> prototype);
3862 
3863  /**
3864  * Finds an instance of the given function template in the prototype
3865  * chain.
3866  */
3868 
3869  /**
3870  * Call builtin Object.prototype.toString on this object.
3871  * This is different from Value::ToString() that may call
3872  * user-defined toString function. This one does not.
3873  */
3875  Local<Context> context);
3876 
3877  /**
3878  * Returns the name of the function invoked as a constructor for this object.
3879  */
3881 
3882  /**
3883  * Sets the integrity level of the object.
3884  */
3886 
3887  /** Gets the number of internal fields for this Object. */
3889 
3890  /** Same as above, but works for PersistentBase. */
3892  const PersistentBase<Object>& object) {
3893  return object.val_->InternalFieldCount();
3894  }
3895 
3896  /** Same as above, but works for TracedReferenceBase. */
3898  const TracedReferenceBase<Object>& object) {
3899  return object.val_->InternalFieldCount();
3900  }
3901 
3902  /** Gets the value from an internal field. */
3903  V8_INLINE Local<Value> GetInternalField(int index);
3904 
3905  /** Sets the value in an internal field. */
3906  void SetInternalField(int index, Local<Value> value);
3907 
3908  /**
3909  * Gets a 2-byte-aligned native pointer from an internal field. This field
3910  * must have been set by SetAlignedPointerInInternalField, everything else
3911  * leads to undefined behavior.
3912  */
3914 
3915  /** Same as above, but works for PersistentBase. */
3917  const PersistentBase<Object>& object, int index) {
3918  return object.val_->GetAlignedPointerFromInternalField(index);
3919  }
3920 
3921  /** Same as above, but works for TracedGlobal. */
3923  const TracedReferenceBase<Object>& object, int index) {
3924  return object.val_->GetAlignedPointerFromInternalField(index);
3925  }
3926 
3927  /**
3928  * Sets a 2-byte-aligned native pointer in an internal field. To retrieve such
3929  * a field, GetAlignedPointerFromInternalField must be used, everything else
3930  * leads to undefined behavior.
3931  */
3932  void SetAlignedPointerInInternalField(int index, void* value);
3933  void SetAlignedPointerInInternalFields(int argc, int indices[],
3934  void* values[]);
3935 
3936  /**
3937  * HasOwnProperty() is like JavaScript's Object.prototype.hasOwnProperty().
3938  *
3939  * See also v8::Object::Has() and v8::Object::HasRealNamedProperty().
3940  */
3942  Local<Name> key);
3944  uint32_t index);
3945  /**
3946  * Use HasRealNamedProperty() if you want to check if an object has an own
3947  * property without causing side effects, i.e., without calling interceptors.
3948  *
3949  * This function is similar to v8::Object::HasOwnProperty(), but it does not
3950  * call interceptors.
3951  *
3952  * \note Consider using non-masking interceptors, i.e., the interceptors are
3953  * not called if the receiver has the real named property. See
3954  * `v8::PropertyHandlerFlags::kNonMasking`.
3955  *
3956  * See also v8::Object::Has().
3957  */
3959  Local<Name> key);
3961  Local<Context> context, uint32_t index);
3963  Local<Context> context, Local<Name> key);
3964 
3965  /**
3966  * If result.IsEmpty() no real property was located in the prototype chain.
3967  * This means interceptors in the prototype chain are not called.
3968  */
3970  Local<Context> context, Local<Name> key);
3971 
3972  /**
3973  * Gets the property attributes of a real property in the prototype chain,
3974  * which can be None or any combination of ReadOnly, DontEnum and DontDelete.
3975  * Interceptors in the prototype chain are not called.
3976  */
3979  Local<Name> key);
3980 
3981  /**
3982  * If result.IsEmpty() no real property was located on the object or
3983  * in the prototype chain.
3984  * This means interceptors in the prototype chain are not called.
3985  */
3987  Local<Context> context, Local<Name> key);
3988 
3989  /**
3990  * Gets the property attributes of a real property which can be
3991  * None or any combination of ReadOnly, DontEnum and DontDelete.
3992  * Interceptors in the prototype chain are not called.
3993  */
3995  Local<Context> context, Local<Name> key);
3996 
3997  /** Tests for a named lookup interceptor.*/
3999 
4000  /** Tests for an index lookup interceptor.*/
4002 
4003  /**
4004  * Returns the identity hash for this object. The current implementation
4005  * uses a hidden property on the object to store the identity hash.
4006  *
4007  * The return value will never be 0. Also, it is not guaranteed to be
4008  * unique.
4009  */
4011 
4012  /**
4013  * Clone this object with a fast but shallow copy. Values will point
4014  * to the same values as the original object.
4015  */
4016  // TODO(dcarney): take an isolate and optionally bail out?
4018 
4019  /**
4020  * Returns the context in which the object was created.
4021  */
4023 
4024  /** Same as above, but works for Persistents */
4026  const PersistentBase<Object>& object) {
4027  return object.val_->CreationContext();
4028  }
4029 
4030  /**
4031  * Checks whether a callback is set by the
4032  * ObjectTemplate::SetCallAsFunctionHandler method.
4033  * When an Object is callable this method returns true.
4034  */
4035  bool IsCallable();
4036 
4037  /**
4038  * True if this object is a constructor.
4039  */
4041 
4042  /**
4043  * True if this object can carry information relevant to the embedder in its
4044  * embedder fields, false otherwise. This is generally true for objects
4045  * constructed through function templates but also holds for other types where
4046  * V8 automatically adds internal fields at compile time, such as e.g.
4047  * v8::ArrayBuffer.
4048  */
4050 
4051  /**
4052  * True if this object was created from an object template which was marked
4053  * as undetectable. See v8::ObjectTemplate::MarkAsUndetectable for more
4054  * information.
4055  */
4057 
4058  /**
4059  * Call an Object as a function if a callback is set by the
4060  * ObjectTemplate::SetCallAsFunctionHandler method.
4061  */
4063  Local<Value> recv,
4064  int argc,
4065  Local<Value> argv[]);
4066 
4067  /**
4068  * Call an Object as a constructor if a callback is set by the
4069  * ObjectTemplate::SetCallAsFunctionHandler method.
4070  * Note: This method behaves like the Function::NewInstance method.
4071  */
4073  Local<Context> context, int argc, Local<Value> argv[]);
4074 
4075  /**
4076  * Return the isolate to which the Object belongs to.
4077  */
4079 
4080  /**
4081  * If this object is a Set, Map, WeakSet or WeakMap, this returns a
4082  * representation of the elements of this object as an array.
4083  * If this object is a SetIterator or MapIterator, this returns all
4084  * elements of the underlying collection, starting at the iterator's current
4085  * position.
4086  * For other types, this will return an empty MaybeLocal<Array> (without
4087  * scheduling an exception).
4088  */
4089  MaybeLocal<Array> PreviewEntries(bool* is_key_value);
4090 
4091  static Local<Object> New(Isolate* isolate);
4092 
4093  /**
4094  * Creates a JavaScript object with the given properties, and
4095  * a the given prototype_or_null (which can be any JavaScript
4096  * value, and if it's null, the newly created object won't have
4097  * a prototype at all). This is similar to Object.create().
4098  * All properties will be created as enumerable, configurable
4099  * and writable properties.
4100  */
4101  static Local<Object> New(Isolate* isolate, Local<Value> prototype_or_null,
4102  Local<Name>* names, Local<Value>* values,
4103  size_t length);
4104 
4105  V8_INLINE static Object* Cast(Value* obj);
4106 
4107  private:
4108  Object();
4109  static void CheckCast(Value* obj);
4110  Local<Value> SlowGetInternalField(int index);
4111  void* SlowGetAlignedPointerFromInternalField(int index);
4112 };
4113 
4114 
4115 /**
4116  * An instance of the built-in array constructor (ECMA-262, 15.4.2).
4117  */
4118 class V8_EXPORT Array : public Object {
4119  public:
4120  uint32_t Length() const;
4121 
4122  /**
4123  * Creates a JavaScript array with the given length. If the length
4124  * is negative the returned array will have length 0.
4125  */
4126  static Local<Array> New(Isolate* isolate, int length = 0);
4127 
4128  /**
4129  * Creates a JavaScript array out of a Local<Value> array in C++
4130  * with a known length.
4131  */
4132  static Local<Array> New(Isolate* isolate, Local<Value>* elements,
4133  size_t length);
4134  V8_INLINE static Array* Cast(Value* obj);
4135  private:
4136  Array();
4137  static void CheckCast(Value* obj);
4138 };
4139 
4140 
4141 /**
4142  * An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1).
4143  */
4144 class V8_EXPORT Map : public Object {
4145  public:
4146  size_t Size() const;
4147  void Clear();
4149  Local<Value> key);
4151  Local<Value> key,
4152  Local<Value> value);
4154  Local<Value> key);
4156  Local<Value> key);
4157 
4158  /**
4159  * Returns an array of length Size() * 2, where index N is the Nth key and
4160  * index N + 1 is the Nth value.
4161  */
4162  Local<Array> AsArray() const;
4163 
4164  /**
4165  * Creates a new empty Map.
4166  */
4167  static Local<Map> New(Isolate* isolate);
4168 
4169  V8_INLINE static Map* Cast(Value* obj);
4170 
4171  private:
4172  Map();
4173  static void CheckCast(Value* obj);
4174 };
4175 
4176 
4177 /**
4178  * An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1).
4179  */
4180 class V8_EXPORT Set : public Object {
4181  public:
4182  size_t Size() const;
4183  void Clear();
4185  Local<Value> key);
4187  Local<Value> key);
4189  Local<Value> key);
4190 
4191  /**
4192  * Returns an array of the keys in this Set.
4193  */
4194  Local<Array> AsArray() const;
4195 
4196  /**
4197  * Creates a new empty Set.
4198  */
4199  static Local<Set> New(Isolate* isolate);
4200 
4201  V8_INLINE static Set* Cast(Value* obj);
4202 
4203  private:
4204  Set();
4205  static void CheckCast(Value* obj);
4206 };
4207 
4208 
4209 template<typename T>
4211  public:
4212  template <class S> V8_INLINE ReturnValue(const ReturnValue<S>& that)
4213  : value_(that.value_) {
4214  static_assert(std::is_base_of<T, S>::value, "type check");
4215  }
4216  // Local setters
4217  template <typename S>
4218  V8_INLINE void Set(const Global<S>& handle);
4219  template <typename S>
4220  V8_INLINE void Set(const TracedReferenceBase<S>& handle);
4221  template <typename S>
4222  V8_INLINE void Set(const Local<S> handle);
4223  // Fast primitive setters
4224  V8_INLINE void Set(bool value);
4225  V8_INLINE void Set(double i);
4226  V8_INLINE void Set(int32_t i);
4227  V8_INLINE void Set(uint32_t i);
4228  // Fast JS primitive setters
4229  V8_INLINE void SetNull();
4230  V8_INLINE void SetUndefined();
4231  V8_INLINE void SetEmptyString();
4232  // Convenience getter for Isolate
4233  V8_INLINE Isolate* GetIsolate() const;
4234 
4235  // Pointer setter: Uncompilable to prevent inadvertent misuse.
4236  template <typename S>
4237  V8_INLINE void Set(S* whatever);
4238 
4239  // Getter. Creates a new Local<> so it comes with a certain performance
4240  // hit. If the ReturnValue was not yet set, this will return the undefined
4241  // value.
4242  V8_INLINE Local<Value> Get() const;
4243 
4244  private:
4245  template<class F> friend class ReturnValue;
4246  template<class F> friend class FunctionCallbackInfo;
4247  template<class F> friend class PropertyCallbackInfo;
4248  template <class F, class G, class H>
4250  V8_INLINE void SetInternal(internal::Address value) { *value_ = value; }
4251  V8_INLINE internal::Address GetDefaultValue();
4252  V8_INLINE explicit ReturnValue(internal::Address* slot);
4253  internal::Address* value_;
4254 };
4255 
4256 
4257 /**
4258  * The argument information given to function call callbacks. This
4259  * class provides access to information about the context of the call,
4260  * including the receiver, the number and values of arguments, and
4261  * the holder of the function.
4262  */
4263 template<typename T>
4265  public:
4266  /** The number of available arguments. */
4267  V8_INLINE int Length() const;
4268  /**
4269  * Accessor for the available arguments. Returns `undefined` if the index
4270  * is out of bounds.
4271  */
4272  V8_INLINE Local<Value> operator[](int i) const;
4273  /** Returns the receiver. This corresponds to the "this" value. */
4274  V8_INLINE Local<Object> This() const;
4275  /**
4276  * If the callback was created without a Signature, this is the same
4277  * value as This(). If there is a signature, and the signature didn't match
4278  * This() but one of its hidden prototypes, this will be the respective
4279  * hidden prototype.
4280  *
4281  * Note that this is not the prototype of This() on which the accessor
4282  * referencing this callback was found (which in V8 internally is often
4283  * referred to as holder [sic]).
4284  */
4285  V8_INLINE Local<Object> Holder() const;
4286  /** For construct calls, this returns the "new.target" value. */
4287  V8_INLINE Local<Value> NewTarget() const;
4288  /** Indicates whether this is a regular call or a construct call. */
4289  V8_INLINE bool IsConstructCall() const;
4290  /** The data argument specified when creating the callback. */
4291  V8_INLINE Local<Value> Data() const;
4292  /** The current Isolate. */
4293  V8_INLINE Isolate* GetIsolate() const;
4294  /** The ReturnValue for the call. */
4296  // This shouldn't be public, but the arm compiler needs it.
4297  static const int kArgsLength = 6;
4298 
4299  protected:
4300  friend class internal::FunctionCallbackArguments;
4302  friend class debug::ConsoleCallArguments;
4303  static const int kHolderIndex = 0;
4304  static const int kIsolateIndex = 1;
4305  static const int kReturnValueDefaultValueIndex = 2;
4306  static const int kReturnValueIndex = 3;
4307  static const int kDataIndex = 4;
4308  static const int kNewTargetIndex = 5;
4309 
4311  internal::Address* values, int length);
4314  int length_;
4315 };
4316 
4317 
4318 /**
4319  * The information passed to a property callback about the context
4320  * of the property access.
4321  */
4322 template<typename T>
4324  public:
4325  /**
4326  * \return The isolate of the property access.
4327  */
4329 
4330  /**
4331  * \return The data set in the configuration, i.e., in
4332  * `NamedPropertyHandlerConfiguration` or
4333  * `IndexedPropertyHandlerConfiguration.`
4334  */
4336 
4337  /**
4338  * \return The receiver. In many cases, this is the object on which the
4339  * property access was intercepted. When using
4340  * `Reflect.get`, `Function.prototype.call`, or similar functions, it is the
4341  * object passed in as receiver or thisArg.
4342  *
4343  * \code
4344  * void GetterCallback(Local<Name> name,
4345  * const v8::PropertyCallbackInfo<v8::Value>& info) {
4346  * auto context = info.GetIsolate()->GetCurrentContext();
4347  *
4348  * v8::Local<v8::Value> a_this =
4349  * info.This()
4350  * ->GetRealNamedProperty(context, v8_str("a"))
4351  * .ToLocalChecked();
4352  * v8::Local<v8::Value> a_holder =
4353  * info.Holder()
4354  * ->GetRealNamedProperty(context, v8_str("a"))
4355  * .ToLocalChecked();
4356  *
4357  * CHECK(v8_str("r")->Equals(context, a_this).FromJust());
4358  * CHECK(v8_str("obj")->Equals(context, a_holder).FromJust());
4359  *
4360  * info.GetReturnValue().Set(name);
4361  * }
4362  *
4363  * v8::Local<v8::FunctionTemplate> templ =
4364  * v8::FunctionTemplate::New(isolate);
4365  * templ->InstanceTemplate()->SetHandler(
4366  * v8::NamedPropertyHandlerConfiguration(GetterCallback));
4367  * LocalContext env;
4368  * env->Global()
4369  * ->Set(env.local(), v8_str("obj"), templ->GetFunction(env.local())
4370  * .ToLocalChecked()
4371  * ->NewInstance(env.local())
4372  * .ToLocalChecked())
4373  * .FromJust();
4374  *
4375  * CompileRun("obj.a = 'obj'; var r = {a: 'r'}; Reflect.get(obj, 'x', r)");
4376  * \endcode
4377  */
4379 
4380  /**
4381  * \return The object in the prototype chain of the receiver that has the
4382  * interceptor. Suppose you have `x` and its prototype is `y`, and `y`
4383  * has an interceptor. Then `info.This()` is `x` and `info.Holder()` is `y`.
4384  * The Holder() could be a hidden object (the global object, rather
4385  * than the global proxy).
4386  *
4387  * \note For security reasons, do not pass the object back into the runtime.
4388  */
4390 
4391  /**
4392  * \return The return value of the callback.
4393  * Can be changed by calling Set().
4394  * \code
4395  * info.GetReturnValue().Set(...)
4396  * \endcode
4397  *
4398  */
4400 
4401  /**
4402  * \return True if the intercepted function should throw if an error occurs.
4403  * Usually, `true` corresponds to `'use strict'`.
4404  *
4405  * \note Always `false` when intercepting `Reflect.set()`
4406  * independent of the language mode.
4407  */
4409 
4410  // This shouldn't be public, but the arm compiler needs it.
4411  static const int kArgsLength = 7;
4412 
4413  protected:
4414  friend class MacroAssembler;
4415  friend class internal::PropertyCallbackArguments;
4417  static const int kShouldThrowOnErrorIndex = 0;
4418  static const int kHolderIndex = 1;
4419  static const int kIsolateIndex = 2;
4420  static const int kReturnValueDefaultValueIndex = 3;
4421  static const int kReturnValueIndex = 4;
4422  static const int kDataIndex = 5;
4423  static const int kThisIndex = 6;
4424 
4427 };
4428 
4429 
4430 typedef void (*FunctionCallback)(const FunctionCallbackInfo<Value>& info);
4431 
4433 
4434 /**
4435  * A JavaScript function object (ECMA-262, 15.3).
4436  */
4437 class V8_EXPORT Function : public Object {
4438  public:
4439  /**
4440  * Create a function in the current execution context
4441  * for a given FunctionCallback.
4442  */
4444  Local<Context> context, FunctionCallback callback,
4445  Local<Value> data = Local<Value>(), int length = 0,
4447  SideEffectType side_effect_type = SideEffectType::kHasSideEffect);
4448 
4450  Local<Context> context, int argc, Local<Value> argv[]) const;
4451 
4453  Local<Context> context) const {
4454  return NewInstance(context, 0, nullptr);
4455  }
4456 
4457  /**
4458  * When side effect checks are enabled, passing kHasNoSideEffect allows the
4459  * constructor to be invoked without throwing. Calls made within the
4460  * constructor are still checked.
4461  */
4463  Local<Context> context, int argc, Local<Value> argv[],
4464  SideEffectType side_effect_type = SideEffectType::kHasSideEffect) const;
4465 
4467  Local<Value> recv, int argc,
4468  Local<Value> argv[]);
4469 
4470  void SetName(Local<String> name);
4471  Local<Value> GetName() const;
4472 
4473  /**
4474  * Name inferred from variable or property assignment of this function.
4475  * Used to facilitate debugging and profiling of JavaScript code written
4476  * in an OO style, where many functions are anonymous but are assigned
4477  * to object properties.
4478  */
4480 
4481  /**
4482  * displayName if it is set, otherwise name if it is configured, otherwise
4483  * function name, otherwise inferred name.
4484  */
4486 
4487  /**
4488  * User-defined name assigned to the "displayName" property of this function.
4489  * Used to facilitate debugging and profiling of JavaScript code.
4490  */
4492 
4493  /**
4494  * Returns zero based line number of function body and
4495  * kLineOffsetNotFound if no information available.
4496  */
4497  int GetScriptLineNumber() const;
4498  /**
4499  * Returns zero based column number of function body and
4500  * kLineOffsetNotFound if no information available.
4501  */
4503 
4504  /**
4505  * Returns scriptId.
4506  */
4507  int ScriptId() const;
4508 
4509  /**
4510  * Returns the original function if this function is bound, else returns
4511  * v8::Undefined.
4512  */
4514 
4516  V8_INLINE static Function* Cast(Value* obj);
4517  static const int kLineOffsetNotFound;
4518 
4519  private:
4520  Function();
4521  static void CheckCast(Value* obj);
4522 };
4523 
4524 #ifndef V8_PROMISE_INTERNAL_FIELD_COUNT
4525 // The number of required internal fields can be defined by embedder.
4526 #define V8_PROMISE_INTERNAL_FIELD_COUNT 0
4527 #endif
4528 
4529 /**
4530  * An instance of the built-in Promise constructor (ES6 draft).
4531  */
4532 class V8_EXPORT Promise : public Object {
4533  public:
4534  /**
4535  * State of the promise. Each value corresponds to one of the possible values
4536  * of the [[PromiseState]] field.
4537  */
4539 
4540  class V8_EXPORT Resolver : public Object {
4541  public:
4542  /**
4543  * Create a new resolver, along with an associated promise in pending state.
4544  */
4546  Local<Context> context);
4547 
4548  /**
4549  * Extract the associated promise.
4550  */
4552 
4553  /**
4554  * Resolve/reject the associated promise with a given value.
4555  * Ignored if the promise is no longer pending.
4556  */
4558  Local<Value> value);
4559 
4561  Local<Value> value);
4562 
4563  V8_INLINE static Resolver* Cast(Value* obj);
4564 
4565  private:
4566  Resolver();
4567  static void CheckCast(Value* obj);
4568  };
4569 
4570  /**
4571  * Register a resolution/rejection handler with a promise.
4572  * The handler is given the respective resolution/rejection value as
4573  * an argument. If the promise is already resolved/rejected, the handler is
4574  * invoked at the end of turn.
4575  */
4577  Local<Function> handler);
4578 
4580  Local<Function> handler);
4581 
4583  Local<Function> on_fulfilled,
4584  Local<Function> on_rejected);
4585 
4586  /**
4587  * Returns true if the promise has at least one derived promise, and
4588  * therefore resolve/reject handlers (including default handler).
4589  */
4590  bool HasHandler();
4591 
4592  /**
4593  * Returns the content of the [[PromiseResult]] field. The Promise must not
4594  * be pending.
4595  */
4597 
4598  /**
4599  * Returns the value of the [[PromiseState]] field.
4600  */
4602 
4603  /**
4604  * Marks this promise as handled to avoid reporting unhandled rejections.
4605  */
4607 
4608  V8_INLINE static Promise* Cast(Value* obj);
4609 
4611 
4612  private:
4613  Promise();
4614  static void CheckCast(Value* obj);
4615 };
4616 
4617 /**
4618  * An instance of a Property Descriptor, see Ecma-262 6.2.4.
4619  *
4620  * Properties in a descriptor are present or absent. If you do not set
4621  * `enumerable`, `configurable`, and `writable`, they are absent. If `value`,
4622  * `get`, or `set` are absent, but you must specify them in the constructor, use
4623  * empty handles.
4624  *
4625  * Accessors `get` and `set` must be callable or undefined if they are present.
4626  *
4627  * \note Only query properties if they are present, i.e., call `x()` only if
4628  * `has_x()` returns true.
4629  *
4630  * \code
4631  * // var desc = {writable: false}
4632  * v8::PropertyDescriptor d(Local<Value>()), false);
4633  * d.value(); // error, value not set
4634  * if (d.has_writable()) {
4635  * d.writable(); // false
4636  * }
4637  *
4638  * // var desc = {value: undefined}
4639  * v8::PropertyDescriptor d(v8::Undefined(isolate));
4640  *
4641  * // var desc = {get: undefined}
4642  * v8::PropertyDescriptor d(v8::Undefined(isolate), Local<Value>()));
4643  * \endcode
4644  */
4646  public:
4647  // GenericDescriptor
4649 
4650  // DataDescriptor
4651  explicit PropertyDescriptor(Local<Value> value);
4652 
4653  // DataDescriptor with writable property
4654  PropertyDescriptor(Local<Value> value, bool writable);
4655 
4656  // AccessorDescriptor
4658 
4660 
4661  Local<Value> value() const;
4662  bool has_value() const;
4663 
4664  Local<Value> get() const;
4665  bool has_get() const;
4666  Local<Value> set() const;
4667  bool has_set() const;
4668 
4669  void set_enumerable(bool enumerable);
4670  bool enumerable() const;
4671  bool has_enumerable() const;
4672 
4673  void set_configurable(bool configurable);
4674  bool configurable() const;
4675  bool has_configurable() const;
4676 
4677  bool writable() const;
4678  bool has_writable() const;
4679 
4680  struct PrivateData;
4681  PrivateData* get_private() const { return private_; }
4682 
4684  void operator=(const PropertyDescriptor&) = delete;
4685 
4686  private:
4687  PrivateData* private_;
4688 };
4689 
4690 /**
4691  * An instance of the built-in Proxy constructor (ECMA-262, 6th Edition,
4692  * 26.2.1).
4693  */
4694 class V8_EXPORT Proxy : public Object {
4695  public:
4698  bool IsRevoked();
4699  void Revoke();
4700 
4701  /**
4702  * Creates a new Proxy for the target object.
4703  */
4704  static MaybeLocal<Proxy> New(Local<Context> context,
4705  Local<Object> local_target,
4706  Local<Object> local_handler);
4707 
4708  V8_INLINE static Proxy* Cast(Value* obj);
4709 
4710  private:
4711  Proxy();
4712  static void CheckCast(Value* obj);
4713 };
4714 
4715 /**
4716  * Points to an unowned continous buffer holding a known number of elements.
4717  *
4718  * This is similar to std::span (under consideration for C++20), but does not
4719  * require advanced C++ support. In the (far) future, this may be replaced with
4720  * or aliased to std::span.
4721  *
4722  * To facilitate future migration, this class exposes a subset of the interface
4723  * implemented by std::span.
4724  */
4725 template <typename T>
4727  public:
4728  /** The default constructor creates an empty span. */
4729  constexpr MemorySpan() = default;
4730 
4731  constexpr MemorySpan(T* data, size_t size) : data_(data), size_(size) {}
4732 
4733  /** Returns a pointer to the beginning of the buffer. */
4734  constexpr T* data() const { return data_; }
4735  /** Returns the number of elements that the buffer holds. */
4736  constexpr size_t size() const { return size_; }
4737 
4738  private:
4739  T* data_ = nullptr;
4740  size_t size_ = 0;
4741 };
4742 
4743 /**
4744  * An owned byte buffer with associated size.
4745  */
4746 struct OwnedBuffer {
4747  std::unique_ptr<const uint8_t[]> buffer;
4748  size_t size = 0;
4749  OwnedBuffer(std::unique_ptr<const uint8_t[]> buffer, size_t size)
4750  : buffer(std::move(buffer)), size(size) {}
4751  OwnedBuffer() = default;
4752 };
4753 
4754 // Wrapper around a compiled WebAssembly module, which is potentially shared by
4755 // different WasmModuleObjects.
4757  public:
4758  /**
4759  * Serialize the compiled module. The serialized data does not include the
4760  * wire bytes.
4761  */
4763 
4764  /**
4765  * Get the (wasm-encoded) wire bytes that were used to compile this module.
4766  */
4767  MemorySpan<const uint8_t> GetWireBytesRef();
4768 
4769  const std::string& source_url() const { return source_url_; }
4770 
4771  private:
4772  friend class WasmModuleObject;
4773  friend class WasmStreaming;
4774 
4775  explicit CompiledWasmModule(std::shared_ptr<internal::wasm::NativeModule>,
4776  const char* source_url, size_t url_length);
4777 
4778  const std::shared_ptr<internal::wasm::NativeModule> native_module_;
4779  const std::string source_url_;
4780 };
4781 
4782 // An instance of WebAssembly.Module.
4784  public:
4785  WasmModuleObject() = delete;
4786 
4787  /**
4788  * Efficiently re-create a WasmModuleObject, without recompiling, from
4789  * a CompiledWasmModule.
4790  */
4792  Isolate* isolate, const CompiledWasmModule&);
4793 
4794  /**
4795  * Get the compiled module for this module object. The compiled module can be
4796  * shared by several module objects.
4797  */
4799 
4800  V8_INLINE static WasmModuleObject* Cast(Value* obj);
4801 
4802  private:
4803  static void CheckCast(Value* obj);
4804 };
4805 
4806 /**
4807  * The V8 interface for WebAssembly streaming compilation. When streaming
4808  * compilation is initiated, V8 passes a {WasmStreaming} object to the embedder
4809  * such that the embedder can pass the input bytes for streaming compilation to
4810  * V8.
4811  */
4812 class V8_EXPORT WasmStreaming final {
4813  public:
4814  class WasmStreamingImpl;
4815 
4816  /**
4817  * Client to receive streaming event notifications.
4818  */
4819  class Client {
4820  public:
4821  virtual ~Client() = default;
4822  /**
4823  * Passes the fully compiled module to the client. This can be used to
4824  * implement code caching.
4825  */
4826  virtual void OnModuleCompiled(CompiledWasmModule compiled_module) = 0;
4827  };
4828 
4829  explicit WasmStreaming(std::unique_ptr<WasmStreamingImpl> impl);
4830 
4832 
4833  /**
4834  * Pass a new chunk of bytes to WebAssembly streaming compilation.
4835  * The buffer passed into {OnBytesReceived} is owned by the caller.
4836  */
4837  void OnBytesReceived(const uint8_t* bytes, size_t size);
4838 
4839  /**
4840  * {Finish} should be called after all received bytes where passed to
4841  * {OnBytesReceived} to tell V8 that there will be no more bytes. {Finish}
4842  * does not have to be called after {Abort} has been called already.
4843  */
4844  void Finish();
4845 
4846  /**
4847  * Abort streaming compilation. If {exception} has a value, then the promise
4848  * associated with streaming compilation is rejected with that value. If
4849  * {exception} does not have value, the promise does not get rejected.
4850  */
4851  void Abort(MaybeLocal<Value> exception);
4852 
4853  /**
4854  * Passes previously compiled module bytes. This must be called before
4855  * {OnBytesReceived}, {Finish}, or {Abort}. Returns true if the module bytes
4856  * can be used, false otherwise. The buffer passed via {bytes} and {size}
4857  * is owned by the caller. If {SetCompiledModuleBytes} returns true, the
4858  * buffer must remain valid until either {Finish} or {Abort} completes.
4859  */
4860  bool SetCompiledModuleBytes(const uint8_t* bytes, size_t size);
4861 
4862  /**
4863  * Sets the client object that will receive streaming event notifications.
4864  * This must be called before {OnBytesReceived}, {Finish}, or {Abort}.
4865  */
4866  void SetClient(std::shared_ptr<Client> client);
4867 
4868  /*
4869  * Sets the UTF-8 encoded source URL for the {Script} object. This must be
4870  * called before {Finish}.
4871  */
4872  void SetUrl(const char* url, size_t length);
4873 
4874  /**
4875  * Unpacks a {WasmStreaming} object wrapped in a {Managed} for the embedder.
4876  * Since the embedder is on the other side of the API, it cannot unpack the
4877  * {Managed} itself.
4878  */
4879  static std::shared_ptr<WasmStreaming> Unpack(Isolate* isolate,
4880  Local<Value> value);
4881 
4882  private:
4883  std::unique_ptr<WasmStreamingImpl> impl_;
4884 };
4885 
4886 // TODO(mtrofin): when streaming compilation is done, we can rename this
4887 // to simply WasmModuleObjectBuilder
4888 class V8_EXPORT WasmModuleObjectBuilderStreaming final {
4889  public:
4891  /**
4892  * The buffer passed into OnBytesReceived is owned by the caller.
4893  */
4894  void OnBytesReceived(const uint8_t*, size_t size);
4895  void Finish();
4896  /**
4897  * Abort streaming compilation. If {exception} has a value, then the promise
4898  * associated with streaming compilation is rejected with that value. If
4899  * {exception} does not have value, the promise does not get rejected.
4900  */
4901  void Abort(MaybeLocal<Value> exception);
4903 
4905 
4906  private:
4907  WasmModuleObjectBuilderStreaming(const WasmModuleObjectBuilderStreaming&) =
4908  delete;
4909  WasmModuleObjectBuilderStreaming(WasmModuleObjectBuilderStreaming&&) =
4910  default;
4911  WasmModuleObjectBuilderStreaming& operator=(
4912  const WasmModuleObjectBuilderStreaming&) = delete;
4913  WasmModuleObjectBuilderStreaming& operator=(
4914  WasmModuleObjectBuilderStreaming&&) = default;
4915  Isolate* isolate_ = nullptr;
4916 
4917 #if V8_CC_MSVC
4918  /**
4919  * We don't need the static Copy API, so the default
4920  * NonCopyablePersistentTraits would be sufficient, however,
4921  * MSVC eagerly instantiates the Copy.
4922  * We ensure we don't use Copy, however, by compiling with the
4923  * defaults everywhere else.
4924  */
4925  Persistent<Promise, CopyablePersistentTraits<Promise>> promise_;
4926 #else
4927  Persistent<Promise> promise_;
4928 #endif
4929  std::shared_ptr<internal::wasm::StreamingDecoder> streaming_decoder_;
4930 };
4931 
4932 #ifndef V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT
4933 // The number of required internal fields can be defined by embedder.
4934 #define V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT 2
4935 #endif
4936 
4937 
4939 
4940 /**
4941  * A wrapper around the backing store (i.e. the raw memory) of an array buffer.
4942  * See a document linked in http://crbug.com/v8/9908 for more information.
4943  *
4944  * The allocation and destruction of backing stores is generally managed by
4945  * V8. Clients should always use standard C++ memory ownership types (i.e.
4946  * std::unique_ptr and std::shared_ptr) to manage lifetimes of backing stores
4947  * properly, since V8 internal objects may alias backing stores.
4948  *
4949  * This object does not keep the underlying |ArrayBuffer::Allocator| alive by
4950  * default. Use Isolate::CreateParams::array_buffer_allocator_shared when
4951  * creating the Isolate to make it hold a reference to the allocator itself.
4952  */
4954  public:
4956 
4957  /**
4958  * Return a pointer to the beginning of the memory block for this backing
4959  * store. The pointer is only valid as long as this backing store object
4960  * lives.
4961  */
4962  void* Data() const;
4963 
4964  /**
4965  * The length (in bytes) of this backing store.
4966  */
4967  size_t ByteLength() const;
4968 
4969  /**
4970  * Indicates whether the backing store was created for an ArrayBuffer or
4971  * a SharedArrayBuffer.
4972  */
4973  bool IsShared() const;
4974 
4975  /**
4976  * Wrapper around ArrayBuffer::Allocator::Reallocate that preserves IsShared.
4977  * Assumes that the backing_store was allocated by the ArrayBuffer allocator
4978  * of the given isolate.
4979  */
4980  static std::unique_ptr<BackingStore> Reallocate(
4981  v8::Isolate* isolate, std::unique_ptr<BackingStore> backing_store,
4982  size_t byte_length);
4983 
4984  /**
4985  * This callback is used only if the memory block for a BackingStore cannot be
4986  * allocated with an ArrayBuffer::Allocator. In such cases the destructor of
4987  * the BackingStore invokes the callback to free the memory block.
4988  */
4989  using DeleterCallback = void (*)(void* data, size_t length,
4990  void* deleter_data);
4991 
4992  /**
4993  * If the memory block of a BackingStore is static or is managed manually,
4994  * then this empty deleter along with nullptr deleter_data can be passed to
4995  * ArrayBuffer::NewBackingStore to indicate that.
4996  *
4997  * The manually managed case should be used with caution and only when it
4998  * is guaranteed that the memory block freeing happens after detaching its
4999  * ArrayBuffer.
5000  */
5001  static void EmptyDeleter(void* data, size_t length, void* deleter_data);
5002 
5003  private:
5004  /**
5005  * See [Shared]ArrayBuffer::GetBackingStore and
5006  * [Shared]ArrayBuffer::NewBackingStore.
5007  */
5008  BackingStore();
5009 };
5010 
5011 #if !defined(V8_IMMINENT_DEPRECATION_WARNINGS)
5012 // Use v8::BackingStore::DeleterCallback instead.
5013 using BackingStoreDeleterCallback = void (*)(void* data, size_t length,
5014  void* deleter_data);
5015 
5016 #endif
5017 
5018 /**
5019  * An instance of the built-in ArrayBuffer constructor (ES6 draft 15.13.5).
5020  */
5021 class V8_EXPORT ArrayBuffer : public Object {
5022  public:
5023  /**
5024  * A thread-safe allocator that V8 uses to allocate |ArrayBuffer|'s memory.
5025  * The allocator is a global V8 setting. It has to be set via
5026  * Isolate::CreateParams.
5027  *
5028  * Memory allocated through this allocator by V8 is accounted for as external
5029  * memory by V8. Note that V8 keeps track of the memory for all internalized
5030  * |ArrayBuffer|s. Responsibility for tracking external memory (using
5031  * Isolate::AdjustAmountOfExternalAllocatedMemory) is handed over to the
5032  * embedder upon externalization and taken over upon internalization (creating
5033  * an internalized buffer from an existing buffer).
5034  *
5035  * Note that it is unsafe to call back into V8 from any of the allocator
5036  * functions.
5037  */
5038  class V8_EXPORT Allocator { // NOLINT
5039  public:
5040  virtual ~Allocator() = default;
5041 
5042  /**
5043  * Allocate |length| bytes. Return nullptr if allocation is not successful.
5044  * Memory should be initialized to zeroes.
5045  */
5046  virtual void* Allocate(size_t length) = 0;
5047 
5048  /**
5049  * Allocate |length| bytes. Return nullptr if allocation is not successful.
5050  * Memory does not have to be initialized.
5051  */
5052  virtual void* AllocateUninitialized(size_t length) = 0;
5053 
5054  /**
5055  * Free the memory block of size |length|, pointed to by |data|.
5056  * That memory is guaranteed to be previously allocated by |Allocate|.
5057  */
5058  virtual void Free(void* data, size_t length) = 0;
5059 
5060  /**
5061  * Reallocate the memory block of size |old_length| to a memory block of
5062  * size |new_length| by expanding, contracting, or copying the existing
5063  * memory block. If |new_length| > |old_length|, then the new part of
5064  * the memory must be initialized to zeros. Return nullptr if reallocation
5065  * is not successful.
5066  *
5067  * The caller guarantees that the memory block was previously allocated
5068  * using Allocate or AllocateUninitialized.
5069  *
5070  * The default implementation allocates a new block and copies data.
5071  */
5072  virtual void* Reallocate(void* data, size_t old_length, size_t new_length);
5073 
5074  /**
5075  * ArrayBuffer allocation mode. kNormal is a malloc/free style allocation,
5076  * while kReservation is for larger allocations with the ability to set
5077  * access permissions.
5078  */
5080 
5081  /**
5082  * malloc/free based convenience allocator.
5083  *
5084  * Caller takes ownership, i.e. the returned object needs to be freed using
5085  * |delete allocator| once it is no longer in use.
5086  */
5088  };
5089 
5090  /**
5091  * The contents of an |ArrayBuffer|. Externalization of |ArrayBuffer|
5092  * returns an instance of this class, populated, with a pointer to data
5093  * and byte length.
5094  *
5095  * The Data pointer of ArrayBuffer::Contents must be freed using the provided
5096  * deleter, which will call ArrayBuffer::Allocator::Free if the buffer
5097  * was allocated with ArraryBuffer::Allocator::Allocate.
5098  */
5099  class V8_EXPORT Contents { // NOLINT
5100  public:
5101  using DeleterCallback = void (*)(void* buffer, size_t length, void* info);
5102 
5104  : data_(nullptr),
5105  byte_length_(0),
5106  allocation_base_(nullptr),
5107  allocation_length_(0),
5108  allocation_mode_(Allocator::AllocationMode::kNormal),
5109  deleter_(nullptr),
5110  deleter_data_(nullptr) {}
5111 
5112  void* AllocationBase() const { return allocation_base_; }
5113  size_t AllocationLength() const { return allocation_length_; }
5114  Allocator::AllocationMode AllocationMode() const {
5115  return allocation_mode_;
5116  }
5117 
5118  void* Data() const { return data_; }
5119  size_t ByteLength() const { return byte_length_; }
5120  DeleterCallback Deleter() const { return deleter_; }
5121  void* DeleterData() const { return deleter_data_; }
5122 
5123  private:
5124  Contents(void* data, size_t byte_length, void* allocation_base,
5125  size_t allocation_length,
5126  Allocator::AllocationMode allocation_mode, DeleterCallback deleter,
5127  void* deleter_data);
5128 
5129  void* data_;
5130  size_t byte_length_;
5131  void* allocation_base_;
5132  size_t allocation_length_;
5133  Allocator::AllocationMode allocation_mode_;
5134  DeleterCallback deleter_;
5135  void* deleter_data_;
5136 
5137  friend class ArrayBuffer;
5138  };
5139 
5140 
5141  /**
5142  * Data length in bytes.
5143  */
5144  size_t ByteLength() const;
5145 
5146  /**
5147  * Create a new ArrayBuffer. Allocate |byte_length| bytes.
5148  * Allocated memory will be owned by a created ArrayBuffer and
5149  * will be deallocated when it is garbage-collected,
5150  * unless the object is externalized.
5151  */
5152  static Local<ArrayBuffer> New(Isolate* isolate, size_t byte_length);
5153 
5154  /**
5155  * Create a new ArrayBuffer over an existing memory block.
5156  * The created array buffer is by default immediately in externalized state.
5157  * In externalized state, the memory block will not be reclaimed when a
5158  * created ArrayBuffer is garbage-collected.
5159  * In internalized state, the memory block will be released using
5160  * |Allocator::Free| once all ArrayBuffers referencing it are collected by
5161  * the garbage collector.
5162  */
5164  "Use the version that takes a BackingStore. "
5165  "See http://crbug.com/v8/9908.")
5166  static Local<ArrayBuffer> New(
5167  Isolate* isolate, void* data, size_t byte_length,
5169 
5170  /**
5171  * Create a new ArrayBuffer with an existing backing store.
5172  * The created array keeps a reference to the backing store until the array
5173  * is garbage collected. Note that the IsExternal bit does not affect this
5174  * reference from the array to the backing store.
5175  *
5176  * In future IsExternal bit will be removed. Until then the bit is set as
5177  * follows. If the backing store does not own the underlying buffer, then
5178  * the array is created in externalized state. Otherwise, the array is created
5179  * in internalized state. In the latter case the array can be transitioned
5180  * to the externalized state using Externalize(backing_store).
5181  */
5182  static Local<ArrayBuffer> New(Isolate* isolate,
5183  std::shared_ptr<BackingStore> backing_store);
5184 
5185  /**
5186  * Returns a new standalone BackingStore that is allocated using the array
5187  * buffer allocator of the isolate. The result can be later passed to
5188  * ArrayBuffer::New.
5189  *
5190  * If the allocator returns nullptr, then the function may cause GCs in the
5191  * given isolate and re-try the allocation. If GCs do not help, then the
5192  * function will crash with an out-of-memory error.
5193  */
5194  static std::unique_ptr<BackingStore> NewBackingStore(Isolate* isolate,
5195  size_t byte_length);
5196  /**
5197  * Returns a new standalone BackingStore that takes over the ownership of
5198  * the given buffer. The destructor of the BackingStore invokes the given
5199  * deleter callback.
5200  *
5201  * The result can be later passed to ArrayBuffer::New. The raw pointer
5202  * to the buffer must not be passed again to any V8 API function.
5203  */
5204  static std::unique_ptr<BackingStore> NewBackingStore(
5205  void* data, size_t byte_length, v8::BackingStore::DeleterCallback deleter,
5206  void* deleter_data);
5207 
5208  /**
5209  * Returns true if ArrayBuffer is externalized, that is, does not
5210  * own its memory block.
5211  */
5213  "With v8::BackingStore externalized ArrayBuffers are "
5214  "the same as ordinary ArrayBuffers. See http://crbug.com/v8/9908.")
5215  bool IsExternal() const;
5216 
5217  /**
5218  * Returns true if this ArrayBuffer may be detached.
5219  */
5220  bool IsDetachable() const;
5221 
5222  /**
5223  * Detaches this ArrayBuffer and all its views (typed arrays).
5224  * Detaching sets the byte length of the buffer and all typed arrays to zero,
5225  * preventing JavaScript from ever accessing underlying backing store.
5226  * ArrayBuffer should have been externalized and must be detachable.
5227  */
5228  void Detach();
5229 
5230  /**
5231  * Make this ArrayBuffer external. The pointer to underlying memory block
5232  * and byte length are returned as |Contents| structure. After ArrayBuffer
5233  * had been externalized, it does no longer own the memory block. The caller
5234  * should take steps to free memory when it is no longer needed.
5235  *
5236  * The Data pointer of ArrayBuffer::Contents must be freed using the provided
5237  * deleter, which will call ArrayBuffer::Allocator::Free if the buffer
5238  * was allocated with ArrayBuffer::Allocator::Allocate.
5239  */
5241  "Use GetBackingStore or Detach. See http://crbug.com/v8/9908.")
5242  Contents Externalize();
5243 
5244  /**
5245  * Marks this ArrayBuffer external given a witness that the embedder
5246  * has fetched the backing store using the new GetBackingStore() function.
5247  *
5248  * With the new lifetime management of backing stores there is no need for
5249  * externalizing, so this function exists only to make the transition easier.
5250  */
5251  V8_DEPRECATE_SOON("This will be removed together with IsExternal.")
5252  void Externalize(const std::shared_ptr<BackingStore>& backing_store);
5253 
5254  /**
5255  * Get a pointer to the ArrayBuffer's underlying memory block without
5256  * externalizing it. If the ArrayBuffer is not externalized, this pointer
5257  * will become invalid as soon as the ArrayBuffer gets garbage collected.
5258  *
5259  * The embedder should make sure to hold a strong reference to the
5260  * ArrayBuffer while accessing this pointer.
5261  */
5262  V8_DEPRECATE_SOON("Use GetBackingStore. See http://crbug.com/v8/9908.")
5264 
5265  /**
5266  * Get a shared pointer to the backing store of this array buffer. This
5267  * pointer coordinates the lifetime management of the internal storage
5268  * with any live ArrayBuffers on the heap, even across isolates. The embedder
5269  * should not attempt to manage lifetime of the storage through other means.
5270  *
5271  * This function replaces both Externalize() and GetContents().
5272  */
5273  std::shared_ptr<BackingStore> GetBackingStore();
5274 
5275  V8_INLINE static ArrayBuffer* Cast(Value* obj);
5276 
5279 
5280  private:
5281  ArrayBuffer();
5282  static void CheckCast(Value* obj);
5283  Contents GetContents(bool externalize);
5284 };
5285 
5286 
5287 #ifndef V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT
5288 // The number of required internal fields can be defined by embedder.
5289 #define V8_ARRAY_BUFFER_VIEW_INTERNAL_FIELD_COUNT 2
5290 #endif
5291 
5292 
5293 /**
5294  * A base class for an instance of one of "views" over ArrayBuffer,
5295  * including TypedArrays and DataView (ES6 draft 15.13).
5296  */
5298  public:
5299  /**
5300  * Returns underlying ArrayBuffer.
5301  */
5303  /**
5304  * Byte offset in |Buffer|.
5305  */
5306  size_t ByteOffset();
5307  /**
5308  * Size of a view in bytes.
5309  */
5310  size_t ByteLength();
5311 
5312  /**
5313  * Copy the contents of the ArrayBufferView's buffer to an embedder defined
5314  * memory without additional overhead that calling ArrayBufferView::Buffer
5315  * might incur.
5316  *
5317  * Will write at most min(|byte_length|, ByteLength) bytes starting at
5318  * ByteOffset of the underlying buffer to the memory starting at |dest|.
5319  * Returns the number of bytes actually written.
5320  */
5321  size_t CopyContents(void* dest, size_t byte_length);
5322 
5323  /**
5324  * Returns true if ArrayBufferView's backing ArrayBuffer has already been
5325  * allocated.
5326  */
5327  bool HasBuffer() const;
5328 
5329  V8_INLINE static ArrayBufferView* Cast(Value* obj);
5330 
5331  static const int kInternalFieldCount =
5333  static const int kEmbedderFieldCount =
5335 
5336  private:
5337  ArrayBufferView();
5338  static void CheckCast(Value* obj);
5339 };
5340 
5341 
5342 /**
5343  * A base class for an instance of TypedArray series of constructors
5344  * (ES6 draft 15.13.6).
5345  */
5347  public:
5348  /*
5349  * The largest typed array size that can be constructed using New.
5350  */
5351  static constexpr size_t kMaxLength = internal::kApiSystemPointerSize == 4
5353  : 0xFFFFFFFF;
5354 
5355  /**
5356  * Number of elements in this typed array
5357  * (e.g. for Int16Array, |ByteLength|/2).
5358  */
5359  size_t Length();
5360 
5361  V8_INLINE static TypedArray* Cast(Value* obj);
5362 
5363  private:
5364  TypedArray();
5365  static void CheckCast(Value* obj);
5366 };
5367 
5368 
5369 /**
5370  * An instance of Uint8Array constructor (ES6 draft 15.13.6).
5371  */
5373  public:
5374  static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer,
5375  size_t byte_offset, size_t length);
5376  static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5377  size_t byte_offset, size_t length);
5378  V8_INLINE static Uint8Array* Cast(Value* obj);
5379 
5380  private:
5381  Uint8Array();
5382  static void CheckCast(Value* obj);
5383 };
5384 
5385 
5386 /**
5387  * An instance of Uint8ClampedArray constructor (ES6 draft 15.13.6).
5388  */
5390  public:
5392  size_t byte_offset, size_t length);
5394  Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset,
5395  size_t length);
5396  V8_INLINE static Uint8ClampedArray* Cast(Value* obj);
5397 
5398  private:
5399  Uint8ClampedArray();
5400  static void CheckCast(Value* obj);
5401 };
5402 
5403 /**
5404  * An instance of Int8Array constructor (ES6 draft 15.13.6).
5405  */
5407  public:
5408  static Local<Int8Array> New(Local<ArrayBuffer> array_buffer,
5409  size_t byte_offset, size_t length);
5410  static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5411  size_t byte_offset, size_t length);
5412  V8_INLINE static Int8Array* Cast(Value* obj);
5413 
5414  private:
5415  Int8Array();
5416  static void CheckCast(Value* obj);
5417 };
5418 
5419 
5420 /**
5421  * An instance of Uint16Array constructor (ES6 draft 15.13.6).
5422  */
5424  public:
5425  static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer,
5426  size_t byte_offset, size_t length);
5427  static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5428  size_t byte_offset, size_t length);
5429  V8_INLINE static Uint16Array* Cast(Value* obj);
5430 
5431  private:
5432  Uint16Array();
5433  static void CheckCast(Value* obj);
5434 };
5435 
5436 
5437 /**
5438  * An instance of Int16Array constructor (ES6 draft 15.13.6).
5439  */
5441  public:
5442  static Local<Int16Array> New(Local<ArrayBuffer> array_buffer,
5443  size_t byte_offset, size_t length);
5444  static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5445  size_t byte_offset, size_t length);
5446  V8_INLINE static Int16Array* Cast(Value* obj);
5447 
5448  private:
5449  Int16Array();
5450  static void CheckCast(Value* obj);
5451 };
5452 
5453 
5454 /**
5455  * An instance of Uint32Array constructor (ES6 draft 15.13.6).
5456  */
5458  public:
5459  static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer,
5460  size_t byte_offset, size_t length);
5461  static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5462  size_t byte_offset, size_t length);
5463  V8_INLINE static Uint32Array* Cast(Value* obj);
5464 
5465  private:
5466  Uint32Array();
5467  static void CheckCast(Value* obj);
5468 };
5469 
5470 
5471 /**
5472  * An instance of Int32Array constructor (ES6 draft 15.13.6).
5473  */
5475  public:
5476  static Local<Int32Array> New(Local<ArrayBuffer> array_buffer,
5477  size_t byte_offset, size_t length);
5478  static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5479  size_t byte_offset, size_t length);
5480  V8_INLINE static Int32Array* Cast(Value* obj);
5481 
5482  private:
5483  Int32Array();
5484  static void CheckCast(Value* obj);
5485 };
5486 
5487 
5488 /**
5489  * An instance of Float32Array constructor (ES6 draft 15.13.6).
5490  */
5492  public:
5493  static Local<Float32Array> New(Local<ArrayBuffer> array_buffer,
5494  size_t byte_offset, size_t length);
5495  static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5496  size_t byte_offset, size_t length);
5497  V8_INLINE static Float32Array* Cast(Value* obj);
5498 
5499  private:
5500  Float32Array();
5501  static void CheckCast(Value* obj);
5502 };
5503 
5504 
5505 /**
5506  * An instance of Float64Array constructor (ES6 draft 15.13.6).
5507  */
5509  public:
5510  static Local<Float64Array> New(Local<ArrayBuffer> array_buffer,
5511  size_t byte_offset, size_t length);
5512  static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5513  size_t byte_offset, size_t length);
5514  V8_INLINE static Float64Array* Cast(Value* obj);
5515 
5516  private:
5517  Float64Array();
5518  static void CheckCast(Value* obj);
5519 };
5520 
5521 /**
5522  * An instance of BigInt64Array constructor.
5523  */
5525  public:
5526  static Local<BigInt64Array> New(Local<ArrayBuffer> array_buffer,
5527  size_t byte_offset, size_t length);
5528  static Local<BigInt64Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5529  size_t byte_offset, size_t length);
5530  V8_INLINE static BigInt64Array* Cast(Value* obj);
5531 
5532  private:
5533  BigInt64Array();
5534  static void CheckCast(Value* obj);
5535 };
5536 
5537 /**
5538  * An instance of BigUint64Array constructor.
5539  */
5541  public:
5542  static Local<BigUint64Array> New(Local<ArrayBuffer> array_buffer,
5543  size_t byte_offset, size_t length);
5544  static Local<BigUint64Array> New(Local<SharedArrayBuffer> shared_array_buffer,
5545  size_t byte_offset, size_t length);
5546  V8_INLINE static BigUint64Array* Cast(Value* obj);
5547 
5548  private:
5549  BigUint64Array();
5550  static void CheckCast(Value* obj);
5551 };
5552 
5553 /**
5554  * An instance of DataView constructor (ES6 draft 15.13.7).
5555  */
5557  public:
5558  static Local<DataView> New(Local<ArrayBuffer> array_buffer,
5559  size_t byte_offset, size_t length);
5560  static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer,
5561  size_t byte_offset, size_t length);
5562  V8_INLINE static DataView* Cast(Value* obj);
5563 
5564  private:
5565  DataView();
5566  static void CheckCast(Value* obj);
5567 };
5568 
5569 
5570 /**
5571  * An instance of the built-in SharedArrayBuffer constructor.
5572  */
5574  public:
5575  /**
5576  * The contents of an |SharedArrayBuffer|. Externalization of
5577  * |SharedArrayBuffer| returns an instance of this class, populated, with a
5578  * pointer to data and byte length.
5579  *
5580  * The Data pointer of ArrayBuffer::Contents must be freed using the provided
5581  * deleter, which will call ArrayBuffer::Allocator::Free if the buffer
5582  * was allocated with ArraryBuffer::Allocator::Allocate.
5583  */
5584  class V8_EXPORT Contents { // NOLINT
5585  public:
5586  using Allocator = v8::ArrayBuffer::Allocator;
5587  using DeleterCallback = void (*)(void* buffer, size_t length, void* info);
5588 
5590  : data_(nullptr),
5591  byte_length_(0),
5592  allocation_base_(nullptr),
5593  allocation_length_(0),
5594  allocation_mode_(Allocator::AllocationMode::kNormal),
5595  deleter_(nullptr),
5596  deleter_data_(nullptr) {}
5597 
5598  void* AllocationBase() const { return allocation_base_; }
5599  size_t AllocationLength() const { return allocation_length_; }
5600  Allocator::AllocationMode AllocationMode() const {
5601  return allocation_mode_;
5602  }
5603 
5604  void* Data() const { return data_; }
5605  size_t ByteLength() const { return byte_length_; }
5606  DeleterCallback Deleter() const { return deleter_; }
5607  void* DeleterData() const { return deleter_data_; }
5608 
5609  private:
5610  Contents(void* data, size_t byte_length, void* allocation_base,
5611  size_t allocation_length,
5612  Allocator::AllocationMode allocation_mode, DeleterCallback deleter,
5613  void* deleter_data);
5614 
5615  void* data_;
5616  size_t byte_length_;
5617  void* allocation_base_;
5618  size_t allocation_length_;
5619  Allocator::AllocationMode allocation_mode_;
5620  DeleterCallback deleter_;
5621  void* deleter_data_;
5622 
5623  friend class SharedArrayBuffer;
5624  };
5625 
5626  /**
5627  * Data length in bytes.
5628  */
5629  size_t ByteLength() const;
5630 
5631  /**
5632  * Create a new SharedArrayBuffer. Allocate |byte_length| bytes.
5633  * Allocated memory will be owned by a created SharedArrayBuffer and
5634  * will be deallocated when it is garbage-collected,
5635  * unless the object is externalized.
5636  */
5637  static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length);
5638 
5639  /**
5640  * Create a new SharedArrayBuffer over an existing memory block. The created
5641  * array buffer is immediately in externalized state unless otherwise
5642  * specified. The memory block will not be reclaimed when a created
5643  * SharedArrayBuffer is garbage-collected.
5644  */
5646  "Use the version that takes a BackingStore. "
5647  "See http://crbug.com/v8/9908.")
5648  static Local<SharedArrayBuffer> New(
5649  Isolate* isolate, void* data, size_t byte_length,
5651 
5652  /**
5653  * Create a new SharedArrayBuffer with an existing backing store.
5654  * The created array keeps a reference to the backing store until the array
5655  * is garbage collected. Note that the IsExternal bit does not affect this
5656  * reference from the array to the backing store.
5657  *
5658  * In future IsExternal bit will be removed. Until then the bit is set as
5659  * follows. If the backing store does not own the underlying buffer, then
5660  * the array is created in externalized state. Otherwise, the array is created
5661  * in internalized state. In the latter case the array can be transitioned
5662  * to the externalized state using Externalize(backing_store).
5663  */
5665  Isolate* isolate, std::shared_ptr<BackingStore> backing_store);
5666 
5667  /**
5668  * Returns a new standalone BackingStore that is allocated using the array
5669  * buffer allocator of the isolate. The result can be later passed to
5670  * SharedArrayBuffer::New.
5671  *
5672  * If the allocator returns nullptr, then the function may cause GCs in the
5673  * given isolate and re-try the allocation. If GCs do not help, then the
5674  * function will crash with an out-of-memory error.
5675  */
5676  static std::unique_ptr<BackingStore> NewBackingStore(Isolate* isolate,
5677  size_t byte_length);
5678  /**
5679  * Returns a new standalone BackingStore that takes over the ownership of
5680  * the given buffer. The destructor of the BackingStore invokes the given
5681  * deleter callback.
5682  *
5683  * The result can be later passed to SharedArrayBuffer::New. The raw pointer
5684  * to the buffer must not be passed again to any V8 functions.
5685  */
5686  static std::unique_ptr<BackingStore> NewBackingStore(
5687  void* data, size_t byte_length, v8::BackingStore::DeleterCallback deleter,
5688  void* deleter_data);
5689 
5690  /**
5691  * Create a new SharedArrayBuffer over an existing memory block. Propagate
5692  * flags to indicate whether the underlying buffer can be grown.
5693  */
5695  "Use the version that takes a BackingStore. "
5696  "See http://crbug.com/v8/9908.")
5697  static Local<SharedArrayBuffer> New(
5698  Isolate* isolate, const SharedArrayBuffer::Contents&,
5700 
5701  /**
5702  * Returns true if SharedArrayBuffer is externalized, that is, does not
5703  * own its memory block.
5704  */
5706  "With v8::BackingStore externalized SharedArrayBuffers are the same "
5707  "as ordinary SharedArrayBuffers. See http://crbug.com/v8/9908.")
5708  bool IsExternal() const;
5709 
5710  /**
5711  * Make this SharedArrayBuffer external. The pointer to underlying memory
5712  * block and byte length are returned as |Contents| structure. After
5713  * SharedArrayBuffer had been externalized, it does no longer own the memory
5714  * block. The caller should take steps to free memory when it is no longer
5715  * needed.
5716  *
5717  * The memory block is guaranteed to be allocated with |Allocator::Allocate|
5718  * by the allocator specified in
5719  * v8::Isolate::CreateParams::array_buffer_allocator.
5720  *
5721  */
5723  "Use GetBackingStore or Detach. See http://crbug.com/v8/9908.")
5724  Contents Externalize();
5725 
5726  /**
5727  * Marks this SharedArrayBuffer external given a witness that the embedder
5728  * has fetched the backing store using the new GetBackingStore() function.
5729  *
5730  * With the new lifetime management of backing stores there is no need for
5731  * externalizing, so this function exists only to make the transition easier.
5732  */
5733  V8_DEPRECATE_SOON("This will be removed together with IsExternal.")
5734  void Externalize(const std::shared_ptr<BackingStore>& backing_store);
5735 
5736  /**
5737  * Get a pointer to the ArrayBuffer's underlying memory block without
5738  * externalizing it. If the ArrayBuffer is not externalized, this pointer
5739  * will become invalid as soon as the ArrayBuffer became garbage collected.
5740  *
5741  * The embedder should make sure to hold a strong reference to the
5742  * ArrayBuffer while accessing this pointer.
5743  *
5744  * The memory block is guaranteed to be allocated with |Allocator::Allocate|
5745  * by the allocator specified in
5746  * v8::Isolate::CreateParams::array_buffer_allocator.
5747  */
5748  V8_DEPRECATE_SOON("Use GetBackingStore. See http://crbug.com/v8/9908.")
5750 
5751  /**
5752  * Get a shared pointer to the backing store of this array buffer. This
5753  * pointer coordinates the lifetime management of the internal storage
5754  * with any live ArrayBuffers on the heap, even across isolates. The embedder
5755  * should not attempt to manage lifetime of the storage through other means.
5756  *
5757  * This function replaces both Externalize() and GetContents().
5758  */
5759  std::shared_ptr<BackingStore> GetBackingStore();
5760 
5761  V8_INLINE static SharedArrayBuffer* Cast(Value* obj);
5762 
5764 
5765  private:
5766  SharedArrayBuffer();
5767  static void CheckCast(Value* obj);
5768  Contents GetContents(bool externalize);
5769 };
5770 
5771 
5772 /**
5773  * An instance of the built-in Date constructor (ECMA-262, 15.9).
5774  */
5775 class V8_EXPORT Date : public Object {
5776  public:
5778  double time);
5779 
5780  /**
5781  * A specialization of Value::NumberValue that is more efficient
5782  * because we know the structure of this object.
5783  */
5784  double ValueOf() const;
5785 
5786  V8_INLINE static Date* Cast(Value* obj);
5787 
5788  private:
5789  static void CheckCast(Value* obj);
5790 };
5791 
5792 
5793 /**
5794  * A Number object (ECMA-262, 4.3.21).
5795  */
5797  public:
5798  static Local<Value> New(Isolate* isolate, double value);
5799 
5800  double ValueOf() const;
5801 
5802  V8_INLINE static NumberObject* Cast(Value* obj);
5803 
5804  private:
5805  static void CheckCast(Value* obj);
5806 };
5807 
5808 /**
5809  * A BigInt object (https://tc39.github.io/proposal-bigint)
5810  */
5812  public:
5813  static Local<Value> New(Isolate* isolate, int64_t value);
5814 
5816 
5817  V8_INLINE static BigIntObject* Cast(Value* obj);
5818 
5819  private:
5820  static void CheckCast(Value* obj);
5821 };
5822 
5823 /**
5824  * A Boolean object (ECMA-262, 4.3.15).
5825  */
5827  public:
5828  static Local<Value> New(Isolate* isolate, bool value);
5829 
5830  bool ValueOf() const;
5831 
5832  V8_INLINE static BooleanObject* Cast(Value* obj);
5833 
5834  private:
5835  static void CheckCast(Value* obj);
5836 };
5837 
5838 
5839 /**
5840  * A String object (ECMA-262, 4.3.18).
5841  */
5843  public:
5844  static Local<Value> New(Isolate* isolate, Local<String> value);
5845 
5847 
5848  V8_INLINE static StringObject* Cast(Value* obj);
5849 
5850  private:
5851  static void CheckCast(Value* obj);
5852 };
5853 
5854 
5855 /**
5856  * A Symbol object (ECMA-262 edition 6).
5857  */
5859  public:
5860  static Local<Value> New(Isolate* isolate, Local<Symbol> value);
5861 
5863 
5864  V8_INLINE static SymbolObject* Cast(Value* obj);
5865 
5866  private:
5867  static void CheckCast(Value* obj);
5868 };
5869 
5870 
5871 /**
5872  * An instance of the built-in RegExp constructor (ECMA-262, 15.10).
5873  */
5874 class V8_EXPORT RegExp : public Object {
5875  public:
5876  /**
5877  * Regular expression flag bits. They can be or'ed to enable a set
5878  * of flags.
5879  */
5880  enum Flags {
5881  kNone = 0,
5882  kGlobal = 1 << 0,
5883  kIgnoreCase = 1 << 1,
5884  kMultiline = 1 << 2,
5885  kSticky = 1 << 3,
5886  kUnicode = 1 << 4,
5887  kDotAll = 1 << 5,
5888  };
5889 
5890  static constexpr int kFlagCount = 6;
5891 
5892  /**
5893  * Creates a regular expression from the given pattern string and
5894  * the flags bit field. May throw a JavaScript exception as
5895  * described in ECMA-262, 15.10.4.1.
5896  *
5897  * For example,
5898  * RegExp::New(v8::String::New("foo"),
5899  * static_cast<RegExp::Flags>(kGlobal | kMultiline))
5900  * is equivalent to evaluating "/foo/gm".
5901  */
5903  Local<String> pattern,
5904  Flags flags);
5905 
5906  /**
5907  * Like New, but additionally specifies a backtrack limit. If the number of
5908  * backtracks done in one Exec call hits the limit, a match failure is
5909  * immediately returned.
5910  */
5912  Local<Context> context, Local<String> pattern, Flags flags,
5913  uint32_t backtrack_limit);
5914 
5915  /**
5916  * Executes the current RegExp instance on the given subject string.
5917  * Equivalent to RegExp.prototype.exec as described in
5918  *
5919  * https://tc39.es/ecma262/#sec-regexp.prototype.exec
5920  *
5921  * On success, an Array containing the matched strings is returned. On
5922  * failure, returns Null.
5923  *
5924  * Note: modifies global context state, accessible e.g. through RegExp.input.
5925  */
5927  Local<String> subject);
5928 
5929  /**
5930  * Returns the value of the source property: a string representing
5931  * the regular expression.
5932  */
5934 
5935  /**
5936  * Returns the flags bit field.
5937  */
5938  Flags GetFlags() const;
5939 
5940  V8_INLINE static RegExp* Cast(Value* obj);
5941 
5942  private:
5943  static void CheckCast(Value* obj);
5944 };
5945 
5946 /**
5947  * A JavaScript value that wraps a C++ void*. This type of value is mainly used
5948  * to associate C++ data structures with JavaScript objects.
5949  */
5950 class V8_EXPORT External : public Value {
5951  public:
5952  static Local<External> New(Isolate* isolate, void* value);
5953  V8_INLINE static External* Cast(Value* obj);
5954  void* Value() const;
5955  private:
5956  static void CheckCast(v8::Value* obj);
5957 };
5958 
5959 #define V8_INTRINSICS_LIST(F)
5960  F(ArrayProto_entries, array_entries_iterator)
5961  F(ArrayProto_forEach, array_for_each_iterator)
5962  F(ArrayProto_keys, array_keys_iterator)
5963  F(ArrayProto_values, array_values_iterator)
5964  F(ErrorPrototype, initial_error_prototype)
5965  F(IteratorPrototype, initial_iterator_prototype)
5966  F(ObjProto_valueOf, object_value_of_function)
5967 
5969 #define V8_DECL_INTRINSIC(name, iname) k##name,
5971 #undef V8_DECL_INTRINSIC
5972 };
5973 
5974 
5975 // --- Templates ---
5976 
5977 
5978 /**
5979  * The superclass of object and function templates.
5980  */
5981 class V8_EXPORT Template : public Data {
5982  public:
5983  /**
5984  * Adds a property to each instance created by this template.
5985  *
5986  * The property must be defined either as a primitive value, or a template.
5987  */
5988  void Set(Local<Name> name, Local<Data> value,
5989  PropertyAttribute attributes = None);
5990  void SetPrivate(Local<Private> name, Local<Data> value,
5991  PropertyAttribute attributes = None);
5992  V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value);
5993 
5995  Local<Name> name,
5998  PropertyAttribute attribute = None,
5999  AccessControl settings = DEFAULT);
6000 
6001  /**
6002  * Whenever the property with the given name is accessed on objects
6003  * created from this Template the getter and setter callbacks
6004  * are called instead of getting and setting the property directly
6005  * on the JavaScript object.
6006  *
6007  * \param name The name of the property for which an accessor is added.
6008  * \param getter The callback to invoke when getting the property.
6009  * \param setter The callback to invoke when setting the property.
6010  * \param data A piece of data that will be passed to the getter and setter
6011  * callbacks whenever they are invoked.
6012  * \param settings Access control settings for the accessor. This is a bit
6013  * field consisting of one of more of
6014  * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2.
6015  * The default is to not allow cross-context access.
6016  * ALL_CAN_READ means that all cross-context reads are allowed.
6017  * ALL_CAN_WRITE means that all cross-context writes are allowed.
6018  * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all
6019  * cross-context access.
6020  * \param attribute The attributes of the property for which an accessor
6021  * is added.
6022  * \param signature The signature describes valid receivers for the accessor
6023  * and is used to perform implicit instance checks against them. If the
6024  * receiver is incompatible (i.e. is not an instance of the constructor as
6025  * defined by FunctionTemplate::HasInstance()), an implicit TypeError is
6026  * thrown and no callback is invoked.
6027  */
6029  Local<String> name, AccessorGetterCallback getter,
6030  AccessorSetterCallback setter = nullptr,
6031  // TODO(dcarney): gcc can't handle Local below
6032  Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
6034  AccessControl settings = DEFAULT,
6035  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
6036  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
6038  Local<Name> name, AccessorNameGetterCallback getter,
6039  AccessorNameSetterCallback setter = nullptr,
6040  // TODO(dcarney): gcc can't handle Local below
6041  Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
6043  AccessControl settings = DEFAULT,
6044  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
6045  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
6046 
6047  /**
6048  * Like SetNativeDataProperty, but V8 will replace the native data property
6049  * with a real data property on first access.
6050  */
6052  Local<Name> name, AccessorNameGetterCallback getter,
6053  Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
6054  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
6055  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
6056 
6057  /**
6058  * During template instantiation, sets the value with the intrinsic property
6059  * from the correct context.
6060  */
6062  PropertyAttribute attribute = None);
6063 
6064  private:
6065  Template();
6066 
6067  friend class ObjectTemplate;
6068  friend class FunctionTemplate;
6069 };
6070 
6071 // TODO(dcarney): Replace GenericNamedPropertyFooCallback with just
6072 // NamedPropertyFooCallback.
6073 
6074 /**
6075  * Interceptor for get requests on an object.
6076  *
6077  * Use `info.GetReturnValue().Set()` to set the return value of the
6078  * intercepted get request.
6079  *
6080  * \param property The name of the property for which the request was
6081  * intercepted.
6082  * \param info Information about the intercepted request, such as
6083  * isolate, receiver, return value, or whether running in `'use strict`' mode.
6084  * See `PropertyCallbackInfo`.
6085  *
6086  * \code
6087  * void GetterCallback(
6088  * Local<Name> name,
6089  * const v8::PropertyCallbackInfo<v8::Value>& info) {
6090  * info.GetReturnValue().Set(v8_num(42));
6091  * }
6092  *
6093  * v8::Local<v8::FunctionTemplate> templ =
6094  * v8::FunctionTemplate::New(isolate);
6095  * templ->InstanceTemplate()->SetHandler(
6096  * v8::NamedPropertyHandlerConfiguration(GetterCallback));
6097  * LocalContext env;
6098  * env->Global()
6099  * ->Set(env.local(), v8_str("obj"), templ->GetFunction(env.local())
6100  * .ToLocalChecked()
6101  * ->NewInstance(env.local())
6102  * .ToLocalChecked())
6103  * .FromJust();
6104  * v8::Local<v8::Value> result = CompileRun("obj.a = 17; obj.a");
6105  * CHECK(v8_num(42)->Equals(env.local(), result).FromJust());
6106  * \endcode
6107  *
6108  * See also `ObjectTemplate::SetHandler`.
6109  */
6111  Local<Name> property, const PropertyCallbackInfo<Value>& info);
6112 
6113 /**
6114  * Interceptor for set requests on an object.
6115  *
6116  * Use `info.GetReturnValue()` to indicate whether the request was intercepted
6117  * or not. If the setter successfully intercepts the request, i.e., if the
6118  * request should not be further executed, call
6119  * `info.GetReturnValue().Set(value)`. If the setter
6120  * did not intercept the request, i.e., if the request should be handled as
6121  * if no interceptor is present, do not not call `Set()`.
6122  *
6123  * \param property The name of the property for which the request was
6124  * intercepted.
6125  * \param value The value which the property will have if the request
6126  * is not intercepted.
6127  * \param info Information about the intercepted request, such as
6128  * isolate, receiver, return value, or whether running in `'use strict'` mode.
6129  * See `PropertyCallbackInfo`.
6130  *
6131  * See also
6132  * `ObjectTemplate::SetHandler.`
6133  */
6135  Local<Name> property, Local<Value> value,
6136  const PropertyCallbackInfo<Value>& info);
6137 
6138 /**
6139  * Intercepts all requests that query the attributes of the
6140  * property, e.g., getOwnPropertyDescriptor(), propertyIsEnumerable(), and
6141  * defineProperty().
6142  *
6143  * Use `info.GetReturnValue().Set(value)` to set the property attributes. The
6144  * value is an integer encoding a `v8::PropertyAttribute`.
6145  *
6146  * \param property The name of the property for which the request was
6147  * intercepted.
6148  * \param info Information about the intercepted request, such as
6149  * isolate, receiver, return value, or whether running in `'use strict'` mode.
6150  * See `PropertyCallbackInfo`.
6151  *
6152  * \note Some functions query the property attributes internally, even though
6153  * they do not return the attributes. For example, `hasOwnProperty()` can
6154  * trigger this interceptor depending on the state of the object.
6155  *
6156  * See also
6157  * `ObjectTemplate::SetHandler.`
6158  */
6160  Local<Name> property, const PropertyCallbackInfo<Integer>& info);
6161 
6162 /**
6163  * Interceptor for delete requests on an object.
6164  *
6165  * Use `info.GetReturnValue()` to indicate whether the request was intercepted
6166  * or not. If the deleter successfully intercepts the request, i.e., if the
6167  * request should not be further executed, call
6168  * `info.GetReturnValue().Set(value)` with a boolean `value`. The `value` is
6169  * used as the return value of `delete`.
6170  *
6171  * \param property The name of the property for which the request was
6172  * intercepted.
6173  * \param info Information about the intercepted request, such as
6174  * isolate, receiver, return value, or whether running in `'use strict'` mode.
6175  * See `PropertyCallbackInfo`.
6176  *
6177  * \note If you need to mimic the behavior of `delete`, i.e., throw in strict
6178  * mode instead of returning false, use `info.ShouldThrowOnError()` to determine
6179  * if you are in strict mode.
6180  *
6181  * See also `ObjectTemplate::SetHandler.`
6182  */
6184  Local<Name> property, const PropertyCallbackInfo<Boolean>& info);
6185 
6186 /**
6187  * Returns an array containing the names of the properties the named
6188  * property getter intercepts.
6189  *
6190  * Note: The values in the array must be of type v8::Name.
6191  */
6193  const PropertyCallbackInfo<Array>& info);
6194 
6195 /**
6196  * Interceptor for defineProperty requests on an object.
6197  *
6198  * Use `info.GetReturnValue()` to indicate whether the request was intercepted
6199  * or not. If the definer successfully intercepts the request, i.e., if the
6200  * request should not be further executed, call
6201  * `info.GetReturnValue().Set(value)`. If the definer
6202  * did not intercept the request, i.e., if the request should be handled as
6203  * if no interceptor is present, do not not call `Set()`.
6204  *
6205  * \param property The name of the property for which the request was
6206  * intercepted.
6207  * \param desc The property descriptor which is used to define the
6208  * property if the request is not intercepted.
6209  * \param info Information about the intercepted request, such as
6210  * isolate, receiver, return value, or whether running in `'use strict'` mode.
6211  * See `PropertyCallbackInfo`.
6212  *
6213  * See also `ObjectTemplate::SetHandler`.
6214  */
6216  Local<Name> property, const PropertyDescriptor& desc,
6217  const PropertyCallbackInfo<Value>& info);
6218 
6219 /**
6220  * Interceptor for getOwnPropertyDescriptor requests on an object.
6221  *
6222  * Use `info.GetReturnValue().Set()` to set the return value of the
6223  * intercepted request. The return value must be an object that
6224  * can be converted to a PropertyDescriptor, e.g., a `v8::value` returned from
6225  * `v8::Object::getOwnPropertyDescriptor`.
6226  *
6227  * \param property The name of the property for which the request was
6228  * intercepted.
6229  * \info Information about the intercepted request, such as
6230  * isolate, receiver, return value, or whether running in `'use strict'` mode.
6231  * See `PropertyCallbackInfo`.
6232  *
6233  * \note If GetOwnPropertyDescriptor is intercepted, it will
6234  * always return true, i.e., indicate that the property was found.
6235  *
6236  * See also `ObjectTemplate::SetHandler`.
6237  */
6239  Local<Name> property, const PropertyCallbackInfo<Value>& info);
6240 
6241 /**
6242  * See `v8::GenericNamedPropertyGetterCallback`.
6243  */
6245  uint32_t index,
6246  const PropertyCallbackInfo<Value>& info);
6247 
6248 /**
6249  * See `v8::GenericNamedPropertySetterCallback`.
6250  */
6252  uint32_t index,
6253  Local<Value> value,
6254  const PropertyCallbackInfo<Value>& info);
6255 
6256 /**
6257  * See `v8::GenericNamedPropertyQueryCallback`.
6258  */
6260  uint32_t index,
6261  const PropertyCallbackInfo<Integer>& info);
6262 
6263 /**
6264  * See `v8::GenericNamedPropertyDeleterCallback`.
6265  */
6267  uint32_t index,
6268  const PropertyCallbackInfo<Boolean>& info);
6269 
6270 /**
6271  * Returns an array containing the indices of the properties the indexed
6272  * property getter intercepts.
6273  *
6274  * Note: The values in the array must be uint32_t.
6275  */
6277  const PropertyCallbackInfo<Array>& info);
6278 
6279 /**
6280  * See `v8::GenericNamedPropertyDefinerCallback`.
6281  */
6283  uint32_t index, const PropertyDescriptor& desc,
6284  const PropertyCallbackInfo<Value>& info);
6285 
6286 /**
6287  * See `v8::GenericNamedPropertyDescriptorCallback`.
6288  */
6290  uint32_t index, const PropertyCallbackInfo<Value>& info);
6291 
6292 /**
6293  * Access type specification.
6294  */
6300  ACCESS_KEYS
6301 };
6302 
6303 
6304 /**
6305  * Returns true if the given context should be allowed to access the given
6306  * object.
6307  */
6308 typedef bool (*AccessCheckCallback)(Local<Context> accessing_context,
6309  Local<Object> accessed_object,
6310  Local<Value> data);
6311 
6312 class CFunction;
6313 /**
6314  * A FunctionTemplate is used to create functions at runtime. There
6315  * can only be one function created from a FunctionTemplate in a
6316  * context. The lifetime of the created function is equal to the
6317  * lifetime of the context. So in case the embedder needs to create
6318  * temporary functions that can be collected using Scripts is
6319  * preferred.
6320  *
6321  * Any modification of a FunctionTemplate after first instantiation will trigger
6322  * a crash.
6323  *
6324  * A FunctionTemplate can have properties, these properties are added to the
6325  * function object when it is created.
6326  *
6327  * A FunctionTemplate has a corresponding instance template which is
6328  * used to create object instances when the function is used as a
6329  * constructor. Properties added to the instance template are added to
6330  * each object instance.
6331  *
6332  * A FunctionTemplate can have a prototype template. The prototype template
6333  * is used to create the prototype object of the function.
6334  *
6335  * The following example shows how to use a FunctionTemplate:
6336  *
6337  * \code
6338  * v8::Local<v8::FunctionTemplate> t = v8::FunctionTemplate::New(isolate);
6339  * t->Set(isolate, "func_property", v8::Number::New(isolate, 1));
6340  *
6341  * v8::Local<v8::Template> proto_t = t->PrototypeTemplate();
6342  * proto_t->Set(isolate,
6343  * "proto_method",
6344  * v8::FunctionTemplate::New(isolate, InvokeCallback));
6345  * proto_t->Set(isolate, "proto_const", v8::Number::New(isolate, 2));
6346  *
6347  * v8::Local<v8::ObjectTemplate> instance_t = t->InstanceTemplate();
6348  * instance_t->SetAccessor(
6349  String::NewFromUtf8Literal(isolate, "instance_accessor"),
6350  * InstanceAccessorCallback);
6351  * instance_t->SetHandler(
6352  * NamedPropertyHandlerConfiguration(PropertyHandlerCallback));
6353  * instance_t->Set(String::NewFromUtf8Literal(isolate, "instance_property"),
6354  * Number::New(isolate, 3));
6355  *
6356  * v8::Local<v8::Function> function = t->GetFunction();
6357  * v8::Local<v8::Object> instance = function->NewInstance();
6358  * \endcode
6359  *
6360  * Let's use "function" as the JS variable name of the function object
6361  * and "instance" for the instance object created above. The function
6362  * and the instance will have the following properties:
6363  *
6364  * \code
6365  * func_property in function == true;
6366  * function.func_property == 1;
6367  *
6368  * function.prototype.proto_method() invokes 'InvokeCallback'
6369  * function.prototype.proto_const == 2;
6370  *
6371  * instance instanceof function == true;
6372  * instance.instance_accessor calls 'InstanceAccessorCallback'
6373  * instance.instance_property == 3;
6374  * \endcode
6375  *
6376  * A FunctionTemplate can inherit from another one by calling the
6377  * FunctionTemplate::Inherit method. The following graph illustrates
6378  * the semantics of inheritance:
6379  *
6380  * \code
6381  * FunctionTemplate Parent -> Parent() . prototype -> { }
6382  * ^ ^
6383  * | Inherit(Parent) | .__proto__
6384  * | |
6385  * FunctionTemplate Child -> Child() . prototype -> { }
6386  * \endcode
6387  *
6388  * A FunctionTemplate 'Child' inherits from 'Parent', the prototype
6389  * object of the Child() function has __proto__ pointing to the
6390  * Parent() function's prototype object. An instance of the Child
6391  * function has all properties on Parent's instance templates.
6392  *
6393  * Let Parent be the FunctionTemplate initialized in the previous
6394  * section and create a Child FunctionTemplate by:
6395  *
6396  * \code
6397  * Local<FunctionTemplate> parent = t;
6398  * Local<FunctionTemplate> child = FunctionTemplate::New();
6399  * child->Inherit(parent);
6400  *
6401  * Local<Function> child_function = child->GetFunction();
6402  * Local<Object> child_instance = child_function->NewInstance();
6403  * \endcode
6404  *
6405  * The Child function and Child instance will have the following
6406  * properties:
6407  *
6408  * \code
6409  * child_func.prototype.__proto__ == function.prototype;
6410  * child_instance.instance_accessor calls 'InstanceAccessorCallback'
6411  * child_instance.instance_property == 3;
6412  * \endcode
6413  *
6414  * The additional 'c_function' parameter refers to a fast API call, which
6415  * must not trigger GC or JavaScript execution, or call into V8 in other
6416  * ways. For more information how to define them, see
6417  * include/v8-fast-api-calls.h. Please note that this feature is still
6418  * experimental.
6419  */
6421  public:
6422  /** Creates a function template.*/
6424  Isolate* isolate, FunctionCallback callback = nullptr,
6425  Local<Value> data = Local<Value>(),
6426  Local<Signature> signature = Local<Signature>(), int length = 0,
6429  const CFunction* c_function = nullptr);
6430 
6431  /**
6432  * Creates a function template backed/cached by a private property.
6433  */
6435  Isolate* isolate, FunctionCallback callback,
6436  Local<Private> cache_property, Local<Value> data = Local<Value>(),
6437  Local<Signature> signature = Local<Signature>(), int length = 0,
6438  SideEffectType side_effect_type = SideEffectType::kHasSideEffect);
6439 
6440  /** Returns the unique function instance in the current execution context.*/
6442  Local<Context> context);
6443 
6444  /**
6445  * Similar to Context::NewRemoteContext, this creates an instance that
6446  * isn't backed by an actual object.
6447  *
6448  * The InstanceTemplate of this FunctionTemplate must have access checks with
6449  * handlers installed.
6450  */
6452 
6453  /**
6454  * Set the call-handler callback for a FunctionTemplate. This
6455  * callback is called whenever the function created from this
6456  * FunctionTemplate is called. The 'c_function' represents a fast
6457  * API call, see the comment above the class declaration.
6458  */
6460  FunctionCallback callback, Local<Value> data = Local<Value>(),
6462  const CFunction* c_function = nullptr);
6463 
6464  /** Set the predefined length property for the FunctionTemplate. */
6465  void SetLength(int length);
6466 
6467  /** Get the InstanceTemplate. */
6469 
6470  /**
6471  * Causes the function template to inherit from a parent function template.
6472  * This means the function's prototype.__proto__ is set to the parent
6473  * function's prototype.
6474  **/
6476 
6477  /**
6478  * A PrototypeTemplate is the template used to create the prototype object
6479  * of the function created by this template.
6480  */
6482 
6483  /**
6484  * A PrototypeProviderTemplate is another function template whose prototype
6485  * property is used for this template. This is mutually exclusive with setting
6486  * a prototype template indirectly by calling PrototypeTemplate() or using
6487  * Inherit().
6488  **/
6490 
6491  /**
6492  * Set the class name of the FunctionTemplate. This is used for
6493  * printing objects created with the function created from the
6494  * FunctionTemplate as its constructor.
6495  */
6497 
6498 
6499  /**
6500  * When set to true, no access check will be performed on the receiver of a
6501  * function call. Currently defaults to true, but this is subject to change.
6502  */
6503  void SetAcceptAnyReceiver(bool value);
6504 
6505  /**
6506  * Sets the ReadOnly flag in the attributes of the 'prototype' property
6507  * of functions created from this FunctionTemplate to true.
6508  */
6510 
6511  /**
6512  * Removes the prototype property from functions created from this
6513  * FunctionTemplate.
6514  */
6516 
6517  /**
6518  * Returns true if the given object is an instance of this function
6519  * template.
6520  */
6521  bool HasInstance(Local<Value> object);
6522 
6523  V8_INLINE static FunctionTemplate* Cast(Data* data);
6524 
6525  private:
6526  FunctionTemplate();
6527 
6528  static void CheckCast(Data* that);
6529  friend class Context;
6530  friend class ObjectTemplate;
6531 };
6532 
6533 /**
6534  * Configuration flags for v8::NamedPropertyHandlerConfiguration or
6535  * v8::IndexedPropertyHandlerConfiguration.
6536  */
6538  /**
6539  * None.
6540  */
6541  kNone = 0,
6542 
6543  /**
6544  * See ALL_CAN_READ above.
6545  */
6546  kAllCanRead = 1,
6547 
6548  /** Will not call into interceptor for properties on the receiver or prototype
6549  * chain, i.e., only call into interceptor for properties that do not exist.
6550  * Currently only valid for named interceptors.
6551  */
6552  kNonMasking = 1 << 1,
6553 
6554  /**
6555  * Will not call into interceptor for symbol lookup. Only meaningful for
6556  * named interceptors.
6557  */
6558  kOnlyInterceptStrings = 1 << 2,
6559 
6560  /**
6561  * The getter, query, enumerator callbacks do not produce side effects.
6562  */
6563  kHasNoSideEffect = 1 << 3,
6564 };
6565 
6575  Local<Value> data = Local<Value>(),
6577  : getter(getter),
6578  setter(setter),
6579  query(query),
6580  deleter(deleter),
6581  enumerator(enumerator),
6582  definer(definer),
6583  descriptor(descriptor),
6584  data(data),
6585  flags(flags) {}
6586 
6588  /** Note: getter is required */
6589  GenericNamedPropertyGetterCallback getter = nullptr,
6590  GenericNamedPropertySetterCallback setter = nullptr,
6591  GenericNamedPropertyQueryCallback query = nullptr,
6592  GenericNamedPropertyDeleterCallback deleter = nullptr,
6593  GenericNamedPropertyEnumeratorCallback enumerator = nullptr,
6594  Local<Value> data = Local<Value>(),
6596  : getter(getter),
6597  setter(setter),
6598  query(query),
6599  deleter(deleter),
6600  enumerator(enumerator),
6601  definer(nullptr),
6602  descriptor(nullptr),
6603  data(data),
6604  flags(flags) {}
6605 
6613  Local<Value> data = Local<Value>(),
6615  : getter(getter),
6616  setter(setter),
6617  query(nullptr),
6618  deleter(deleter),
6619  enumerator(enumerator),
6620  definer(definer),
6621  descriptor(descriptor),
6622  data(data),
6623  flags(flags) {}
6624 
6634 };
6635 
6636 
6645  Local<Value> data = Local<Value>(),
6647  : getter(getter),
6648  setter(setter),
6649  query(query),
6650  deleter(deleter),
6651  enumerator(enumerator),
6652  definer(definer),
6653  descriptor(descriptor),
6654  data(data),
6655  flags(flags) {}
6656 
6658  /** Note: getter is required */
6659  IndexedPropertyGetterCallback getter = nullptr,
6660  IndexedPropertySetterCallback setter = nullptr,
6661  IndexedPropertyQueryCallback query = nullptr,
6662  IndexedPropertyDeleterCallback deleter = nullptr,
6663  IndexedPropertyEnumeratorCallback enumerator = nullptr,
6664  Local<Value> data = Local<Value>(),
6666  : getter(getter),
6667  setter(setter),
6668  query(query),
6669  deleter(deleter),
6670  enumerator(enumerator),
6671  definer(nullptr),
6672  descriptor(nullptr),
6673  data(data),
6674  flags(flags) {}
6675 
6683  Local<Value> data = Local<Value>(),
6685  : getter(getter),
6686  setter(setter),
6687  query(nullptr),
6688  deleter(deleter),
6689  enumerator(enumerator),
6690  definer(definer),
6691  descriptor(descriptor),
6692  data(data),
6693  flags(flags) {}
6694 
6704 };
6705 
6706 
6707 /**
6708  * An ObjectTemplate is used to create objects at runtime.
6709  *
6710  * Properties added to an ObjectTemplate are added to each object
6711  * created from the ObjectTemplate.
6712  */
6714  public:
6715  /** Creates an ObjectTemplate. */
6717  Isolate* isolate,
6719 
6720  /** Creates a new instance of this template.*/
6722 
6723  /**
6724  * Sets an accessor on the object template.
6725  *
6726  * Whenever the property with the given name is accessed on objects
6727  * created from this ObjectTemplate the getter and setter callbacks
6728  * are called instead of getting and setting the property directly
6729  * on the JavaScript object.
6730  *
6731  * \param name The name of the property for which an accessor is added.
6732  * \param getter The callback to invoke when getting the property.
6733  * \param setter The callback to invoke when setting the property.
6734  * \param data A piece of data that will be passed to the getter and setter
6735  * callbacks whenever they are invoked.
6736  * \param settings Access control settings for the accessor. This is a bit
6737  * field consisting of one of more of
6738  * DEFAULT = 0, ALL_CAN_READ = 1, or ALL_CAN_WRITE = 2.
6739  * The default is to not allow cross-context access.
6740  * ALL_CAN_READ means that all cross-context reads are allowed.
6741  * ALL_CAN_WRITE means that all cross-context writes are allowed.
6742  * The combination ALL_CAN_READ | ALL_CAN_WRITE can be used to allow all
6743  * cross-context access.
6744  * \param attribute The attributes of the property for which an accessor
6745  * is added.
6746  * \param signature The signature describes valid receivers for the accessor
6747  * and is used to perform implicit instance checks against them. If the
6748  * receiver is incompatible (i.e. is not an instance of the constructor as
6749  * defined by FunctionTemplate::HasInstance()), an implicit TypeError is
6750  * thrown and no callback is invoked.
6751  */
6753  Local<String> name, AccessorGetterCallback getter,
6754  AccessorSetterCallback setter = nullptr,
6755  Local<Value> data = Local<Value>(), AccessControl settings = DEFAULT,
6756  PropertyAttribute attribute = None,
6758  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
6759  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
6761  Local<Name> name, AccessorNameGetterCallback getter,
6762  AccessorNameSetterCallback setter = nullptr,
6763  Local<Value> data = Local<Value>(), AccessControl settings = DEFAULT,
6764  PropertyAttribute attribute = None,
6766  SideEffectType getter_side_effect_type = SideEffectType::kHasSideEffect,
6767  SideEffectType setter_side_effect_type = SideEffectType::kHasSideEffect);
6768 
6769  /**
6770  * Sets a named property handler on the object template.
6771  *
6772  * Whenever a property whose name is a string or a symbol is accessed on
6773  * objects created from this object template, the provided callback is
6774  * invoked instead of accessing the property directly on the JavaScript
6775  * object.
6776  *
6777  * @param configuration The NamedPropertyHandlerConfiguration that defines the
6778  * callbacks to invoke when accessing a property.
6779  */
6780  void SetHandler(const NamedPropertyHandlerConfiguration& configuration);
6781 
6782  /**
6783  * Sets an indexed property handler on the object template.
6784  *
6785  * Whenever an indexed property is accessed on objects created from
6786  * this object template, the provided callback is invoked instead of
6787  * accessing the property directly on the JavaScript object.
6788  *
6789  * \param getter The callback to invoke when getting a property.
6790  * \param setter The callback to invoke when setting a property.
6791  * \param query The callback to invoke to check if an object has a property.
6792  * \param deleter The callback to invoke when deleting a property.
6793  * \param enumerator The callback to invoke to enumerate all the indexed
6794  * properties of an object.
6795  * \param data A piece of data that will be passed to the callbacks
6796  * whenever they are invoked.
6797  */
6798  // TODO(dcarney): deprecate
6801  IndexedPropertySetterCallback setter = nullptr,
6802  IndexedPropertyQueryCallback query = nullptr,
6803  IndexedPropertyDeleterCallback deleter = nullptr,
6804  IndexedPropertyEnumeratorCallback enumerator = nullptr,
6805  Local<Value> data = Local<Value>()) {
6807  deleter, enumerator, data));
6808  }
6809 
6810  /**
6811  * Sets an indexed property handler on the object template.
6812  *
6813  * Whenever an indexed property is accessed on objects created from
6814  * this object template, the provided callback is invoked instead of
6815  * accessing the property directly on the JavaScript object.
6816  *
6817  * @param configuration The IndexedPropertyHandlerConfiguration that defines
6818  * the callbacks to invoke when accessing a property.
6819  */
6821 
6822  /**
6823  * Sets the callback to be used when calling instances created from
6824  * this template as a function. If no callback is set, instances
6825  * behave like normal JavaScript objects that cannot be called as a
6826  * function.
6827  */
6829  Local<Value> data = Local<Value>());
6830 
6831  /**
6832  * Mark object instances of the template as undetectable.
6833  *
6834  * In many ways, undetectable objects behave as though they are not
6835  * there. They behave like 'undefined' in conditionals and when
6836  * printed. However, properties can be accessed and called as on
6837  * normal objects.
6838  */
6840 
6841  /**
6842  * Sets access check callback on the object template and enables access
6843  * checks.
6844  *
6845  * When accessing properties on instances of this object template,
6846  * the access check callback will be called to determine whether or
6847  * not to allow cross-context access to the properties.
6848  */
6850  Local<Value> data = Local<Value>());
6851 
6852  /**
6853  * Like SetAccessCheckCallback but invokes an interceptor on failed access
6854  * checks instead of looking up all-can-read properties. You can only use
6855  * either this method or SetAccessCheckCallback, but not both at the same
6856  * time.
6857  */
6859  AccessCheckCallback callback,
6860  const NamedPropertyHandlerConfiguration& named_handler,
6861  const IndexedPropertyHandlerConfiguration& indexed_handler,
6862  Local<Value> data = Local<Value>());
6863 
6864  /**
6865  * Gets the number of internal fields for objects generated from
6866  * this template.
6867  */
6869 
6870  /**
6871  * Sets the number of internal fields for objects generated from
6872  * this template.
6873  */
6874  void SetInternalFieldCount(int value);
6875 
6876  /**
6877  * Returns true if the object will be an immutable prototype exotic object.
6878  */
6880 
6881  /**
6882  * Makes the ObjectTemplate for an immutable prototype exotic object, with an
6883  * immutable __proto__.
6884  */
6886 
6887  V8_INLINE static ObjectTemplate* Cast(Data* data);
6888 
6889  private:
6890  ObjectTemplate();
6891  static Local<ObjectTemplate> New(internal::Isolate* isolate,
6892  Local<FunctionTemplate> constructor);
6893  static void CheckCast(Data* that);
6894  friend class FunctionTemplate;
6895 };
6896 
6897 /**
6898  * A Signature specifies which receiver is valid for a function.
6899  *
6900  * A receiver matches a given signature if the receiver (or any of its
6901  * hidden prototypes) was created from the signature's FunctionTemplate, or
6902  * from a FunctionTemplate that inherits directly or indirectly from the
6903  * signature's FunctionTemplate.
6904  */
6905 class V8_EXPORT Signature : public Data {
6906  public:
6908  Isolate* isolate,
6910 
6911  V8_INLINE static Signature* Cast(Data* data);
6912 
6913  private:
6914  Signature();
6915 
6916  static void CheckCast(Data* that);
6917 };
6918 
6919 
6920 /**
6921  * An AccessorSignature specifies which receivers are valid parameters
6922  * to an accessor callback.
6923  */
6925  public:
6927  Isolate* isolate,
6929 
6930  V8_INLINE static AccessorSignature* Cast(Data* data);
6931 
6932  private:
6933  AccessorSignature();
6934 
6935  static void CheckCast(Data* that);
6936 };
6937 
6938 
6939 // --- Extensions ---
6940 
6941 /**
6942  * Ignore
6943  */
6944 class V8_EXPORT Extension { // NOLINT
6945  public:
6946  // Note that the strings passed into this constructor must live as long
6947  // as the Extension itself.
6948  Extension(const char* name, const char* source = nullptr, int dep_count = 0,
6949  const char** deps = nullptr, int source_length = -1);
6950  virtual ~Extension() { delete source_; }
6952  Isolate* isolate, Local<String> name) {
6954  }
6955 
6956  const char* name() const { return name_; }
6957  size_t source_length() const { return source_length_; }
6959  return source_;
6960  }
6961  int dependency_count() const { return dep_count_; }
6962  const char** dependencies() const { return deps_; }
6963  void set_auto_enable(bool value) { auto_enable_ = value; }
6964  bool auto_enable() { return auto_enable_; }
6965 
6966  // Disallow copying and assigning.
6967  Extension(const Extension&) = delete;
6968  void operator=(const Extension&) = delete;
6969 
6970  private:
6971  const char* name_;
6972  size_t source_length_; // expected to initialize before source_
6974  int dep_count_;
6975  const char** deps_;
6976  bool auto_enable_;
6977 };
6978 
6979 void V8_EXPORT RegisterExtension(std::unique_ptr<Extension>);
6980 
6981 // --- Statics ---
6982 
6984 V8_INLINE Local<Primitive> Null(Isolate* isolate);
6985 V8_INLINE Local<Boolean> True(Isolate* isolate);
6986 V8_INLINE Local<Boolean> False(Isolate* isolate);
6987 
6988 /**
6989  * A set of constraints that specifies the limits of the runtime's memory use.
6990  * You must set the heap size before initializing the VM - the size cannot be
6991  * adjusted after the VM is initialized.
6992  *
6993  * If you are using threads then you should hold the V8::Locker lock while
6994  * setting the stack limit and you must set a non-default stack limit separately
6995  * for each thread.
6996  *
6997  * The arguments for set_max_semi_space_size, set_max_old_space_size,
6998  * set_max_executable_size, set_code_range_size specify limits in MB.
6999  *
7000  * The argument for set_max_semi_space_size_in_kb is in KB.
7001  */
7003  public:
7004  /**
7005  * Configures the constraints with reasonable default values based on the
7006  * provided heap size limit. The heap size includes both the young and
7007  * the old generation.
7008  *
7009  * \param initial_heap_size_in_bytes The initial heap size or zero.
7010  * By default V8 starts with a small heap and dynamically grows it to
7011  * match the set of live objects. This may lead to ineffective
7012  * garbage collections at startup if the live set is large.
7013  * Setting the initial heap size avoids such garbage collections.
7014  * Note that this does not affect young generation garbage collections.
7015  *
7016  * \param maximum_heap_size_in_bytes The hard limit for the heap size.
7017  * When the heap size approaches this limit, V8 will perform series of
7018  * garbage collections and invoke the NearHeapLimitCallback. If the garbage
7019  * collections do not help and the callback does not increase the limit,
7020  * then V8 will crash with V8::FatalProcessOutOfMemory.
7021  */
7022  void ConfigureDefaultsFromHeapSize(size_t initial_heap_size_in_bytes,
7023  size_t maximum_heap_size_in_bytes);
7024 
7025  /**
7026  * Configures the constraints with reasonable default values based on the
7027  * capabilities of the current device the VM is running on.
7028  *
7029  * \param physical_memory The total amount of physical memory on the current
7030  * device, in bytes.
7031  * \param virtual_memory_limit The amount of virtual memory on the current
7032  * device, in bytes, or zero, if there is no limit.
7033  */
7034  void ConfigureDefaults(uint64_t physical_memory,
7035  uint64_t virtual_memory_limit);
7036 
7037  /**
7038  * The address beyond which the VM's stack may not grow.
7039  */
7040  uint32_t* stack_limit() const { return stack_limit_; }
7041  void set_stack_limit(uint32_t* value) { stack_limit_ = value; }
7042 
7043  /**
7044  * The amount of virtual memory reserved for generated code. This is relevant
7045  * for 64-bit architectures that rely on code range for calls in code.
7046  */
7047  size_t code_range_size_in_bytes() const { return code_range_size_; }
7048  void set_code_range_size_in_bytes(size_t limit) { code_range_size_ = limit; }
7049 
7050  /**
7051  * The maximum size of the old generation.
7052  * When the old generation approaches this limit, V8 will perform series of
7053  * garbage collections and invoke the NearHeapLimitCallback.
7054  * If the garbage collections do not help and the callback does not
7055  * increase the limit, then V8 will crash with V8::FatalProcessOutOfMemory.
7056  */
7058  return max_old_generation_size_;
7059  }
7061  max_old_generation_size_ = limit;
7062  }
7063 
7064  /**
7065  * The maximum size of the young generation, which consists of two semi-spaces
7066  * and a large object space. This affects frequency of Scavenge garbage
7067  * collections and should be typically much smaller that the old generation.
7068  */
7070  return max_young_generation_size_;
7071  }
7073  max_young_generation_size_ = limit;
7074  }
7075 
7077  return initial_old_generation_size_;
7078  }
7079  void set_initial_old_generation_size_in_bytes(size_t initial_size) {
7080  initial_old_generation_size_ = initial_size;
7081  }
7082 
7084  return initial_young_generation_size_;
7085  }
7087  initial_young_generation_size_ = initial_size;
7088  }
7089 
7090  /**
7091  * Deprecated functions. Do not use in new code.
7092  */
7093  V8_DEPRECATE_SOON("Use code_range_size_in_bytes.")
7094  size_t code_range_size() const { return code_range_size_ / kMB; }
7095  V8_DEPRECATE_SOON("Use set_code_range_size_in_bytes.")
7096  void set_code_range_size(size_t limit_in_mb) {
7097  code_range_size_ = limit_in_mb * kMB;
7098  }
7099  V8_DEPRECATE_SOON("Use max_young_generation_size_in_bytes.")
7101  V8_DEPRECATE_SOON("Use set_max_young_generation_size_in_bytes.")
7102  void set_max_semi_space_size_in_kb(size_t limit_in_kb);
7103  V8_DEPRECATE_SOON("Use max_old_generation_size_in_bytes.")
7104  size_t max_old_space_size() const { return max_old_generation_size_ / kMB; }
7105  V8_DEPRECATE_SOON("Use set_max_old_generation_size_in_bytes.")
7106  void set_max_old_space_size(size_t limit_in_mb) {
7107  max_old_generation_size_ = limit_in_mb * kMB;
7108  }
7109  V8_DEPRECATE_SOON("Zone does not pool memory any more.")
7110  size_t max_zone_pool_size() const { return max_zone_pool_size_; }
7111  V8_DEPRECATE_SOON("Zone does not pool memory any more.")
7112  void set_max_zone_pool_size(size_t bytes) { max_zone_pool_size_ = bytes; }
7113 
7114  private:
7115  static constexpr size_t kMB = 1048576u;
7116  size_t code_range_size_ = 0;
7117  size_t max_old_generation_size_ = 0;
7118  size_t max_young_generation_size_ = 0;
7119  size_t max_zone_pool_size_ = 0;
7120  size_t initial_old_generation_size_ = 0;
7121  size_t initial_young_generation_size_ = 0;
7122  uint32_t* stack_limit_ = nullptr;
7123 };
7124 
7125 
7126 // --- Exceptions ---
7127 
7128 
7129 typedef void (*FatalErrorCallback)(const char* location, const char* message);
7130 
7131 typedef void (*OOMErrorCallback)(const char* location, bool is_heap_oom);
7132 
7133 typedef void (*DcheckErrorCallback)(const char* file, int line,
7134  const char* message);
7135 
7136 typedef void (*MessageCallback)(Local<Message> message, Local<Value> data);
7137 
7138 // --- Tracing ---
7139 
7140 typedef void (*LogEventCallback)(const char* name, int event);
7141 
7142 /**
7143  * Create new error objects by calling the corresponding error object
7144  * constructor with the message.
7145  */
7147  public:
7148  static Local<Value> RangeError(Local<String> message);
7150  static Local<Value> SyntaxError(Local<String> message);
7151  static Local<Value> TypeError(Local<String> message);
7153  static Local<Value> WasmLinkError(Local<String> message);
7155  static Local<Value> Error(Local<String> message);
7156 
7157  /**
7158  * Creates an error message for the given exception.
7159  * Will try to reconstruct the original stack trace from the exception value,
7160  * or capture the current stack trace if not available.
7161  */
7162  static Local<Message> CreateMessage(Isolate* isolate, Local<Value> exception);
7163 
7164  /**
7165  * Returns the original stack trace that was captured at the creation time
7166  * of a given exception, or an empty handle if not available.
7167  */
7169 };
7170 
7171 
7172 // --- Counters Callbacks ---
7173 
7174 typedef int* (*CounterLookupCallback)(const char* name);
7175 
7176 typedef void* (*CreateHistogramCallback)(const char* name,
7177  int min,
7178  int max,
7179  size_t buckets);
7180 
7181 typedef void (*AddHistogramSampleCallback)(void* histogram, int sample);
7182 
7183 // --- Crashkeys Callback ---
7184 enum class CrashKeyId {
7189  kDumpType,
7190 };
7191 
7192 typedef void (*AddCrashKeyCallback)(CrashKeyId id, const std::string& value);
7193 
7194 // --- Enter/Leave Script Callback ---
7196 typedef void (*CallCompletedCallback)(Isolate*);
7197 
7198 /**
7199  * HostImportModuleDynamicallyCallback is called when we require the
7200  * embedder to load a module. This is used as part of the dynamic
7201  * import syntax.
7202  *
7203  * The referrer contains metadata about the script/module that calls
7204  * import.
7205  *
7206  * The specifier is the name of the module that should be imported.
7207  *
7208  * The embedder must compile, instantiate, evaluate the Module, and
7209  * obtain it's namespace object.
7210  *
7211  * The Promise returned from this function is forwarded to userland
7212  * JavaScript. The embedder must resolve this promise with the module
7213  * namespace object. In case of an exception, the embedder must reject
7214  * this promise with the exception. If the promise creation itself
7215  * fails (e.g. due to stack overflow), the embedder must propagate
7216  * that exception by returning an empty MaybeLocal.
7217  */
7219  Local<Context> context, Local<ScriptOrModule> referrer,
7220  Local<String> specifier);
7221 
7222 /**
7223  * HostInitializeImportMetaObjectCallback is called the first time import.meta
7224  * is accessed for a module. Subsequent access will reuse the same value. The
7225  * callback must not throw.
7226  *
7227  * The method combines two implementation-defined abstract operations into one:
7228  * HostGetImportMetaProperties and HostFinalizeImportMeta.
7229  *
7230  * The embedder should use v8::Object::CreateDataProperty to add properties on
7231  * the meta object.
7232  */
7234  Local<Module> module,
7235  Local<Object> meta);
7236 
7237 /**
7238  * PrepareStackTraceCallback is called when the stack property of an error is
7239  * first accessed. The return value will be used as the stack value. If this
7240  * callback is registed, the |Error.prepareStackTrace| API will be disabled.
7241  * |sites| is an array of call sites, specified in
7242  * https://v8.dev/docs/stack-trace-api
7243  */
7245  Local<Value> error,
7246  Local<Array> sites);
7247 
7248 /**
7249  * PromiseHook with type kInit is called when a new promise is
7250  * created. When a new promise is created as part of the chain in the
7251  * case of Promise.then or in the intermediate promises created by
7252  * Promise.{race, all}/AsyncFunctionAwait, we pass the parent promise
7253  * otherwise we pass undefined.
7254  *
7255  * PromiseHook with type kResolve is called at the beginning of
7256  * resolve or reject function defined by CreateResolvingFunctions.
7257  *
7258  * PromiseHook with type kBefore is called at the beginning of the
7259  * PromiseReactionJob.
7260  *
7261  * PromiseHook with type kAfter is called right at the end of the
7262  * PromiseReactionJob.
7263  */
7265 
7266 typedef void (*PromiseHook)(PromiseHookType type, Local<Promise> promise,
7267  Local<Value> parent);
7268 
7269 // --- Promise Reject Callback ---
7275 };
7276 
7278  public:
7280  Local<Value> value)
7281  : promise_(promise), event_(event), value_(value) {}
7282 
7283  V8_INLINE Local<Promise> GetPromise() const { return promise_; }
7284  V8_INLINE PromiseRejectEvent GetEvent() const { return event_; }
7285  V8_INLINE Local<Value> GetValue() const { return value_; }
7286 
7287  private:
7288  Local<Promise> promise_;
7289  PromiseRejectEvent event_;
7290  Local<Value> value_;
7291 };
7292 
7294 
7295 // --- Microtasks Callbacks ---
7296 V8_DEPRECATE_SOON("Use *WithData version.")
7299 typedef void (*MicrotaskCallback)(void* data);
7300 
7301 /**
7302  * Policy for running microtasks:
7303  * - explicit: microtasks are invoked with the
7304  * Isolate::PerformMicrotaskCheckpoint() method;
7305  * - scoped: microtasks invocation is controlled by MicrotasksScope objects;
7306  * - auto: microtasks are invoked when the script call depth decrements
7307  * to zero.
7308  */
7310 
7311 /**
7312  * Represents the microtask queue, where microtasks are stored and processed.
7313  * https://html.spec.whatwg.org/multipage/webappapis.html#microtask-queue
7314  * https://html.spec.whatwg.org/multipage/webappapis.html#enqueuejob(queuename,-job,-arguments)
7315  * https://html.spec.whatwg.org/multipage/webappapis.html#perform-a-microtask-checkpoint
7316  *
7317  * A MicrotaskQueue instance may be associated to multiple Contexts by passing
7318  * it to Context::New(), and they can be detached by Context::DetachGlobal().
7319  * The embedder must keep the MicrotaskQueue instance alive until all associated
7320  * Contexts are gone or detached.
7321  *
7322  * Use the same instance of MicrotaskQueue for all Contexts that may access each
7323  * other synchronously. E.g. for Web embedding, use the same instance for all
7324  * origins that share the same URL scheme and eTLD+1.
7325  */
7327  public:
7328  /**
7329  * Creates an empty MicrotaskQueue instance.
7330  */
7331  static std::unique_ptr<MicrotaskQueue> New(
7332  Isolate* isolate, MicrotasksPolicy policy = MicrotasksPolicy::kAuto);
7333 
7334  virtual ~MicrotaskQueue() = default;
7335 
7336  /**
7337  * Enqueues the callback to the queue.
7338  */
7339  virtual void EnqueueMicrotask(Isolate* isolate,
7340  Local<Function> microtask) = 0;
7341 
7342  /**
7343  * Enqueues the callback to the queue.
7344  */
7345  virtual void EnqueueMicrotask(v8::Isolate* isolate,
7346  MicrotaskCallback callback,
7347  void* data = nullptr) = 0;
7348 
7349  /**
7350  * Adds a callback to notify the embedder after microtasks were run. The
7351  * callback is triggered by explicit RunMicrotasks call or automatic
7352  * microtasks execution (see Isolate::SetMicrotasksPolicy).
7353  *
7354  * Callback will trigger even if microtasks were attempted to run,
7355  * but the microtasks queue was empty and no single microtask was actually
7356  * executed.
7357  *
7358  * Executing scripts inside the callback will not re-trigger microtasks and
7359  * the callback.
7360  */
7362  MicrotasksCompletedCallbackWithData callback, void* data = nullptr) = 0;
7363 
7364  /**
7365  * Removes callback that was installed by AddMicrotasksCompletedCallback.
7366  */
7368  MicrotasksCompletedCallbackWithData callback, void* data = nullptr) = 0;
7369 
7370  /**
7371  * Runs microtasks if no microtask is running on this MicrotaskQueue instance.
7372  */
7373  virtual void PerformCheckpoint(Isolate* isolate) = 0;
7374 
7375  /**
7376  * Returns true if a microtask is running on this MicrotaskQueue instance.
7377  */
7378  virtual bool IsRunningMicrotasks() const = 0;
7379 
7380  /**
7381  * Returns the current depth of nested MicrotasksScope that has
7382  * kRunMicrotasks.
7383  */
7384  virtual int GetMicrotasksScopeDepth() const = 0;
7385 
7386  MicrotaskQueue(const MicrotaskQueue&) = delete;
7388 
7389  private:
7390  friend class internal::MicrotaskQueue;
7391  MicrotaskQueue() = default;
7392 };
7393 
7394 /**
7395  * This scope is used to control microtasks when MicrotasksPolicy::kScoped
7396  * is used on Isolate. In this mode every non-primitive call to V8 should be
7397  * done inside some MicrotasksScope.
7398  * Microtasks are executed when topmost MicrotasksScope marked as kRunMicrotasks
7399  * exits.
7400  * kDoNotRunMicrotasks should be used to annotate calls not intended to trigger
7401  * microtasks.
7402  */
7404  public:
7406 
7407  MicrotasksScope(Isolate* isolate, Type type);
7408  MicrotasksScope(Isolate* isolate, MicrotaskQueue* microtask_queue, Type type);
7410 
7411  /**
7412  * Runs microtasks if no kRunMicrotasks scope is currently active.
7413  */
7414  static void PerformCheckpoint(Isolate* isolate);
7415 
7416  /**
7417  * Returns current depth of nested kRunMicrotasks scopes.
7418  */
7419  static int GetCurrentDepth(Isolate* isolate);
7420 
7421  /**
7422  * Returns true while microtasks are being executed.
7423  */
7424  static bool IsRunningMicrotasks(Isolate* isolate);
7425 
7426  // Prevent copying.
7429 
7430  private:
7431  internal::Isolate* const isolate_;
7432  internal::MicrotaskQueue* const microtask_queue_;
7433  bool run_;
7434 };
7435 
7436 
7437 // --- Failed Access Check Callback ---
7438 typedef void (*FailedAccessCheckCallback)(Local<Object> target,
7439  AccessType type,
7440  Local<Value> data);
7441 
7442 // --- AllowCodeGenerationFromStrings callbacks ---
7443 
7444 /**
7445  * Callback to check if code generation from strings is allowed. See
7446  * Context::AllowCodeGenerationFromStrings.
7447  */
7449  Local<String> source);
7450 
7452  // If true, proceed with the codegen algorithm. Otherwise, block it.
7453  bool codegen_allowed = false;
7454  // Overwrite the original source with this string, if present.
7455  // Use the original source if empty.
7456  // This field is considered only if codegen_allowed is true.
7458 };
7459 
7460 /**
7461  * Callback to check if codegen is allowed from a source object, and convert
7462  * the source to string if necessary.See ModifyCodeGenerationFromStrings.
7463  */
7465  *ModifyCodeGenerationFromStringsCallback)(Local<Context> context,
7466  Local<Value> source);
7467 
7468 // --- WebAssembly compilation callbacks ---
7470 
7472  Local<String> source);
7473 
7474 // --- Callback for APIs defined on v8-supported objects, but implemented
7475 // by the embedder. Example: WebAssembly.{compile|instantiate}Streaming ---
7477 
7478 // --- Callback for WebAssembly.compileStreaming ---
7480 
7481 // --- Callback for checking if WebAssembly threads are enabled ---
7482 typedef bool (*WasmThreadsEnabledCallback)(Local<Context> context);
7483 
7484 // --- Callback for loading source map file for Wasm profiling support
7486  const char* name);
7487 
7488 // --- Callback for checking if WebAssembly Simd is enabled ---
7489 typedef bool (*WasmSimdEnabledCallback)(Local<Context> context);
7490 
7491 // --- Garbage Collection Callbacks ---
7492 
7493 /**
7494  * Applications can register callback functions which will be called before and
7495  * after certain garbage collection operations. Allocations are not allowed in
7496  * the callback functions, you therefore cannot manipulate objects (set or
7497  * delete properties for example) since it is possible such operations will
7498  * result in the allocation of objects.
7499  */
7500 enum GCType {
7507 };
7508 
7509 /**
7510  * GCCallbackFlags is used to notify additional information about the GC
7511  * callback.
7512  * - kGCCallbackFlagConstructRetainedObjectInfos: The GC callback is for
7513  * constructing retained object infos.
7514  * - kGCCallbackFlagForced: The GC callback is for a forced GC for testing.
7515  * - kGCCallbackFlagSynchronousPhantomCallbackProcessing: The GC callback
7516  * is called synchronously without getting posted to an idle task.
7517  * - kGCCallbackFlagCollectAllAvailableGarbage: The GC callback is called
7518  * in a phase where V8 is trying to collect all available garbage
7519  * (e.g., handling a low memory notification).
7520  * - kGCCallbackScheduleIdleGarbageCollection: The GC callback is called to
7521  * trigger an idle garbage collection.
7522  */
7531 };
7532 
7533 typedef void (*GCCallback)(GCType type, GCCallbackFlags flags);
7534 
7535 typedef void (*InterruptCallback)(Isolate* isolate, void* data);
7536 
7537 /**
7538  * This callback is invoked when the heap size is close to the heap limit and
7539  * V8 is likely to abort with out-of-memory error.
7540  * The callback can extend the heap limit by returning a value that is greater
7541  * than the current_heap_limit. The initial heap limit is the limit that was
7542  * set after heap setup.
7543  */
7544 typedef size_t (*NearHeapLimitCallback)(void* data, size_t current_heap_limit,
7545  size_t initial_heap_limit);
7546 
7547 /**
7548  * Collection of shared per-process V8 memory information.
7549  *
7550  * Instances of this class can be passed to
7551  * v8::V8::GetSharedMemoryStatistics to get shared memory statistics from V8.
7552  */
7554  public:
7556  size_t read_only_space_size() { return read_only_space_size_; }
7557  size_t read_only_space_used_size() { return read_only_space_used_size_; }
7559  return read_only_space_physical_size_;
7560  }
7561 
7562  private:
7563  size_t read_only_space_size_;
7564  size_t read_only_space_used_size_;
7565  size_t read_only_space_physical_size_;
7566 
7567  friend class V8;
7568  friend class internal::ReadOnlyHeap;
7569 };
7570 
7571 /**
7572  * Collection of V8 heap information.
7573  *
7574  * Instances of this class can be passed to v8::Isolate::GetHeapStatistics to
7575  * get heap statistics from V8.
7576  */
7578  public:
7580  size_t total_heap_size() { return total_heap_size_; }
7581  size_t total_heap_size_executable() { return total_heap_size_executable_; }
7582  size_t total_physical_size() { return total_physical_size_; }
7583  size_t total_available_size() { return total_available_size_; }
7584  size_t total_global_handles_size() { return total_global_handles_size_; }
7585  size_t used_global_handles_size() { return used_global_handles_size_; }
7586  size_t used_heap_size() { return used_heap_size_; }
7587  size_t heap_size_limit() { return heap_size_limit_; }
7588  size_t malloced_memory() { return malloced_memory_; }
7589  size_t external_memory() { return external_memory_; }
7590  size_t peak_malloced_memory() { return peak_malloced_memory_; }
7591  size_t number_of_native_contexts() { return number_of_native_contexts_; }
7592  size_t number_of_detached_contexts() { return number_of_detached_contexts_; }
7593 
7594  /**
7595  * Returns a 0/1 boolean, which signifies whether the V8 overwrite heap
7596  * garbage with a bit pattern.
7597  */
7598  size_t does_zap_garbage() { return does_zap_garbage_; }
7599 
7600  private:
7601  size_t total_heap_size_;
7602  size_t total_heap_size_executable_;
7603  size_t total_physical_size_;
7604  size_t total_available_size_;
7605  size_t used_heap_size_;
7606  size_t heap_size_limit_;
7607  size_t malloced_memory_;
7608  size_t external_memory_;
7609  size_t peak_malloced_memory_;
7610  bool does_zap_garbage_;
7611  size_t number_of_native_contexts_;
7612  size_t number_of_detached_contexts_;
7613  size_t total_global_handles_size_;
7614  size_t used_global_handles_size_;
7615 
7616  friend class V8;
7617  friend class Isolate;
7618 };
7619 
7620 
7622  public:
7624  const char* space_name() { return space_name_; }
7625  size_t space_size() { return space_size_; }
7626  size_t space_used_size() { return space_used_size_; }
7627  size_t space_available_size() { return space_available_size_; }
7628  size_t physical_space_size() { return physical_space_size_; }
7629 
7630  private:
7631  const char* space_name_;
7632  size_t space_size_;
7633  size_t space_used_size_;
7634  size_t space_available_size_;
7635  size_t physical_space_size_;
7636 
7637  friend class Isolate;
7638 };
7639 
7640 
7642  public:
7644  const char* object_type() { return object_type_; }
7645  const char* object_sub_type() { return object_sub_type_; }
7646  size_t object_count() { return object_count_; }
7647  size_t object_size() { return object_size_; }
7648 
7649  private:
7650  const char* object_type_;
7651  const char* object_sub_type_;
7652  size_t object_count_;
7653  size_t object_size_;
7654 
7655  friend class Isolate;
7656 };
7657 
7659  public:
7661  size_t code_and_metadata_size() { return code_and_metadata_size_; }
7662  size_t bytecode_and_metadata_size() { return bytecode_and_metadata_size_; }
7663  size_t external_script_source_size() { return external_script_source_size_; }
7664 
7665  private:
7666  size_t code_and_metadata_size_;
7667  size_t bytecode_and_metadata_size_;
7668  size_t external_script_source_size_;
7669 
7670  friend class Isolate;
7671 };
7672 
7673 /**
7674  * A JIT code event is issued each time code is added, moved or removed.
7675  *
7676  * \note removal events are not currently issued.
7677  */
7679  enum EventType {
7686  };
7687  // Definition of the code position type. The "POSITION" type means the place
7688  // in the source code which are of interest when making stack traces to
7689  // pin-point the source location of a stack frame as close as possible.
7690  // The "STATEMENT_POSITION" means the place at the beginning of each
7691  // statement, and is used to indicate possible break locations.
7693 
7694  // There are two different kinds of JitCodeEvents, one for JIT code generated
7695  // by the optimizing compiler, and one for byte code generated for the
7696  // interpreter. For JIT_CODE events, the |code_start| member of the event
7697  // points to the beginning of jitted assembly code, while for BYTE_CODE
7698  // events, |code_start| points to the first bytecode of the interpreted
7699  // function.
7701 
7702  // Type of event.
7705  // Start of the instructions.
7706  void* code_start;
7707  // Size of the instructions.
7708  size_t code_len;
7709  // Script info for CODE_ADDED event.
7711  // User-defined data for *_LINE_INFO_* event. It's used to hold the source
7712  // code line information which is returned from the
7713  // CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent
7714  // CODE_ADD_LINE_POS_INFO and CODE_END_LINE_INFO_RECORDING events.
7715  void* user_data;
7716 
7717  struct name_t {
7718  // Name of the object associated with the code, note that the string is not
7719  // zero-terminated.
7720  const char* str;
7721  // Number of chars in str.
7722  size_t len;
7723  };
7724 
7725  struct line_info_t {
7726  // PC offset
7727  size_t offset;
7728  // Code position
7729  size_t pos;
7730  // The position type.
7732  };
7733 
7735  // Source file name.
7736  const char* filename;
7737  // Length of filename.
7739  // Line number table, which maps offsets of JITted code to line numbers of
7740  // source file.
7742  // Number of entries in the line number table.
7744  };
7745 
7747 
7748  union {
7749  // Only valid for CODE_ADDED.
7750  struct name_t name;
7751 
7752  // Only valid for CODE_ADD_LINE_POS_INFO
7753  struct line_info_t line_info;
7754 
7755  // New location of instructions. Only valid for CODE_MOVED.
7757  };
7758 
7760 };
7761 
7762 /**
7763  * Option flags passed to the SetRAILMode function.
7764  * See documentation https://developers.google.com/web/tools/chrome-devtools/
7765  * profile/evaluate-performance/rail
7766  */
7767 enum RAILMode : unsigned {
7768  // Response performance mode: In this mode very low virtual machine latency
7769  // is provided. V8 will try to avoid JavaScript execution interruptions.
7770  // Throughput may be throttled.
7772  // Animation performance mode: In this mode low virtual machine latency is
7773  // provided. V8 will try to avoid as many JavaScript execution interruptions
7774  // as possible. Throughput may be throttled. This is the default mode.
7776  // Idle performance mode: The embedder is idle. V8 can complete deferred work
7777  // in this mode.
7779  // Load performance mode: In this mode high throughput is provided. V8 may
7780  // turn off latency optimizations.
7782 };
7783 
7784 /**
7785  * Option flags passed to the SetJitCodeEventHandler function.
7786  */
7789  // Generate callbacks for already existent code.
7791 };
7792 
7793 
7794 /**
7795  * Callback function passed to SetJitCodeEventHandler.
7796  *
7797  * \param event code add, move or removal event.
7798  */
7799 typedef void (*JitCodeEventHandler)(const JitCodeEvent* event);
7800 
7801 /**
7802  * Callback function passed to SetUnhandledExceptionCallback.
7803  */
7804 #if defined(V8_OS_WIN)
7805 typedef int (*UnhandledExceptionCallback)(
7807 #endif
7808 
7809 /**
7810  * Interface for iterating through all external resources in the heap.
7811  */
7813  public:
7814  virtual ~ExternalResourceVisitor() = default;
7815  virtual void VisitExternalString(Local<String> string) {}
7816 };
7817 
7818 
7819 /**
7820  * Interface for iterating through all the persistent handles in the heap.
7821  */
7823  public:
7824  virtual ~PersistentHandleVisitor() = default;
7826  uint16_t class_id) {}
7827 };
7828 
7829 /**
7830  * Memory pressure level for the MemoryPressureNotification.
7831  * kNone hints V8 that there is no memory pressure.
7832  * kModerate hints V8 to speed up incremental garbage collection at the cost of
7833  * of higher latency due to garbage collection pauses.
7834  * kCritical hints V8 to free memory as soon as possible. Garbage collection
7835  * pauses at this level will be large.
7836  */
7838 
7839 /**
7840  * Interface for tracing through the embedder heap. During a V8 garbage
7841  * collection, V8 collects hidden fields of all potential wrappers, and at the
7842  * end of its marking phase iterates the collection and asks the embedder to
7843  * trace through its heap and use reporter to report each JavaScript object
7844  * reachable from any of the given wrappers.
7845  */
7847  public:
7848  using EmbedderStackState = cppgc::EmbedderStackState;
7849 
7852  kReduceMemory = 1 << 0,
7853  kForced = 1 << 2,
7854  };
7855 
7856  /**
7857  * Interface for iterating through TracedGlobal handles.
7858  */
7860  public:
7861  virtual ~TracedGlobalHandleVisitor() = default;
7862  virtual void VisitTracedGlobalHandle(const TracedGlobal<Value>& handle) {}
7863  virtual void VisitTracedReference(const TracedReference<Value>& handle) {}
7864  };
7865 
7866  /**
7867  * Summary of a garbage collection cycle. See |TraceEpilogue| on how the
7868  * summary is reported.
7869  */
7870  struct TraceSummary {
7871  /**
7872  * Time spent managing the retained memory in milliseconds. This can e.g.
7873  * include the time tracing through objects in the embedder.
7874  */
7875  double time = 0.0;
7876 
7877  /**
7878  * Memory retained by the embedder through the |EmbedderHeapTracer|
7879  * mechanism in bytes.
7880  */
7881  size_t allocated_size = 0;
7882  };
7883 
7884  virtual ~EmbedderHeapTracer() = default;
7885 
7886  /**
7887  * Iterates all TracedGlobal handles created for the v8::Isolate the tracer is
7888  * attached to.
7889  */
7891 
7892  /**
7893  * Called by the embedder to set the start of the stack which is e.g. used by
7894  * V8 to determine whether handles are used from stack or heap.
7895  */
7896  void SetStackStart(void* stack_start);
7897 
7898  /**
7899  * Called by the embedder to notify V8 of an empty execution stack.
7900  */
7902 
7903  /**
7904  * Called by v8 to register internal fields of found wrappers.
7905  *
7906  * The embedder is expected to store them somewhere and trace reachable
7907  * wrappers from them when called through |AdvanceTracing|.
7908  */
7909  virtual void RegisterV8References(
7910  const std::vector<std::pair<void*, void*> >& embedder_fields) = 0;
7911 
7913 
7914  /**
7915  * Called at the beginning of a GC cycle.
7916  */
7917  virtual void TracePrologue(TraceFlags flags) {}
7918 
7919  /**
7920  * Called to advance tracing in the embedder.
7921  *
7922  * The embedder is expected to trace its heap starting from wrappers reported
7923  * by RegisterV8References method, and report back all reachable wrappers.
7924  * Furthermore, the embedder is expected to stop tracing by the given
7925  * deadline. A deadline of infinity means that tracing should be finished.
7926  *
7927  * Returns |true| if tracing is done, and false otherwise.
7928  */
7929  virtual bool AdvanceTracing(double deadline_in_ms) = 0;
7930 
7931  /*
7932  * Returns true if there no more tracing work to be done (see AdvanceTracing)
7933  * and false otherwise.
7934  */
7935  virtual bool IsTracingDone() = 0;
7936 
7937  /**
7938  * Called at the end of a GC cycle.
7939  *
7940  * Note that allocation is *not* allowed within |TraceEpilogue|. Can be
7941  * overriden to fill a |TraceSummary| that is used by V8 to schedule future
7942  * garbage collections.
7943  */
7944  virtual void TraceEpilogue(TraceSummary* trace_summary) {}
7945 
7946  /**
7947  * Called upon entering the final marking pause. No more incremental marking
7948  * steps will follow this call.
7949  */
7950  virtual void EnterFinalPause(EmbedderStackState stack_state) = 0;
7951 
7952  /*
7953  * Called by the embedder to request immediate finalization of the currently
7954  * running tracing phase that has been started with TracePrologue and not
7955  * yet finished with TraceEpilogue.
7956  *
7957  * Will be a noop when currently not in tracing.
7958  *
7959  * This is an experimental feature.
7960  */
7962 
7963  /**
7964  * Returns true if the TracedGlobal handle should be considered as root for
7965  * the currently running non-tracing garbage collection and false otherwise.
7966  * The default implementation will keep all TracedGlobal references as roots.
7967  *
7968  * If this returns false, then V8 may decide that the object referred to by
7969  * such a handle is reclaimed. In that case:
7970  * - No action is required if handles are used with destructors, i.e., by just
7971  * using |TracedGlobal|.
7972  * - When run without destructors, i.e., by using
7973  * |TracedReference|, V8 calls |ResetHandleInNonTracingGC|.
7974  *
7975  * Note that the |handle| is different from the handle that the embedder holds
7976  * for retaining the object. The embedder may use |WrapperClassId()| to
7977  * distinguish cases where it wants handles to be treated as roots from not
7978  * being treated as roots.
7979  */
7981  const v8::TracedReference<v8::Value>& handle);
7982  virtual bool IsRootForNonTracingGC(const v8::TracedGlobal<v8::Value>& handle);
7983 
7984  /**
7985  * Used in combination with |IsRootForNonTracingGC|. Called by V8 when an
7986  * object that is backed by a handle is reclaimed by a non-tracing garbage
7987  * collection. It is up to the embedder to reset the original handle.
7988  *
7989  * Note that the |handle| is different from the handle that the embedder holds
7990  * for retaining the object. It is up to the embedder to find the original
7991  * handle via the object or class id.
7992  */
7994  const v8::TracedReference<v8::Value>& handle);
7995 
7996  /*
7997  * Called by the embedder to immediately perform a full garbage collection.
7998  *
7999  * Should only be used in testing code.
8000  */
8001  void GarbageCollectionForTesting(EmbedderStackState stack_state);
8002 
8003  /*
8004  * Called by the embedder to signal newly allocated or freed memory. Not bound
8005  * to tracing phases. Embedders should trade off when increments are reported
8006  * as V8 may consult global heuristics on whether to trigger garbage
8007  * collection on this change.
8008  */
8009  void IncreaseAllocatedSize(size_t bytes);
8010  void DecreaseAllocatedSize(size_t bytes);
8011 
8012  /*
8013  * Returns the v8::Isolate this tracer is attached too and |nullptr| if it
8014  * is not attached to any v8::Isolate.
8015  */
8016  v8::Isolate* isolate() const { return isolate_; }
8017 
8018  protected:
8019  v8::Isolate* isolate_ = nullptr;
8020 
8021  friend class internal::LocalEmbedderHeapTracer;
8022 };
8023 
8024 /**
8025  * Callback and supporting data used in SnapshotCreator to implement embedder
8026  * logic to serialize internal fields.
8027  * Internal fields that directly reference V8 objects are serialized without
8028  * calling this callback. Internal fields that contain aligned pointers are
8029  * serialized by this callback if it returns non-zero result. Otherwise it is
8030  * serialized verbatim.
8031  */
8033  typedef StartupData (*CallbackFunction)(Local<Object> holder, int index,
8034  void* data);
8035  SerializeInternalFieldsCallback(CallbackFunction function = nullptr,
8036  void* data_arg = nullptr)
8037  : callback(function), data(data_arg) {}
8038  CallbackFunction callback;
8039  void* data;
8040 };
8041 // Note that these fields are called "internal fields" in the API and called
8042 // "embedder fields" within V8.
8044 
8045 /**
8046  * Callback and supporting data used to implement embedder logic to deserialize
8047  * internal fields.
8048  */
8050  typedef void (*CallbackFunction)(Local<Object> holder, int index,
8051  StartupData payload, void* data);
8053  void* data_arg = nullptr)
8054  : callback(function), data(data_arg) {}
8055  void (*callback)(Local<Object> holder, int index, StartupData payload,
8056  void* data);
8057  void* data;
8058 };
8060 
8061 /**
8062  * Controls how the default MeasureMemoryDelegate reports the result of
8063  * the memory measurement to JS. With kSummary only the total size is reported.
8064  * With kDetailed the result includes the size of each native context.
8065  */
8067 
8068 /**
8069  * Controls how promptly a memory measurement request is executed.
8070  * By default the measurement is folded with the next scheduled GC which may
8071  * happen after a while. The kEager starts increment GC right away and
8072  * is useful for testing.
8073  */
8075 
8076 /**
8077  * The delegate is used in Isolate::MeasureMemory API.
8078  *
8079  * It specifies the contexts that need to be measured and gets called when
8080  * the measurement is completed to report the results.
8081  */
8083  public:
8084  virtual ~MeasureMemoryDelegate() = default;
8085 
8086  /**
8087  * Returns true if the size of the given context needs to be measured.
8088  */
8089  virtual bool ShouldMeasure(Local<Context> context) = 0;
8090 
8091  /**
8092  * This function is called when memory measurement finishes.
8093  *
8094  * \param context_sizes_in_bytes a vector of (context, size) pairs that
8095  * includes each context for which ShouldMeasure returned true and that
8096  * was not garbage collected while the memory measurement was in progress.
8097  *
8098  * \param unattributed_size_in_bytes total size of objects that were not
8099  * attributed to any context (i.e. are likely shared objects).
8100  */
8101  virtual void MeasurementComplete(
8102  const std::vector<std::pair<Local<Context>, size_t>>&
8103  context_sizes_in_bytes,
8104  size_t unattributed_size_in_bytes) = 0;
8105 
8106  /**
8107  * Returns a default delegate that resolves the given promise when
8108  * the memory measurement completes.
8109  *
8110  * \param isolate the current isolate
8111  * \param context the current context
8112  * \param promise_resolver the promise resolver that is given the
8113  * result of the memory measurement.
8114  * \param mode the detail level of the result.
8115  */
8116  static std::unique_ptr<MeasureMemoryDelegate> Default(
8117  Isolate* isolate, Local<Context> context,
8118  Local<Promise::Resolver> promise_resolver, MeasureMemoryMode mode);
8119 };
8120 
8121 /**
8122  * Isolate represents an isolated instance of the V8 engine. V8 isolates have
8123  * completely separate states. Objects from one isolate must not be used in
8124  * other isolates. The embedder can create multiple isolates and use them in
8125  * parallel in multiple threads. An isolate can be entered by at most one
8126  * thread at any given time. The Locker/Unlocker API must be used to
8127  * synchronize.
8128  */
8130  public:
8131  /**
8132  * Initial configuration parameters for a new Isolate.
8133  */
8134  struct CreateParams {
8136  : code_event_handler(nullptr),
8137  snapshot_blob(nullptr),
8138  counter_lookup_callback(nullptr),
8139  create_histogram_callback(nullptr),
8141  array_buffer_allocator(nullptr),
8143  external_references(nullptr),
8144  allow_atomics_wait(true),
8148 
8149  /**
8150  * Allows the host application to provide the address of a function that is
8151  * notified each time code is added, moved or removed.
8152  */
8154 
8155  /**
8156  * ResourceConstraints to use for the new Isolate.
8157  */
8159 
8160  /**
8161  * Explicitly specify a startup snapshot blob. The embedder owns the blob.
8162  */
8164 
8165 
8166  /**
8167  * Enables the host application to provide a mechanism for recording
8168  * statistics counters.
8169  */
8171 
8172  /**
8173  * Enables the host application to provide a mechanism for recording
8174  * histograms. The CreateHistogram function returns a
8175  * histogram which will later be passed to the AddHistogramSample
8176  * function.
8177  */
8180 
8181  /**
8182  * The ArrayBuffer::Allocator to use for allocating and freeing the backing
8183  * store of ArrayBuffers.
8184  *
8185  * If the shared_ptr version is used, the Isolate instance and every
8186  * |BackingStore| allocated using this allocator hold a std::shared_ptr
8187  * to the allocator, in order to facilitate lifetime
8188  * management for the allocator instance.
8189  */
8192 
8193  /**
8194  * Specifies an optional nullptr-terminated array of raw addresses in the
8195  * embedder that V8 can match against during serialization and use for
8196  * deserialization. This array and its content must stay valid for the
8197  * entire lifetime of the isolate.
8198  */
8199  const intptr_t* external_references;
8200 
8201  /**
8202  * Whether calling Atomics.wait (a function that may block) is allowed in
8203  * this isolate. This can also be configured via SetAllowAtomicsWait.
8204  */
8206 
8207  /**
8208  * Termination is postponed when there is no active SafeForTerminationScope.
8209  */
8211 
8212  /**
8213  * The following parameters describe the offsets for addressing type info
8214  * for wrapped API objects and are used by the fast C API
8215  * (for details see v8-fast-api-calls.h).
8216  */
8219  };
8220 
8221 
8222  /**
8223  * Stack-allocated class which sets the isolate for all operations
8224  * executed within a local scope.
8225  */
8227  public:
8228  explicit Scope(Isolate* isolate) : isolate_(isolate) {
8229  isolate->Enter();
8230  }
8231 
8232  ~Scope() { isolate_->Exit(); }
8233 
8234  // Prevent copying of Scope objects.
8235  Scope(const Scope&) = delete;
8236  Scope& operator=(const Scope&) = delete;
8237 
8238  private:
8239  Isolate* const isolate_;
8240  };
8241 
8242 
8243  /**
8244  * Assert that no Javascript code is invoked.
8245  */
8247  public:
8249 
8252 
8253  // Prevent copying of Scope objects.
8255  delete;
8257  const DisallowJavascriptExecutionScope&) = delete;
8258 
8259  private:
8260  OnFailure on_failure_;
8261  void* internal_;
8262  };
8263 
8264 
8265  /**
8266  * Introduce exception to DisallowJavascriptExecutionScope.
8267  */
8269  public:
8272 
8273  // Prevent copying of Scope objects.
8275  delete;
8277  const AllowJavascriptExecutionScope&) = delete;
8278 
8279  private:
8280  void* internal_throws_;
8281  void* internal_assert_;
8282  void* internal_dump_;
8283  };
8284 
8285  /**
8286  * Do not run microtasks while this scope is active, even if microtasks are
8287  * automatically executed otherwise.
8288  */
8290  public:
8292  Isolate* isolate, MicrotaskQueue* microtask_queue = nullptr);
8294 
8295  // Prevent copying of Scope objects.
8297  delete;
8299  const SuppressMicrotaskExecutionScope&) = delete;
8300 
8301  private:
8302  internal::Isolate* const isolate_;
8303  internal::MicrotaskQueue* const microtask_queue_;
8304  internal::Address previous_stack_height_;
8305 
8306  friend class internal::ThreadLocalTop;
8307  };
8308 
8309  /**
8310  * This scope allows terminations inside direct V8 API calls and forbid them
8311  * inside any recursice API calls without explicit SafeForTerminationScope.
8312  */
8314  public:
8315  explicit SafeForTerminationScope(v8::Isolate* isolate);
8317 
8318  // Prevent copying of Scope objects.
8321 
8322  private:
8323  internal::Isolate* isolate_;
8324  bool prev_value_;
8325  };
8326 
8327  /**
8328  * Types of garbage collections that can be requested via
8329  * RequestGarbageCollectionForTesting.
8330  */
8334  };
8335 
8336  /**
8337  * Features reported via the SetUseCounterCallback callback. Do not change
8338  * assigned numbers of existing items; add new features to the end of this
8339  * list.
8340  */
8342  kUseAsm = 0,
8401  kLocale = 59,
8416  kDateGetTimezoneOffset = 74, // Unused.
8450 
8451  // If you add new values here, you'll also need to update Chromium's:
8452  // web_feature.mojom, use_counter_callback.cc, and enums.xml. V8 changes to
8453  // this list need to be landed first, then changes on the Chromium side.
8454  kUseCounterFeatureCount // This enum value must be last.
8455  };
8456 
8458  kMessageLog = (1 << 0),
8459  kMessageDebug = (1 << 1),
8460  kMessageInfo = (1 << 2),
8461  kMessageError = (1 << 3),
8462  kMessageWarning = (1 << 4),
8465  };
8466 
8467  typedef void (*UseCounterCallback)(Isolate* isolate,
8468  UseCounterFeature feature);
8469 
8470  /**
8471  * Allocates a new isolate but does not initialize it. Does not change the
8472  * currently entered isolate.
8473  *
8474  * Only Isolate::GetData() and Isolate::SetData(), which access the
8475  * embedder-controlled parts of the isolate, are allowed to be called on the
8476  * uninitialized isolate. To initialize the isolate, call
8477  * Isolate::Initialize().
8478  *
8479  * When an isolate is no longer used its resources should be freed
8480  * by calling Dispose(). Using the delete operator is not allowed.
8481  *
8482  * V8::Initialize() must have run prior to this.
8483  */
8484  static Isolate* Allocate();
8485 
8486  /**
8487  * Initialize an Isolate previously allocated by Isolate::Allocate().
8488  */
8489  static void Initialize(Isolate* isolate, const CreateParams& params);
8490 
8491  /**
8492  * Creates a new isolate. Does not change the currently entered
8493  * isolate.
8494  *
8495  * When an isolate is no longer used its resources should be freed
8496  * by calling Dispose(). Using the delete operator is not allowed.
8497  *
8498  * V8::Initialize() must have run prior to this.
8499  */
8500  static Isolate* New(const CreateParams& params);
8501 
8502  /**
8503  * Returns the entered isolate for the current thread or NULL in
8504  * case there is no current isolate.
8505  *
8506  * This method must not be invoked before V8::Initialize() was invoked.
8507  */
8508  static Isolate* GetCurrent();
8509 
8510  /**
8511  * Clears the set of objects held strongly by the heap. This set of
8512  * objects are originally built when a WeakRef is created or
8513  * successfully dereferenced.
8514  *
8515  * This is invoked automatically after microtasks are run. See
8516  * MicrotasksPolicy for when microtasks are run.
8517  *
8518  * This needs to be manually invoked only if the embedder is manually running
8519  * microtasks via a custom MicrotaskQueue class's PerformCheckpoint. In that
8520  * case, it is the embedder's responsibility to make this call at a time which
8521  * does not interrupt synchronous ECMAScript code execution.
8522  */
8524 
8525  /**
8526  * Custom callback used by embedders to help V8 determine if it should abort
8527  * when it throws and no internal handler is predicted to catch the
8528  * exception. If --abort-on-uncaught-exception is used on the command line,
8529  * then V8 will abort if either:
8530  * - no custom callback is set.
8531  * - the custom callback set returns true.
8532  * Otherwise, the custom callback will not be called and V8 will not abort.
8533  */
8537 
8538  /**
8539  * This specifies the callback called by the upcoming dynamic
8540  * import() language feature to load modules.
8541  */
8544 
8545  /**
8546  * This specifies the callback called by the upcoming importa.meta
8547  * language feature to retrieve host-defined meta data for a module.
8548  */
8551 
8552  /**
8553  * This specifies the callback called when the stack property of Error
8554  * is accessed.
8555  */
8557 
8558  /**
8559  * Optional notification that the system is running low on memory.
8560  * V8 uses these notifications to guide heuristics.
8561  * It is allowed to call this function from another thread while
8562  * the isolate is executing long running JavaScript code.
8563  */
8565 
8566  /**
8567  * Methods below this point require holding a lock (using Locker) in
8568  * a multi-threaded environment.
8569  */
8570 
8571  /**
8572  * Sets this isolate as the entered one for the current thread.
8573  * Saves the previously entered one (if any), so that it can be
8574  * restored when exiting. Re-entering an isolate is allowed.
8575  */
8576  void Enter();
8577 
8578  /**
8579  * Exits this isolate by restoring the previously entered one in the
8580  * current thread. The isolate may still stay the same, if it was
8581  * entered more than once.
8582  *
8583  * Requires: this == Isolate::GetCurrent().
8584  */
8585  void Exit();
8586 
8587  /**
8588  * Disposes the isolate. The isolate must not be entered by any
8589  * thread to be disposable.
8590  */
8591  void Dispose();
8592 
8593  /**
8594  * Dumps activated low-level V8 internal stats. This can be used instead
8595  * of performing a full isolate disposal.
8596  */
8598 
8599  /**
8600  * Discards all V8 thread-specific data for the Isolate. Should be used
8601  * if a thread is terminating and it has used an Isolate that will outlive
8602  * the thread -- all thread-specific data for an Isolate is discarded when
8603  * an Isolate is disposed so this call is pointless if an Isolate is about
8604  * to be Disposed.
8605  */
8607 
8608  /**
8609  * Associate embedder-specific data with the isolate. |slot| has to be
8610  * between 0 and GetNumberOfDataSlots() - 1.
8611  */
8612  V8_INLINE void SetData(uint32_t slot, void* data);
8613 
8614  /**
8615  * Retrieve embedder-specific data from the isolate.
8616  * Returns NULL if SetData has never been called for the given |slot|.
8617  */
8618  V8_INLINE void* GetData(uint32_t slot);
8619 
8620  /**
8621  * Returns the maximum number of available embedder data slots. Valid slots
8622  * are in the range of 0 - GetNumberOfDataSlots() - 1.
8623  */
8624  V8_INLINE static uint32_t GetNumberOfDataSlots();
8625 
8626  /**
8627  * Return data that was previously attached to the isolate snapshot via
8628  * SnapshotCreator, and removes the reference to it.
8629  * Repeated call with the same index returns an empty MaybeLocal.
8630  */
8631  template <class T>
8633 
8634  /**
8635  * Get statistics about the heap memory usage.
8636  */
8637  void GetHeapStatistics(HeapStatistics* heap_statistics);
8638 
8639  /**
8640  * Returns the number of spaces in the heap.
8641  */
8643 
8644  /**
8645  * Get the memory usage of a space in the heap.
8646  *
8647  * \param space_statistics The HeapSpaceStatistics object to fill in
8648  * statistics.
8649  * \param index The index of the space to get statistics from, which ranges
8650  * from 0 to NumberOfHeapSpaces() - 1.
8651  * \returns true on success.
8652  */
8654  size_t index);
8655 
8656  /**
8657  * Returns the number of types of objects tracked in the heap at GC.
8658  */
8660 
8661  /**
8662  * Get statistics about objects in the heap.
8663  *
8664  * \param object_statistics The HeapObjectStatistics object to fill in
8665  * statistics of objects of given type, which were live in the previous GC.
8666  * \param type_index The index of the type of object to fill details about,
8667  * which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1.
8668  * \returns true on success.
8669  */
8671  size_t type_index);
8672 
8673  /**
8674  * Get statistics about code and its metadata in the heap.
8675  *
8676  * \param object_statistics The HeapCodeStatistics object to fill in
8677  * statistics of code, bytecode and their metadata.
8678  * \returns true on success.
8679  */
8681 
8682  /**
8683  * This API is experimental and may change significantly.
8684  *
8685  * Enqueues a memory measurement request and invokes the delegate with the
8686  * results.
8687  *
8688  * \param delegate the delegate that defines which contexts to measure and
8689  * reports the results.
8690  *
8691  * \param execution promptness executing the memory measurement.
8692  * The kEager value is expected to be used only in tests.
8693  */
8695  std::unique_ptr<MeasureMemoryDelegate> delegate,
8697 
8698  V8_DEPRECATE_SOON("Use the version with a delegate")
8700  MeasureMemoryMode mode);
8701 
8702  /**
8703  * Get a call stack sample from the isolate.
8704  * \param state Execution state.
8705  * \param frames Caller allocated buffer to store stack frames.
8706  * \param frames_limit Maximum number of frames to capture. The buffer must
8707  * be large enough to hold the number of frames.
8708  * \param sample_info The sample info is filled up by the function
8709  * provides number of actual captured stack frames and
8710  * the current VM state.
8711  * \note GetStackSample should only be called when the JS thread is paused or
8712  * interrupted. Otherwise the behavior is undefined.
8713  */
8714  void GetStackSample(const RegisterState& state, void** frames,
8715  size_t frames_limit, SampleInfo* sample_info);
8716 
8717  /**
8718  * Adjusts the amount of registered external memory. Used to give V8 an
8719  * indication of the amount of externally allocated memory that is kept alive
8720  * by JavaScript objects. V8 uses this to decide when to perform global
8721  * garbage collections. Registering externally allocated memory will trigger
8722  * global garbage collections more often than it would otherwise in an attempt
8723  * to garbage collect the JavaScript objects that keep the externally
8724  * allocated memory alive.
8725  *
8726  * \param change_in_bytes the change in externally allocated memory that is
8727  * kept alive by JavaScript objects.
8728  * \returns the adjusted value.
8729  */
8730  V8_INLINE int64_t
8731  AdjustAmountOfExternalAllocatedMemory(int64_t change_in_bytes);
8732 
8733  /**
8734  * Returns the number of phantom handles without callbacks that were reset
8735  * by the garbage collector since the last call to this function.
8736  */
8738 
8739  /**
8740  * Returns heap profiler for this isolate. Will return NULL until the isolate
8741  * is initialized.
8742  */
8744 
8745  /**
8746  * Tells the VM whether the embedder is idle or not.
8747  */
8748  void SetIdle(bool is_idle);
8749 
8750  /** Returns the ArrayBuffer::Allocator used in this isolate. */
8752 
8753  /** Returns true if this isolate has a current context. */
8754  bool InContext();
8755 
8756  /**
8757  * Returns the context of the currently running JavaScript, or the context
8758  * on the top of the stack if no JavaScript is running.
8759  */
8761 
8762  /** Returns the last context entered through V8's C++ API. */
8763  V8_DEPRECATED("Use GetEnteredOrMicrotaskContext().")
8765 
8766  /**
8767  * Returns either the last context entered through V8's C++ API, or the
8768  * context of the currently running microtask while processing microtasks.
8769  * If a context is entered while executing a microtask, that context is
8770  * returned.
8771  */
8773 
8774  /**
8775  * Returns the Context that corresponds to the Incumbent realm in HTML spec.
8776  * https://html.spec.whatwg.org/multipage/webappapis.html#incumbent
8777  */
8779 
8780  /**
8781  * Schedules an exception to be thrown when returning to JavaScript. When an
8782  * exception has been scheduled it is illegal to invoke any JavaScript
8783  * operation; the caller must return immediately and only after the exception
8784  * has been handled does it become legal to invoke JavaScript operations.
8785  */
8787 
8788  typedef void (*GCCallback)(Isolate* isolate, GCType type,
8789  GCCallbackFlags flags);
8790  typedef void (*GCCallbackWithData)(Isolate* isolate, GCType type,
8791  GCCallbackFlags flags, void* data);
8792 
8793  /**
8794  * Enables the host application to receive a notification before a
8795  * garbage collection. Allocations are allowed in the callback function,
8796  * but the callback is not re-entrant: if the allocation inside it will
8797  * trigger the garbage collection, the callback won't be called again.
8798  * It is possible to specify the GCType filter for your callback. But it is
8799  * not possible to register the same callback function two times with
8800  * different GCType filters.
8801  */
8802  void AddGCPrologueCallback(GCCallbackWithData callback, void* data = nullptr,
8803  GCType gc_type_filter = kGCTypeAll);
8805  GCType gc_type_filter = kGCTypeAll);
8806 
8807  /**
8808  * This function removes callback which was installed by
8809  * AddGCPrologueCallback function.
8810  */
8811  void RemoveGCPrologueCallback(GCCallbackWithData, void* data = nullptr);
8813 
8814  /**
8815  * Sets the embedder heap tracer for the isolate.
8816  */
8818 
8819  /*
8820  * Gets the currently active heap tracer for the isolate.
8821  */
8823 
8824  /**
8825  * Use for |AtomicsWaitCallback| to indicate the type of event it receives.
8826  */
8827  enum class AtomicsWaitEvent {
8828  /** Indicates that this call is happening before waiting. */
8829  kStartWait,
8830  /** `Atomics.wait()` finished because of an `Atomics.wake()` call. */
8831  kWokenUp,
8832  /** `Atomics.wait()` finished because it timed out. */
8833  kTimedOut,
8834  /** `Atomics.wait()` was interrupted through |TerminateExecution()|. */
8836  /** `Atomics.wait()` was stopped through |AtomicsWaitWakeHandle|. */
8837  kAPIStopped,
8838  /** `Atomics.wait()` did not wait, as the initial condition was not met. */
8839  kNotEqual
8840  };
8841 
8842  /**
8843  * Passed to |AtomicsWaitCallback| as a means of stopping an ongoing
8844  * `Atomics.wait` call.
8845  */
8847  public:
8848  /**
8849  * Stop this `Atomics.wait()` call and call the |AtomicsWaitCallback|
8850  * with |kAPIStopped|.
8851  *
8852  * This function may be called from another thread. The caller has to ensure
8853  * through proper synchronization that it is not called after
8854  * the finishing |AtomicsWaitCallback|.
8855  *
8856  * Note that the ECMAScript specification does not plan for the possibility
8857  * of wakeups that are neither coming from a timeout or an `Atomics.wake()`
8858  * call, so this may invalidate assumptions made by existing code.
8859  * The embedder may accordingly wish to schedule an exception in the
8860  * finishing |AtomicsWaitCallback|.
8861  */
8862  void Wake();
8863  };
8864 
8865  /**
8866  * Embedder callback for `Atomics.wait()` that can be added through
8867  * |SetAtomicsWaitCallback|.
8868  *
8869  * This will be called just before starting to wait with the |event| value
8870  * |kStartWait| and after finishing waiting with one of the other
8871  * values of |AtomicsWaitEvent| inside of an `Atomics.wait()` call.
8872  *
8873  * |array_buffer| will refer to the underlying SharedArrayBuffer,
8874  * |offset_in_bytes| to the location of the waited-on memory address inside
8875  * the SharedArrayBuffer.
8876  *
8877  * |value| and |timeout_in_ms| will be the values passed to
8878  * the `Atomics.wait()` call. If no timeout was used, |timeout_in_ms|
8879  * will be `INFINITY`.
8880  *
8881  * In the |kStartWait| callback, |stop_handle| will be an object that
8882  * is only valid until the corresponding finishing callback and that
8883  * can be used to stop the wait process while it is happening.
8884  *
8885  * This callback may schedule exceptions, *unless* |event| is equal to
8886  * |kTerminatedExecution|.
8887  */
8888  typedef void (*AtomicsWaitCallback)(AtomicsWaitEvent event,
8889  Local<SharedArrayBuffer> array_buffer,
8890  size_t offset_in_bytes, int64_t value,
8891  double timeout_in_ms,
8892  AtomicsWaitWakeHandle* stop_handle,
8893  void* data);
8894 
8895  /**
8896  * Set a new |AtomicsWaitCallback|. This overrides an earlier
8897  * |AtomicsWaitCallback|, if there was any. If |callback| is nullptr,
8898  * this unsets the callback. |data| will be passed to the callback
8899  * as its last parameter.
8900  */
8901  void SetAtomicsWaitCallback(AtomicsWaitCallback callback, void* data);
8902 
8903  /**
8904  * Enables the host application to receive a notification after a
8905  * garbage collection. Allocations are allowed in the callback function,
8906  * but the callback is not re-entrant: if the allocation inside it will
8907  * trigger the garbage collection, the callback won't be called again.
8908  * It is possible to specify the GCType filter for your callback. But it is
8909  * not possible to register the same callback function two times with
8910  * different GCType filters.
8911  */
8912  void AddGCEpilogueCallback(GCCallbackWithData callback, void* data = nullptr,
8913  GCType gc_type_filter = kGCTypeAll);
8915  GCType gc_type_filter = kGCTypeAll);
8916 
8917  /**
8918  * This function removes callback which was installed by
8919  * AddGCEpilogueCallback function.
8920  */
8922  void* data = nullptr);
8924 
8925  typedef size_t (*GetExternallyAllocatedMemoryInBytesCallback)();
8926 
8927  /**
8928  * Set the callback that tells V8 how much memory is currently allocated
8929  * externally of the V8 heap. Ideally this memory is somehow connected to V8
8930  * objects and may get freed-up when the corresponding V8 objects get
8931  * collected by a V8 garbage collection.
8932  */
8934  GetExternallyAllocatedMemoryInBytesCallback callback);
8935 
8936  /**
8937  * Forcefully terminate the current thread of JavaScript execution
8938  * in the given isolate.
8939  *
8940  * This method can be used by any thread even if that thread has not
8941  * acquired the V8 lock with a Locker object.
8942  */
8944 
8945  /**
8946  * Is V8 terminating JavaScript execution.
8947  *
8948  * Returns true if JavaScript execution is currently terminating
8949  * because of a call to TerminateExecution. In that case there are
8950  * still JavaScript frames on the stack and the termination
8951  * exception is still active.
8952  */
8954 
8955  /**
8956  * Resume execution capability in the given isolate, whose execution
8957  * was previously forcefully terminated using TerminateExecution().
8958  *
8959  * When execution is forcefully terminated using TerminateExecution(),
8960  * the isolate can not resume execution until all JavaScript frames
8961  * have propagated the uncatchable exception which is generated. This
8962  * method allows the program embedding the engine to handle the
8963  * termination event and resume execution capability, even if
8964  * JavaScript frames remain on the stack.
8965  *
8966  * This method can be used by any thread even if that thread has not
8967  * acquired the V8 lock with a Locker object.
8968  */
8970 
8971  /**
8972  * Request V8 to interrupt long running JavaScript code and invoke
8973  * the given |callback| passing the given |data| to it. After |callback|
8974  * returns control will be returned to the JavaScript code.
8975  * There may be a number of interrupt requests in flight.
8976  * Can be called from another thread without acquiring a |Locker|.
8977  * Registered |callback| must not reenter interrupted Isolate.
8978  */
8979  void RequestInterrupt(InterruptCallback callback, void* data);
8980 
8981  /**
8982  * Request garbage collection in this Isolate. It is only valid to call this
8983  * function if --expose_gc was specified.
8984  *
8985  * This should only be used for testing purposes and not to enforce a garbage
8986  * collection schedule. It has strong negative impact on the garbage
8987  * collection performance. Use IdleNotificationDeadline() or
8988  * LowMemoryNotification() instead to influence the garbage collection
8989  * schedule.
8990  */
8992 
8993  /**
8994  * Set the callback to invoke for logging event.
8995  */
8997 
8998  /**
8999  * Adds a callback to notify the host application right before a script
9000  * is about to run. If a script re-enters the runtime during executing, the
9001  * BeforeCallEnteredCallback is invoked for each re-entrance.
9002  * Executing scripts inside the callback will re-trigger the callback.
9003  */
9005 
9006  /**
9007  * Removes callback that was installed by AddBeforeCallEnteredCallback.
9008  */
9010 
9011  /**
9012  * Adds a callback to notify the host application when a script finished
9013  * running. If a script re-enters the runtime during executing, the
9014  * CallCompletedCallback is only invoked when the outer-most script
9015  * execution ends. Executing scripts inside the callback do not trigger
9016  * further callbacks.
9017  */
9019 
9020  /**
9021  * Removes callback that was installed by AddCallCompletedCallback.
9022  */
9024 
9025  /**
9026  * Set the PromiseHook callback for various promise lifecycle
9027  * events.
9028  */
9030 
9031  /**
9032  * Set callback to notify about promise reject with no handler, or
9033  * revocation of such a previous notification once the handler is added.
9034  */
9036 
9037  /**
9038  * An alias for PerformMicrotaskCheckpoint.
9039  */
9040  V8_DEPRECATE_SOON("Use PerformMicrotaskCheckpoint.")
9042 
9043  /**
9044  * Runs the default MicrotaskQueue until it gets empty and perform other
9045  * microtask checkpoint steps, such as calling ClearKeptObjects. Asserts that
9046  * the MicrotasksPolicy is not kScoped. Any exceptions thrown by microtask
9047  * callbacks are swallowed.
9048  */
9050 
9051  /**
9052  * Enqueues the callback to the default MicrotaskQueue
9053  */
9054  void EnqueueMicrotask(Local<Function> microtask);
9055 
9056  /**
9057  * Enqueues the callback to the default MicrotaskQueue
9058  */
9059  void EnqueueMicrotask(MicrotaskCallback callback, void* data = nullptr);
9060 
9061  /**
9062  * Controls how Microtasks are invoked. See MicrotasksPolicy for details.
9063  */
9065 
9066  /**
9067  * Returns the policy controlling how Microtasks are invoked.
9068  */
9070 
9071  /**
9072  * Adds a callback to notify the host application after
9073  * microtasks were run on the default MicrotaskQueue. The callback is
9074  * triggered by explicit RunMicrotasks call or automatic microtasks execution
9075  * (see SetMicrotaskPolicy).
9076  *
9077  * Callback will trigger even if microtasks were attempted to run,
9078  * but the microtasks queue was empty and no single microtask was actually
9079  * executed.
9080  *
9081  * Executing scripts inside the callback will not re-trigger microtasks and
9082  * the callback.
9083  */
9084  V8_DEPRECATE_SOON("Use *WithData version.")
9087  MicrotasksCompletedCallbackWithData callback, void* data = nullptr);
9088 
9089  /**
9090  * Removes callback that was installed by AddMicrotasksCompletedCallback.
9091  */
9092  V8_DEPRECATE_SOON("Use *WithData version.")
9095  MicrotasksCompletedCallbackWithData callback, void* data = nullptr);
9096 
9097  /**
9098  * Sets a callback for counting the number of times a feature of V8 is used.
9099  */
9101 
9102  /**
9103  * Enables the host application to provide a mechanism for recording
9104  * statistics counters.
9105  */
9107 
9108  /**
9109  * Enables the host application to provide a mechanism for recording
9110  * histograms. The CreateHistogram function returns a
9111  * histogram which will later be passed to the AddHistogramSample
9112  * function.
9113  */
9116 
9117  /**
9118  * Enables the host application to provide a mechanism for recording a
9119  * predefined set of data as crash keys to be used in postmortem debugging in
9120  * case of a crash.
9121  */
9123 
9124  /**
9125  * Optional notification that the embedder is idle.
9126  * V8 uses the notification to perform garbage collection.
9127  * This call can be used repeatedly if the embedder remains idle.
9128  * Returns true if the embedder should stop calling IdleNotificationDeadline
9129  * until real work has been done. This indicates that V8 has done
9130  * as much cleanup as it will be able to do.
9131  *
9132  * The deadline_in_seconds argument specifies the deadline V8 has to finish
9133  * garbage collection work. deadline_in_seconds is compared with
9134  * MonotonicallyIncreasingTime() and should be based on the same timebase as
9135  * that function. There is no guarantee that the actual work will be done
9136  * within the time limit.
9137  */
9138  bool IdleNotificationDeadline(double deadline_in_seconds);
9139 
9140  /**
9141  * Optional notification that the system is running low on memory.
9142  * V8 uses these notifications to attempt to free memory.
9143  */
9145 
9146  /**
9147  * Optional notification that a context has been disposed. V8 uses these
9148  * notifications to guide the GC heuristic and cancel FinalizationRegistry
9149  * cleanup tasks. Returns the number of context disposals - including this one
9150  * - since the last time V8 had a chance to clean up.
9151  *
9152  * The optional parameter |dependant_context| specifies whether the disposed
9153  * context was depending on state from other contexts or not.
9154  */
9155  int ContextDisposedNotification(bool dependant_context = true);
9156 
9157  /**
9158  * Optional notification that the isolate switched to the foreground.
9159  * V8 uses these notifications to guide heuristics.
9160  */
9162 
9163  /**
9164  * Optional notification that the isolate switched to the background.
9165  * V8 uses these notifications to guide heuristics.
9166  */
9168 
9169  /**
9170  * Optional notification which will enable the memory savings mode.
9171  * V8 uses this notification to guide heuristics which may result in a
9172  * smaller memory footprint at the cost of reduced runtime performance.
9173  */
9175 
9176  /**
9177  * Optional notification which will disable the memory savings mode.
9178  */
9180 
9181  /**
9182  * Optional notification to tell V8 the current performance requirements
9183  * of the embedder based on RAIL.
9184  * V8 uses these notifications to guide heuristics.
9185  * This is an unfinished experimental feature. Semantics and implementation
9186  * may change frequently.
9187  */
9188  void SetRAILMode(RAILMode rail_mode);
9189 
9190  /**
9191  * Optional notification to tell V8 the current isolate is used for debugging
9192  * and requires higher heap limit.
9193  */
9195 
9196  /**
9197  * Restores the original heap limit after IncreaseHeapLimitForDebugging().
9198  */
9200 
9201  /**
9202  * Returns true if the heap limit was increased for debugging and the
9203  * original heap limit was not restored yet.
9204  */
9206 
9207  /**
9208  * Allows the host application to provide the address of a function that is
9209  * notified each time code is added, moved or removed.
9210  *
9211  * \param options options for the JIT code event handler.
9212  * \param event_handler the JIT code event handler, which will be invoked
9213  * each time code is added, moved or removed.
9214  * \note \p event_handler won't get notified of existent code.
9215  * \note since code removal notifications are not currently issued, the
9216  * \p event_handler may get notifications of code that overlaps earlier
9217  * code notifications. This happens when code areas are reused, and the
9218  * earlier overlapping code areas should therefore be discarded.
9219  * \note the events passed to \p event_handler and the strings they point to
9220  * are not guaranteed to live past each call. The \p event_handler must
9221  * copy strings and other parameters it needs to keep around.
9222  * \note the set of events declared in JitCodeEvent::EventType is expected to
9223  * grow over time, and the JitCodeEvent structure is expected to accrue
9224  * new members. The \p event_handler function must ignore event codes
9225  * it does not recognize to maintain future compatibility.
9226  * \note Use Isolate::CreateParams to get events for code executed during
9227  * Isolate setup.
9228  */
9230  JitCodeEventHandler event_handler);
9231 
9232  /**
9233  * Modifies the stack limit for this Isolate.
9234  *
9235  * \param stack_limit An address beyond which the Vm's stack may not grow.
9236  *
9237  * \note If you are using threads then you should hold the V8::Locker lock
9238  * while setting the stack limit and you must set a non-default stack
9239  * limit separately for each thread.
9240  */
9241  void SetStackLimit(uintptr_t stack_limit);
9242 
9243  /**
9244  * Returns a memory range that can potentially contain jitted code. Code for
9245  * V8's 'builtins' will not be in this range if embedded builtins is enabled.
9246  *
9247  * On Win64, embedders are advised to install function table callbacks for
9248  * these ranges, as default SEH won't be able to unwind through jitted code.
9249  * The first page of the code range is reserved for the embedder and is
9250  * committed, writable, and executable, to be used to store unwind data, as
9251  * documented in
9252  * https://docs.microsoft.com/en-us/cpp/build/exception-handling-x64.
9253  *
9254  * Might be empty on other platforms.
9255  *
9256  * https://code.google.com/p/v8/issues/detail?id=3598
9257  */
9258  void GetCodeRange(void** start, size_t* length_in_bytes);
9259 
9260  /**
9261  * Returns the UnwindState necessary for use with the Unwinder API.
9262  */
9263  // TODO(petermarshall): Remove this API.
9264  V8_DEPRECATED("Use entry_stubs + code_pages version.")
9266 
9267  /**
9268  * Returns the JSEntryStubs necessary for use with the Unwinder API.
9269  */
9271 
9272  static constexpr size_t kMinCodePagesBufferSize = 32;
9273 
9274  /**
9275  * Copies the code heap pages currently in use by V8 into |code_pages_out|.
9276  * |code_pages_out| must have at least kMinCodePagesBufferSize capacity and
9277  * must be empty.
9278  *
9279  * Signal-safe, does not allocate, does not access the V8 heap.
9280  * No code on the stack can rely on pages that might be missing.
9281  *
9282  * Returns the number of pages available to be copied, which might be greater
9283  * than |capacity|. In this case, only |capacity| pages will be copied into
9284  * |code_pages_out|. The caller should provide a bigger buffer on the next
9285  * call in order to get all available code pages, but this is not required.
9286  */
9287  size_t CopyCodePages(size_t capacity, MemoryRange* code_pages_out);
9288 
9289  /** Set the callback to invoke in case of fatal errors. */
9291 
9292  /** Set the callback to invoke in case of OOM errors. */
9294 
9295  /**
9296  * Add a callback to invoke in case the heap size is close to the heap limit.
9297  * If multiple callbacks are added, only the most recently added callback is
9298  * invoked.
9299  */
9300  void AddNearHeapLimitCallback(NearHeapLimitCallback callback, void* data);
9301 
9302  /**
9303  * Remove the given callback and restore the heap limit to the
9304  * given limit. If the given limit is zero, then it is ignored.
9305  * If the current heap size is greater than the given limit,
9306  * then the heap limit is restored to the minimal limit that
9307  * is possible for the current heap size.
9308  */
9309  void RemoveNearHeapLimitCallback(NearHeapLimitCallback callback,
9310  size_t heap_limit);
9311 
9312  /**
9313  * If the heap limit was changed by the NearHeapLimitCallback, then the
9314  * initial heap limit will be restored once the heap size falls below the
9315  * given threshold percentage of the initial heap limit.
9316  * The threshold percentage is a number in (0.0, 1.0) range.
9317  */
9318  void AutomaticallyRestoreInitialHeapLimit(double threshold_percent = 0.5);
9319 
9320  /**
9321  * Set the callback to invoke to check if code generation from
9322  * strings should be allowed.
9323  */
9325  "Use Isolate::SetModifyCodeGenerationFromStringsCallback instead. "
9326  "See http://crbug.com/v8/10096.")
9327  void SetAllowCodeGenerationFromStringsCallback(
9330  ModifyCodeGenerationFromStringsCallback callback);
9331 
9332  /**
9333  * Set the callback to invoke to check if wasm code generation should
9334  * be allowed.
9335  */
9338 
9339  /**
9340  * Embedder over{ride|load} injection points for wasm APIs. The expectation
9341  * is that the embedder sets them at most once.
9342  */
9345 
9347 
9349 
9351 
9353 
9354  /**
9355  * Check if V8 is dead and therefore unusable. This is the case after
9356  * fatal errors such as out-of-memory situations.
9357  */
9358  bool IsDead();
9359 
9360  /**
9361  * Adds a message listener (errors only).
9362  *
9363  * The same message listener can be added more than once and in that
9364  * case it will be called more than once for each message.
9365  *
9366  * If data is specified, it will be passed to the callback when it is called.
9367  * Otherwise, the exception object will be passed to the callback instead.
9368  */
9370  Local<Value> data = Local<Value>());
9371 
9372  /**
9373  * Adds a message listener.
9374  *
9375  * The same message listener can be added more than once and in that
9376  * case it will be called more than once for each message.
9377  *
9378  * If data is specified, it will be passed to the callback when it is called.
9379  * Otherwise, the exception object will be passed to the callback instead.
9380  *
9381  * A listener can listen for particular error levels by providing a mask.
9382  */
9384  int message_levels,
9385  Local<Value> data = Local<Value>());
9386 
9387  /**
9388  * Remove all message listeners from the specified callback function.
9389  */
9391 
9392  /** Callback function for reporting failed access checks.*/
9394 
9395  /**
9396  * Tells V8 to capture current stack trace when uncaught exception occurs
9397  * and report it to the message listeners. The option is off by default.
9398  */
9400  bool capture, int frame_limit = 10,
9402 
9403  /**
9404  * Iterates through all external resources referenced from current isolate
9405  * heap. GC is not invoked prior to iterating, therefore there is no
9406  * guarantee that visited objects are still alive.
9407  */
9409 
9410  /**
9411  * Iterates through all the persistent handles in the current isolate's heap
9412  * that have class_ids.
9413  */
9415 
9416  /**
9417  * Iterates through all the persistent handles in the current isolate's heap
9418  * that have class_ids and are weak to be marked as inactive if there is no
9419  * pending activity for the handle.
9420  */
9422 
9423  /**
9424  * Check if this isolate is in use.
9425  * True if at least one thread Enter'ed this isolate.
9426  */
9427  bool IsInUse();
9428 
9429  /**
9430  * Set whether calling Atomics.wait (a function that may block) is allowed in
9431  * this isolate. This can also be configured via
9432  * CreateParams::allow_atomics_wait.
9433  */
9434  void SetAllowAtomicsWait(bool allow);
9435 
9436  /**
9437  * Time zone redetection indicator for
9438  * DateTimeConfigurationChangeNotification.
9439  *
9440  * kSkip indicates V8 that the notification should not trigger redetecting
9441  * host time zone. kRedetect indicates V8 that host time zone should be
9442  * redetected, and used to set the default time zone.
9443  *
9444  * The host time zone detection may require file system access or similar
9445  * operations unlikely to be available inside a sandbox. If v8 is run inside a
9446  * sandbox, the host time zone has to be detected outside the sandbox before
9447  * calling DateTimeConfigurationChangeNotification function.
9448  */
9450 
9451  /**
9452  * Notification that the embedder has changed the time zone, daylight savings
9453  * time or other date / time configuration parameters. V8 keeps a cache of
9454  * various values used for date / time computation. This notification will
9455  * reset those cached values for the current context so that date / time
9456  * configuration changes would be reflected.
9457  *
9458  * This API should not be called more than needed as it will negatively impact
9459  * the performance of date operations.
9460  */
9462  TimeZoneDetection time_zone_detection = TimeZoneDetection::kSkip);
9463 
9464  /**
9465  * Notification that the embedder has changed the locale. V8 keeps a cache of
9466  * various values used for locale computation. This notification will reset
9467  * those cached values for the current context so that locale configuration
9468  * changes would be reflected.
9469  *
9470  * This API should not be called more than needed as it will negatively impact
9471  * the performance of locale operations.
9472  */
9474 
9475  Isolate() = delete;
9476  ~Isolate() = delete;
9477  Isolate(const Isolate&) = delete;
9478  Isolate& operator=(const Isolate&) = delete;
9479  // Deleting operator new and delete here is allowed as ctor and dtor is also
9480  // deleted.
9481  void* operator new(size_t size) = delete;
9482  void* operator new[](size_t size) = delete;
9483  void operator delete(void*, size_t) = delete;
9484  void operator delete[](void*, size_t) = delete;
9485 
9486  private:
9487  template <class K, class V, class Traits>
9489 
9490  internal::Address* GetDataFromSnapshotOnce(size_t index);
9491  void ReportExternalAllocationLimitReached();
9492 };
9493 
9495  public:
9496  /**
9497  * Whether the data created can be rehashed and and the hash seed can be
9498  * recomputed when deserialized.
9499  * Only valid for StartupData returned by SnapshotCreator::CreateBlob().
9500  */
9501  bool CanBeRehashed() const;
9502 
9503  const char* data;
9505 };
9506 
9507 
9508 /**
9509  * EntropySource is used as a callback function when v8 needs a source
9510  * of entropy.
9511  */
9512 typedef bool (*EntropySource)(unsigned char* buffer, size_t length);
9513 
9514 /**
9515  * ReturnAddressLocationResolver is used as a callback function when v8 is
9516  * resolving the location of a return address on the stack. Profilers that
9517  * change the return address on the stack can use this to resolve the stack
9518  * location to wherever the profiler stashed the original return address.
9519  *
9520  * \param return_addr_location A location on stack where a machine
9521  * return address resides.
9522  * \returns Either return_addr_location, or else a pointer to the profiler's
9523  * copy of the original return address.
9524  *
9525  * \note The resolver function must not cause garbage collection.
9526  */
9527 typedef uintptr_t (*ReturnAddressLocationResolver)(
9528  uintptr_t return_addr_location);
9529 
9530 
9531 /**
9532  * Container class for static utility functions.
9533  */
9534 class V8_EXPORT V8 {
9535  public:
9536  /**
9537  * Hand startup data to V8, in case the embedder has chosen to build
9538  * V8 with external startup data.
9539  *
9540  * Note:
9541  * - By default the startup data is linked into the V8 library, in which
9542  * case this function is not meaningful.
9543  * - If this needs to be called, it needs to be called before V8
9544  * tries to make use of its built-ins.
9545  * - To avoid unnecessary copies of data, V8 will point directly into the
9546  * given data blob, so pretty please keep it around until V8 exit.
9547  * - Compression of the startup blob might be useful, but needs to
9548  * handled entirely on the embedders' side.
9549  * - The call will abort if the data is invalid.
9550  */
9551  static void SetSnapshotDataBlob(StartupData* startup_blob);
9552 
9553  /** Set the callback to invoke in case of Dcheck failures. */
9555 
9556 
9557  /**
9558  * Sets V8 flags from a string.
9559  */
9560  static void SetFlagsFromString(const char* str);
9561  static void SetFlagsFromString(const char* str, size_t length);
9562 
9563  /**
9564  * Sets V8 flags from the command line.
9565  */
9566  static void SetFlagsFromCommandLine(int* argc,
9567  char** argv,
9568  bool remove_flags);
9569 
9570  /** Get the version string. */
9571  static const char* GetVersion();
9572 
9573  /**
9574  * Initializes V8. This function needs to be called before the first Isolate
9575  * is created. It always returns true.
9576  */
9577  V8_INLINE static bool Initialize() {
9578  const int kBuildConfiguration =
9579  (internal::PointerCompressionIsEnabled() ? kPointerCompression : 0) |
9580  (internal::SmiValuesAre31Bits() ? k31BitSmis : 0) |
9581  (internal::HeapSandboxIsEnabled() ? kHeapSandbox : 0);
9582  return Initialize(kBuildConfiguration);
9583  }
9584 
9585  /**
9586  * Allows the host application to provide a callback which can be used
9587  * as a source of entropy for random number generators.
9588  */
9589  static void SetEntropySource(EntropySource source);
9590 
9591  /**
9592  * Allows the host application to provide a callback that allows v8 to
9593  * cooperate with a profiler that rewrites return addresses on stack.
9594  */
9596  ReturnAddressLocationResolver return_address_resolver);
9597 
9598  /**
9599  * Releases any resources used by v8 and stops any utility threads
9600  * that may be running. Note that disposing v8 is permanent, it
9601  * cannot be reinitialized.
9602  *
9603  * It should generally not be necessary to dispose v8 before exiting
9604  * a process, this should happen automatically. It is only necessary
9605  * to use if the process needs the resources taken up by v8.
9606  */
9607  static bool Dispose();
9608 
9609  /**
9610  * Initialize the ICU library bundled with V8. The embedder should only
9611  * invoke this method when using the bundled ICU. Returns true on success.
9612  *
9613  * If V8 was compiled with the ICU data in an external file, the location
9614  * of the data file has to be provided.
9615  */
9616  static bool InitializeICU(const char* icu_data_file = nullptr);
9617 
9618  /**
9619  * Initialize the ICU library bundled with V8. The embedder should only
9620  * invoke this method when using the bundled ICU. If V8 was compiled with
9621  * the ICU data in an external file and when the default location of that
9622  * file should be used, a path to the executable must be provided.
9623  * Returns true on success.
9624  *
9625  * The default is a file called icudtl.dat side-by-side with the executable.
9626  *
9627  * Optionally, the location of the data file can be provided to override the
9628  * default.
9629  */
9630  static bool InitializeICUDefaultLocation(const char* exec_path,
9631  const char* icu_data_file = nullptr);
9632 
9633  /**
9634  * Initialize the external startup data. The embedder only needs to
9635  * invoke this method when external startup data was enabled in a build.
9636  *
9637  * If V8 was compiled with the startup data in an external file, then
9638  * V8 needs to be given those external files during startup. There are
9639  * three ways to do this:
9640  * - InitializeExternalStartupData(const char*)
9641  * This will look in the given directory for the file "snapshot_blob.bin".
9642  * - InitializeExternalStartupDataFromFile(const char*)
9643  * As above, but will directly use the given file name.
9644  * - Call SetSnapshotDataBlob.
9645  * This will read the blobs from the given data structure and will
9646  * not perform any file IO.
9647  */
9648  static void InitializeExternalStartupData(const char* directory_path);
9649  static void InitializeExternalStartupDataFromFile(const char* snapshot_blob);
9650 
9651  /**
9652  * Sets the v8::Platform to use. This should be invoked before V8 is
9653  * initialized.
9654  */
9655  static void InitializePlatform(Platform* platform);
9656 
9657  /**
9658  * Clears all references to the v8::Platform. This should be invoked after
9659  * V8 was disposed.
9660  */
9661  static void ShutdownPlatform();
9662 
9663 #if V8_OS_POSIX
9664  /**
9665  * Give the V8 signal handler a chance to handle a fault.
9666  *
9667  * This function determines whether a memory access violation can be recovered
9668  * by V8. If so, it will return true and modify context to return to a code
9669  * fragment that can recover from the fault. Otherwise, TryHandleSignal will
9670  * return false.
9671  *
9672  * The parameters to this function correspond to those passed to a Linux
9673  * signal handler.
9674  *
9675  * \param signal_number The signal number.
9676  *
9677  * \param info A pointer to the siginfo_t structure provided to the signal
9678  * handler.
9679  *
9680  * \param context The third argument passed to the Linux signal handler, which
9681  * points to a ucontext_t structure.
9682  */
9683  V8_DEPRECATE_SOON("Use TryHandleWebAssemblyTrapPosix")
9684  static bool TryHandleSignal(int signal_number, void* info, void* context);
9685 #endif // V8_OS_POSIX
9686 
9687  /**
9688  * Activate trap-based bounds checking for WebAssembly.
9689  *
9690  * \param use_v8_signal_handler Whether V8 should install its own signal
9691  * handler or rely on the embedder's.
9692  */
9693  static bool EnableWebAssemblyTrapHandler(bool use_v8_signal_handler);
9694 
9695 #if defined(V8_OS_WIN)
9696  /**
9697  * On Win64, by default V8 does not emit unwinding data for jitted code,
9698  * which means the OS cannot walk the stack frames and the system Structured
9699  * Exception Handling (SEH) cannot unwind through V8-generated code:
9700  * https://code.google.com/p/v8/issues/detail?id=3598.
9701  *
9702  * This function allows embedders to register a custom exception handler for
9703  * exceptions in V8-generated code.
9704  */
9705  static void SetUnhandledExceptionCallback(
9707 #endif
9708 
9709  /**
9710  * Get statistics about the shared memory usage.
9711  */
9713 
9714  private:
9715  V8();
9716 
9717  enum BuildConfigurationFeatures {
9718  kPointerCompression = 1 << 0,
9719  k31BitSmis = 1 << 1,
9720  kHeapSandbox = 1 << 2,
9721  };
9722 
9723  /**
9724  * Checks that the embedder build configuration is compatible with
9725  * the V8 binary and if so initializes V8.
9726  */
9727  static bool Initialize(int build_config);
9728 
9729  static internal::Address* GlobalizeReference(internal::Isolate* isolate,
9730  internal::Address* handle);
9731  static internal::Address* GlobalizeTracedReference(internal::Isolate* isolate,
9732  internal::Address* handle,
9733  internal::Address* slot,
9734  bool has_destructor);
9735  static void MoveGlobalReference(internal::Address** from,
9736  internal::Address** to);
9737  static void MoveTracedGlobalReference(internal::Address** from,
9738  internal::Address** to);
9739  static void CopyTracedGlobalReference(const internal::Address* const* from,
9740  internal::Address** to);
9741  static internal::Address* CopyGlobalReference(internal::Address* from);
9742  static void DisposeGlobal(internal::Address* global_handle);
9743  static void DisposeTracedGlobal(internal::Address* global_handle);
9744  static void MakeWeak(internal::Address* location, void* data,
9745  WeakCallbackInfo<void>::Callback weak_callback,
9746  WeakCallbackType type);
9747  static void MakeWeak(internal::Address** location_addr);
9748  static void* ClearWeak(internal::Address* location);
9749  static void SetFinalizationCallbackTraced(
9750  internal::Address* location, void* parameter,
9751  WeakCallbackInfo<void>::Callback callback);
9752  static void AnnotateStrongRetainer(internal::Address* location,
9753  const char* label);
9754  static Value* Eternalize(Isolate* isolate, Value* handle);
9755 
9756  template <class K, class V, class T>
9758 
9759  static void FromJustIsNothing();
9760  static void ToLocalEmpty();
9761  static void InternalFieldOutOfBounds(int index);
9762  template <class T>
9763  friend class Global;
9764  template <class T> friend class Local;
9765  template <class T>
9766  friend class MaybeLocal;
9767  template <class T>
9768  friend class Maybe;
9769  template <class T>
9770  friend class TracedReferenceBase;
9771  template <class T>
9772  friend class TracedGlobal;
9773  template <class T>
9774  friend class TracedReference;
9775  template <class T>
9776  friend class WeakCallbackInfo;
9777  template <class T> friend class Eternal;
9778  template <class T> friend class PersistentBase;
9779  template <class T, class M> friend class Persistent;
9780  friend class Context;
9781 };
9782 
9783 /**
9784  * Helper class to create a snapshot data blob.
9785  *
9786  * The Isolate used by a SnapshotCreator is owned by it, and will be entered
9787  * and exited by the constructor and destructor, respectively; The destructor
9788  * will also destroy the Isolate. Experimental language features, including
9789  * those available by default, are not available while creating a snapshot.
9790  */
9792  public:
9794 
9795  /**
9796  * Initialize and enter an isolate, and set it up for serialization.
9797  * The isolate is either created from scratch or from an existing snapshot.
9798  * The caller keeps ownership of the argument snapshot.
9799  * \param existing_blob existing snapshot from which to create this one.
9800  * \param external_references a null-terminated array of external references
9801  * that must be equivalent to CreateParams::external_references.
9802  */
9804  const intptr_t* external_references = nullptr,
9805  StartupData* existing_blob = nullptr);
9806 
9807  /**
9808  * Create and enter an isolate, and set it up for serialization.
9809  * The isolate is either created from scratch or from an existing snapshot.
9810  * The caller keeps ownership of the argument snapshot.
9811  * \param existing_blob existing snapshot from which to create this one.
9812  * \param external_references a null-terminated array of external references
9813  * that must be equivalent to CreateParams::external_references.
9814  */
9815  SnapshotCreator(const intptr_t* external_references = nullptr,
9816  StartupData* existing_blob = nullptr);
9817 
9818  /**
9819  * Destroy the snapshot creator, and exit and dispose of the Isolate
9820  * associated with it.
9821  */
9823 
9824  /**
9825  * \returns the isolate prepared by the snapshot creator.
9826  */
9828 
9829  /**
9830  * Set the default context to be included in the snapshot blob.
9831  * The snapshot will not contain the global proxy, and we expect one or a
9832  * global object template to create one, to be provided upon deserialization.
9833  *
9834  * \param callback optional callback to serialize internal fields.
9835  */
9839 
9840  /**
9841  * Add additional context to be included in the snapshot blob.
9842  * The snapshot will include the global proxy.
9843  *
9844  * \param callback optional callback to serialize internal fields.
9845  *
9846  * \returns the index of the context in the snapshot blob.
9847  */
9848  size_t AddContext(Local<Context> context,
9851 
9852  /**
9853  * Attach arbitrary V8::Data to the context snapshot, which can be retrieved
9854  * via Context::GetDataFromSnapshot after deserialization. This data does not
9855  * survive when a new snapshot is created from an existing snapshot.
9856  * \returns the index for retrieval.
9857  */
9858  template <class T>
9859  V8_INLINE size_t AddData(Local<Context> context, Local<T> object);
9860 
9861  /**
9862  * Attach arbitrary V8::Data to the isolate snapshot, which can be retrieved
9863  * via Isolate::GetDataFromSnapshot after deserialization. This data does not
9864  * survive when a new snapshot is created from an existing snapshot.
9865  * \returns the index for retrieval.
9866  */
9867  template <class T>
9868  V8_INLINE size_t AddData(Local<T> object);
9869 
9870  /**
9871  * Created a snapshot data blob.
9872  * This must not be called from within a handle scope.
9873  * \param function_code_handling whether to include compiled function code
9874  * in the snapshot.
9875  * \returns { nullptr, 0 } on failure, and a startup snapshot on success. The
9876  * caller acquires ownership of the data array in the return value.
9877  */
9879 
9880  // Disallow copying and assigning.
9882  void operator=(const SnapshotCreator&) = delete;
9883 
9884  private:
9885  size_t AddData(Local<Context> context, internal::Address object);
9886  size_t AddData(internal::Address object);
9887 
9888  void* data_;
9889 };
9890 
9891 /**
9892  * A simple Maybe type, representing an object which may or may not have a
9893  * value, see https://hackage.haskell.org/package/base/docs/Data-Maybe.html.
9894  *
9895  * If an API method returns a Maybe<>, the API method can potentially fail
9896  * either because an exception is thrown, or because an exception is pending,
9897  * e.g. because a previous API call threw an exception that hasn't been caught
9898  * yet, or because a TerminateExecution exception was thrown. In that case, a
9899  * "Nothing" value is returned.
9900  */
9901 template <class T>
9902 class Maybe {
9903  public:
9904  V8_INLINE bool IsNothing() const { return !has_value_; }
9905  V8_INLINE bool IsJust() const { return has_value_; }
9906 
9907  /**
9908  * An alias for |FromJust|. Will crash if the Maybe<> is nothing.
9909  */
9910  V8_INLINE T ToChecked() const { return FromJust(); }
9911 
9912  /**
9913  * Short-hand for ToChecked(), which doesn't return a value. To be used, where
9914  * the actual value of the Maybe is not needed like Object::Set.
9915  */
9916  V8_INLINE void Check() const {
9917  if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing();
9918  }
9919 
9920  /**
9921  * Converts this Maybe<> to a value of type T. If this Maybe<> is
9922  * nothing (empty), |false| is returned and |out| is left untouched.
9923  */
9924  V8_WARN_UNUSED_RESULT V8_INLINE bool To(T* out) const {
9925  if (V8_LIKELY(IsJust())) *out = value_;
9926  return IsJust();
9927  }
9928 
9929  /**
9930  * Converts this Maybe<> to a value of type T. If this Maybe<> is
9931  * nothing (empty), V8 will crash the process.
9932  */
9933  V8_INLINE T FromJust() const {
9934  if (V8_UNLIKELY(!IsJust())) V8::FromJustIsNothing();
9935  return value_;
9936  }
9937 
9938  /**
9939  * Converts this Maybe<> to a value of type T, using a default value if this
9940  * Maybe<> is nothing (empty).
9941  */
9942  V8_INLINE T FromMaybe(const T& default_value) const {
9943  return has_value_ ? value_ : default_value;
9944  }
9945 
9946  V8_INLINE bool operator==(const Maybe& other) const {
9947  return (IsJust() == other.IsJust()) &&
9948  (!IsJust() || FromJust() == other.FromJust());
9949  }
9950 
9951  V8_INLINE bool operator!=(const Maybe& other) const {
9952  return !operator==(other);
9953  }
9954 
9955  private:
9956  Maybe() : has_value_(false) {}
9957  explicit Maybe(const T& t) : has_value_(true), value_(t) {}
9958 
9959  bool has_value_;
9960  T value_;
9961 
9962  template <class U>
9963  friend Maybe<U> Nothing();
9964  template <class U>
9965  friend Maybe<U> Just(const U& u);
9966 };
9967 
9968 template <class T>
9969 inline Maybe<T> Nothing() {
9970  return Maybe<T>();
9971 }
9972 
9973 template <class T>
9974 inline Maybe<T> Just(const T& t) {
9975  return Maybe<T>(t);
9976 }
9977 
9978 // A template specialization of Maybe<T> for the case of T = void.
9979 template <>
9980 class Maybe<void> {
9981  public:
9982  V8_INLINE bool IsNothing() const { return !is_valid_; }
9983  V8_INLINE bool IsJust() const { return is_valid_; }
9984 
9985  V8_INLINE bool operator==(const Maybe& other) const {
9986  return IsJust() == other.IsJust();
9987  }
9988 
9989  V8_INLINE bool operator!=(const Maybe& other) const {
9990  return !operator==(other);
9991  }
9992 
9993  private:
9994  struct JustTag {};
9995 
9996  Maybe() : is_valid_(false) {}
9997  explicit Maybe(JustTag) : is_valid_(true) {}
9998 
9999  bool is_valid_;
10000 
10001  template <class U>
10002  friend Maybe<U> Nothing();
10003  friend Maybe<void> JustVoid();
10004 };
10005 
10006 inline Maybe<void> JustVoid() { return Maybe<void>(Maybe<void>::JustTag()); }
10007 
10008 /**
10009  * An external exception handler.
10010  */
10012  public:
10013  /**
10014  * Creates a new try/catch block and registers it with v8. Note that
10015  * all TryCatch blocks should be stack allocated because the memory
10016  * location itself is compared against JavaScript try/catch blocks.
10017  */
10018  explicit TryCatch(Isolate* isolate);
10019 
10020  /**
10021  * Unregisters and deletes this try/catch block.
10022  */
10024 
10025  /**
10026  * Returns true if an exception has been caught by this try/catch block.
10027  */
10028  bool HasCaught() const;
10029 
10030  /**
10031  * For certain types of exceptions, it makes no sense to continue execution.
10032  *
10033  * If CanContinue returns false, the correct action is to perform any C++
10034  * cleanup needed and then return. If CanContinue returns false and
10035  * HasTerminated returns true, it is possible to call
10036  * CancelTerminateExecution in order to continue calling into the engine.
10037  */
10038  bool CanContinue() const;
10039 
10040  /**
10041  * Returns true if an exception has been caught due to script execution
10042  * being terminated.
10043  *
10044  * There is no JavaScript representation of an execution termination
10045  * exception. Such exceptions are thrown when the TerminateExecution
10046  * methods are called to terminate a long-running script.
10047  *
10048  * If such an exception has been thrown, HasTerminated will return true,
10049  * indicating that it is possible to call CancelTerminateExecution in order
10050  * to continue calling into the engine.
10051  */
10052  bool HasTerminated() const;
10053 
10054  /**
10055  * Throws the exception caught by this TryCatch in a way that avoids
10056  * it being caught again by this same TryCatch. As with ThrowException
10057  * it is illegal to execute any JavaScript operations after calling
10058  * ReThrow; the caller must return immediately to where the exception
10059  * is caught.
10060  */
10062 
10063  /**
10064  * Returns the exception caught by this try/catch block. If no exception has
10065  * been caught an empty handle is returned.
10066  *
10067  * The returned handle is valid until this TryCatch block has been destroyed.
10068  */
10070 
10071  /**
10072  * Returns the .stack property of an object. If no .stack
10073  * property is present an empty handle is returned.
10074  */
10076  Local<Context> context, Local<Value> exception);
10077 
10078  /**
10079  * Returns the .stack property of the thrown object. If no .stack property is
10080  * present or if this try/catch block has not caught an exception, an empty
10081  * handle is returned.
10082  */
10084  Local<Context> context) const;
10085 
10086  /**
10087  * Returns the message associated with this exception. If there is
10088  * no message associated an empty handle is returned.
10089  *
10090  * The returned handle is valid until this TryCatch block has been
10091  * destroyed.
10092  */
10093  Local<v8::Message> Message() const;
10094 
10095  /**
10096  * Clears any exceptions that may have been caught by this try/catch block.
10097  * After this method has been called, HasCaught() will return false. Cancels
10098  * the scheduled exception if it is caught and ReThrow() is not called before.
10099  *
10100  * It is not necessary to clear a try/catch block before using it again; if
10101  * another exception is thrown the previously caught exception will just be
10102  * overwritten. However, it is often a good idea since it makes it easier
10103  * to determine which operation threw a given exception.
10104  */
10105  void Reset();
10106 
10107  /**
10108  * Set verbosity of the external exception handler.
10109  *
10110  * By default, exceptions that are caught by an external exception
10111  * handler are not reported. Call SetVerbose with true on an
10112  * external exception handler to have exceptions caught by the
10113  * handler reported as if they were not caught.
10114  */
10115  void SetVerbose(bool value);
10116 
10117  /**
10118  * Returns true if verbosity is enabled.
10119  */
10120  bool IsVerbose() const;
10121 
10122  /**
10123  * Set whether or not this TryCatch should capture a Message object
10124  * which holds source information about where the exception
10125  * occurred. True by default.
10126  */
10127  void SetCaptureMessage(bool value);
10128 
10129  /**
10130  * There are cases when the raw address of C++ TryCatch object cannot be
10131  * used for comparisons with addresses into the JS stack. The cases are:
10132  * 1) ARM, ARM64 and MIPS simulators which have separate JS stack.
10133  * 2) Address sanitizer allocates local C++ object in the heap when
10134  * UseAfterReturn mode is enabled.
10135  * This method returns address that can be used for comparisons with
10136  * addresses into the JS stack. When neither simulator nor ASAN's
10137  * UseAfterReturn is enabled, then the address returned will be the address
10138  * of the C++ try catch handler itself.
10139  */
10140  static void* JSStackComparableAddress(TryCatch* handler) {
10141  if (handler == nullptr) return nullptr;
10142  return handler->js_stack_comparable_address_;
10143  }
10144 
10145  TryCatch(const TryCatch&) = delete;
10146  void operator=(const TryCatch&) = delete;
10147 
10148  private:
10149  // Declaring operator new and delete as deleted is not spec compliant.
10150  // Therefore declare them private instead to disable dynamic alloc
10151  void* operator new(size_t size);
10152  void* operator new[](size_t size);
10153  void operator delete(void*, size_t);
10154  void operator delete[](void*, size_t);
10155 
10156  void ResetInternal();
10157 
10158  internal::Isolate* isolate_;
10159  TryCatch* next_;
10160  void* exception_;
10161  void* message_obj_;
10162  void* js_stack_comparable_address_;
10163  bool is_verbose_ : 1;
10164  bool can_continue_ : 1;
10165  bool capture_message_ : 1;
10166  bool rethrow_ : 1;
10167  bool has_terminated_ : 1;
10168 
10169  friend class internal::Isolate;
10170 };
10171 
10172 
10173 // --- Context ---
10174 
10175 
10176 /**
10177  * A container for extension names.
10178  */
10180  public:
10181  ExtensionConfiguration() : name_count_(0), names_(nullptr) {}
10182  ExtensionConfiguration(int name_count, const char* names[])
10183  : name_count_(name_count), names_(names) { }
10184 
10185  const char** begin() const { return &names_[0]; }
10186  const char** end() const { return &names_[name_count_]; }
10187 
10188  private:
10189  const int name_count_;
10190  const char** names_;
10191 };
10192 
10193 /**
10194  * A sandboxed execution context with its own set of built-in objects
10195  * and functions.
10196  */
10198  public:
10199  /**
10200  * Returns the global proxy object.
10201  *
10202  * Global proxy object is a thin wrapper whose prototype points to actual
10203  * context's global object with the properties like Object, etc. This is done
10204  * that way for security reasons (for more details see
10205  * https://wiki.mozilla.org/Gecko:SplitWindow).
10206  *
10207  * Please note that changes to global proxy object prototype most probably
10208  * would break VM---v8 expects only global object as a prototype of global
10209  * proxy object.
10210  */
10212 
10213  /**
10214  * Detaches the global object from its context before
10215  * the global object can be reused to create a new context.
10216  */
10218 
10219  /**
10220  * Creates a new context and returns a handle to the newly allocated
10221  * context.
10222  *
10223  * \param isolate The isolate in which to create the context.
10224  *
10225  * \param extensions An optional extension configuration containing
10226  * the extensions to be installed in the newly created context.
10227  *
10228  * \param global_template An optional object template from which the
10229  * global object for the newly created context will be created.
10230  *
10231  * \param global_object An optional global object to be reused for
10232  * the newly created context. This global object must have been
10233  * created by a previous call to Context::New with the same global
10234  * template. The state of the global object will be completely reset
10235  * and only object identify will remain.
10236  */
10237  static Local<Context> New(
10238  Isolate* isolate, ExtensionConfiguration* extensions = nullptr,
10240  MaybeLocal<Value> global_object = MaybeLocal<Value>(),
10241  DeserializeInternalFieldsCallback internal_fields_deserializer =
10243  MicrotaskQueue* microtask_queue = nullptr);
10244 
10245  /**
10246  * Create a new context from a (non-default) context snapshot. There
10247  * is no way to provide a global object template since we do not create
10248  * a new global object from template, but we can reuse a global object.
10249  *
10250  * \param isolate See v8::Context::New.
10251  *
10252  * \param context_snapshot_index The index of the context snapshot to
10253  * deserialize from. Use v8::Context::New for the default snapshot.
10254  *
10255  * \param embedder_fields_deserializer Optional callback to deserialize
10256  * internal fields. It should match the SerializeInternalFieldCallback used
10257  * to serialize.
10258  *
10259  * \param extensions See v8::Context::New.
10260  *
10261  * \param global_object See v8::Context::New.
10262  */
10264  Isolate* isolate, size_t context_snapshot_index,
10265  DeserializeInternalFieldsCallback embedder_fields_deserializer =
10267  ExtensionConfiguration* extensions = nullptr,
10268  MaybeLocal<Value> global_object = MaybeLocal<Value>(),
10269  MicrotaskQueue* microtask_queue = nullptr);
10270 
10271  /**
10272  * Returns an global object that isn't backed by an actual context.
10273  *
10274  * The global template needs to have access checks with handlers installed.
10275  * If an existing global object is passed in, the global object is detached
10276  * from its context.
10277  *
10278  * Note that this is different from a detached context where all accesses to
10279  * the global proxy will fail. Instead, the access check handlers are invoked.
10280  *
10281  * It is also not possible to detach an object returned by this method.
10282  * Instead, the access check handlers need to return nothing to achieve the
10283  * same effect.
10284  *
10285  * It is possible, however, to create a new context from the global object
10286  * returned by this method.
10287  */
10289  Isolate* isolate, Local<ObjectTemplate> global_template,
10290  MaybeLocal<Value> global_object = MaybeLocal<Value>());
10291 
10292  /**
10293  * Sets the security token for the context. To access an object in
10294  * another context, the security tokens must match.
10295  */
10297 
10298  /** Restores the security token to the default value. */
10300 
10301  /** Returns the security token of this context.*/
10303 
10304  /**
10305  * Enter this context. After entering a context, all code compiled
10306  * and run is compiled and run in this context. If another context
10307  * is already entered, this old context is saved so it can be
10308  * restored when the new context is exited.
10309  */
10310  void Enter();
10311 
10312  /**
10313  * Exit this context. Exiting the current context restores the
10314  * context that was in place when entering the current context.
10315  */
10316  void Exit();
10317 
10318  /** Returns an isolate associated with a current context. */
10320 
10321  /**
10322  * The field at kDebugIdIndex used to be reserved for the inspector.
10323  * It now serves no purpose.
10324  */
10326 
10327  /**
10328  * Return the number of fields allocated for embedder data.
10329  */
10331 
10332  /**
10333  * Gets the embedder data with the given index, which must have been set by a
10334  * previous call to SetEmbedderData with the same index.
10335  */
10336  V8_INLINE Local<Value> GetEmbedderData(int index);
10337 
10338  /**
10339  * Gets the binding object used by V8 extras. Extra natives get a reference
10340  * to this object and can use it to "export" functionality by adding
10341  * properties. Extra natives can also "import" functionality by accessing
10342  * properties added by the embedder using the V8 API.
10343  */
10345 
10346  /**
10347  * Sets the embedder data with the given index, growing the data as
10348  * needed. Note that index 0 currently has a special meaning for Chrome's
10349  * debugger.
10350  */
10351  void SetEmbedderData(int index, Local<Value> value);
10352 
10353  /**
10354  * Gets a 2-byte-aligned native pointer from the embedder data with the given
10355  * index, which must have been set by a previous call to
10356  * SetAlignedPointerInEmbedderData with the same index. Note that index 0
10357  * currently has a special meaning for Chrome's debugger.
10358  */
10360 
10361  /**
10362  * Sets a 2-byte-aligned native pointer in the embedder data with the given
10363  * index, growing the data as needed. Note that index 0 currently has a
10364  * special meaning for Chrome's debugger.
10365  */
10366  void SetAlignedPointerInEmbedderData(int index, void* value);
10367 
10368  /**
10369  * Control whether code generation from strings is allowed. Calling
10370  * this method with false will disable 'eval' and the 'Function'
10371  * constructor for code running in this context. If 'eval' or the
10372  * 'Function' constructor are used an exception will be thrown.
10373  *
10374  * If code generation from strings is not allowed the
10375  * V8::AllowCodeGenerationFromStrings callback will be invoked if
10376  * set before blocking the call to 'eval' or the 'Function'
10377  * constructor. If that callback returns true, the call will be
10378  * allowed, otherwise an exception will be thrown. If no callback is
10379  * set an exception will be thrown.
10380  */
10382 
10383  /**
10384  * Returns true if code generation from strings is allowed for the context.
10385  * For more details see AllowCodeGenerationFromStrings(bool) documentation.
10386  */
10388 
10389  /**
10390  * Sets the error description for the exception that is thrown when
10391  * code generation from strings is not allowed and 'eval' or the 'Function'
10392  * constructor are called.
10393  */
10395 
10396  /**
10397  * Return data that was previously attached to the context snapshot via
10398  * SnapshotCreator, and removes the reference to it.
10399  * Repeated call with the same index returns an empty MaybeLocal.
10400  */
10401  template <class T>
10403 
10404  /**
10405  * If callback is set, abort any attempt to execute JavaScript in this
10406  * context, call the specified callback, and throw an exception.
10407  * To unset abort, pass nullptr as callback.
10408  */
10409  typedef void (*AbortScriptExecutionCallback)(Isolate* isolate,
10410  Local<Context> context);
10412 
10413  /**
10414  * Returns the value that was set or restored by
10415  * SetContinuationPreservedEmbedderData(), if any.
10416  */
10418 
10419  /**
10420  * Sets a value that will be stored on continuations and reset while the
10421  * continuation runs.
10422  */
10424 
10425  /**
10426  * Stack-allocated class which sets the execution context for all
10427  * operations executed within a local scope.
10428  */
10429  class Scope {
10430  public:
10431  explicit V8_INLINE Scope(Local<Context> context) : context_(context) {
10432  context_->Enter();
10433  }
10434  V8_INLINE ~Scope() { context_->Exit(); }
10435 
10436  private:
10437  Local<Context> context_;
10438  };
10439 
10440  /**
10441  * Stack-allocated class to support the backup incumbent settings object
10442  * stack.
10443  * https://html.spec.whatwg.org/multipage/webappapis.html#backup-incumbent-settings-object-stack
10444  */
10445  class V8_EXPORT BackupIncumbentScope final {
10446  public:
10447  /**
10448  * |backup_incumbent_context| is pushed onto the backup incumbent settings
10449  * object stack.
10450  */
10451  explicit BackupIncumbentScope(Local<Context> backup_incumbent_context);
10453 
10454  /**
10455  * Returns address that is comparable with JS stack address. Note that JS
10456  * stack may be allocated separately from the native stack. See also
10457  * |TryCatch::JSStackComparableAddress| for details.
10458  */
10459  uintptr_t JSStackComparableAddress() const {
10460  return js_stack_comparable_address_;
10461  }
10462 
10463  private:
10464  friend class internal::Isolate;
10465 
10466  Local<Context> backup_incumbent_context_;
10467  uintptr_t js_stack_comparable_address_ = 0;
10468  const BackupIncumbentScope* prev_ = nullptr;
10469  };
10470 
10471  private:
10472  friend class Value;
10473  friend class Script;
10474  friend class Object;
10475  friend class Function;
10476 
10477  internal::Address* GetDataFromSnapshotOnce(size_t index);
10478  Local<Value> SlowGetEmbedderData(int index);
10479  void* SlowGetAlignedPointerFromEmbedderData(int index);
10480 };
10481 
10482 
10483 /**
10484  * Multiple threads in V8 are allowed, but only one thread at a time is allowed
10485  * to use any given V8 isolate, see the comments in the Isolate class. The
10486  * definition of 'using a V8 isolate' includes accessing handles or holding onto
10487  * object pointers obtained from V8 handles while in the particular V8 isolate.
10488  * It is up to the user of V8 to ensure, perhaps with locking, that this
10489  * constraint is not violated. In addition to any other synchronization
10490  * mechanism that may be used, the v8::Locker and v8::Unlocker classes must be
10491  * used to signal thread switches to V8.
10492  *
10493  * v8::Locker is a scoped lock object. While it's active, i.e. between its
10494  * construction and destruction, the current thread is allowed to use the locked
10495  * isolate. V8 guarantees that an isolate can be locked by at most one thread at
10496  * any time. In other words, the scope of a v8::Locker is a critical section.
10497  *
10498  * Sample usage:
10499 * \code
10500  * ...
10501  * {
10502  * v8::Locker locker(isolate);
10503  * v8::Isolate::Scope isolate_scope(isolate);
10504  * ...
10505  * // Code using V8 and isolate goes here.
10506  * ...
10507  * } // Destructor called here
10508  * \endcode
10509  *
10510  * If you wish to stop using V8 in a thread A you can do this either by
10511  * destroying the v8::Locker object as above or by constructing a v8::Unlocker
10512  * object:
10513  *
10514  * \code
10515  * {
10516  * isolate->Exit();
10517  * v8::Unlocker unlocker(isolate);
10518  * ...
10519  * // Code not using V8 goes here while V8 can run in another thread.
10520  * ...
10521  * } // Destructor called here.
10522  * isolate->Enter();
10523  * \endcode
10524  *
10525  * The Unlocker object is intended for use in a long-running callback from V8,
10526  * where you want to release the V8 lock for other threads to use.
10527  *
10528  * The v8::Locker is a recursive lock, i.e. you can lock more than once in a
10529  * given thread. This can be useful if you have code that can be called either
10530  * from code that holds the lock or from code that does not. The Unlocker is
10531  * not recursive so you can not have several Unlockers on the stack at once, and
10532  * you can not use an Unlocker in a thread that is not inside a Locker's scope.
10533  *
10534  * An unlocker will unlock several lockers if it has to and reinstate the
10535  * correct depth of locking on its destruction, e.g.:
10536  *
10537  * \code
10538  * // V8 not locked.
10539  * {
10540  * v8::Locker locker(isolate);
10541  * Isolate::Scope isolate_scope(isolate);
10542  * // V8 locked.
10543  * {
10544  * v8::Locker another_locker(isolate);
10545  * // V8 still locked (2 levels).
10546  * {
10547  * isolate->Exit();
10548  * v8::Unlocker unlocker(isolate);
10549  * // V8 not locked.
10550  * }
10551  * isolate->Enter();
10552  * // V8 locked again (2 levels).
10553  * }
10554  * // V8 still locked (1 level).
10555  * }
10556  * // V8 Now no longer locked.
10557  * \endcode
10558  */
10560  public:
10561  /**
10562  * Initialize Unlocker for a given Isolate.
10563  */
10564  V8_INLINE explicit Unlocker(Isolate* isolate) { Initialize(isolate); }
10565 
10567  private:
10568  void Initialize(Isolate* isolate);
10569 
10570  internal::Isolate* isolate_;
10571 };
10572 
10573 
10575  public:
10576  /**
10577  * Initialize Locker for a given Isolate.
10578  */
10579  V8_INLINE explicit Locker(Isolate* isolate) { Initialize(isolate); }
10580 
10582 
10583  /**
10584  * Returns whether or not the locker for a given isolate, is locked by the
10585  * current thread.
10586  */
10587  static bool IsLocked(Isolate* isolate);
10588 
10589  /**
10590  * Returns whether v8::Locker is being used by this V8 instance.
10591  */
10592  static bool IsActive();
10593 
10594  // Disallow copying and assigning.
10595  Locker(const Locker&) = delete;
10596  void operator=(const Locker&) = delete;
10597 
10598  private:
10599  void Initialize(Isolate* isolate);
10600 
10601  bool has_lock_;
10602  bool top_level_;
10603  internal::Isolate* isolate_;
10604 };
10605 
10606 /**
10607  * Various helpers for skipping over V8 frames in a given stack.
10608  *
10609  * The unwinder API is only supported on the x64, ARM64 and ARM32 architectures.
10610  */
10612  public:
10613  /**
10614  * Attempt to unwind the stack to the most recent C++ frame. This function is
10615  * signal-safe and does not access any V8 state and thus doesn't require an
10616  * Isolate.
10617  *
10618  * The unwinder needs to know the location of the JS Entry Stub (a piece of
10619  * code that is run when C++ code calls into generated JS code). This is used
10620  * for edge cases where the current frame is being constructed or torn down
10621  * when the stack sample occurs.
10622  *
10623  * The unwinder also needs the virtual memory range of all possible V8 code
10624  * objects. There are two ranges required - the heap code range and the range
10625  * for code embedded in the binary. The V8 API provides all required inputs
10626  * via an UnwindState object through the Isolate::GetUnwindState() API. These
10627  * values will not change after Isolate initialization, so the same
10628  * |unwind_state| can be used for multiple calls.
10629  *
10630  * \param unwind_state Input state for the Isolate that the stack comes from.
10631  * \param register_state The current registers. This is an in-out param that
10632  * will be overwritten with the register values after unwinding, on success.
10633  * \param stack_base The resulting stack pointer and frame pointer values are
10634  * bounds-checked against the stack_base and the original stack pointer value
10635  * to ensure that they are valid locations in the given stack. If these values
10636  * or any intermediate frame pointer values used during unwinding are ever out
10637  * of these bounds, unwinding will fail.
10638  *
10639  * \return True on success.
10640  */
10641  // TODO(petermarshall): Remove this API
10642  V8_DEPRECATED("Use entry_stubs + code_pages version.")
10643  static bool TryUnwindV8Frames(const UnwindState& unwind_state,
10644  RegisterState* register_state,
10645  const void* stack_base);
10646 
10647  /**
10648  * The same as above, but is available on x64, ARM64 and ARM32.
10649  *
10650  * \param code_pages A list of all of the ranges in which V8 has allocated
10651  * executable code. The caller should obtain this list by calling
10652  * Isolate::CopyCodePages() during the same interrupt/thread suspension that
10653  * captures the stack.
10654  */
10655  static bool TryUnwindV8Frames(const JSEntryStubs& entry_stubs,
10656  size_t code_pages_length,
10657  const MemoryRange* code_pages,
10658  RegisterState* register_state,
10659  const void* stack_base);
10660 
10661  /**
10662  * Whether the PC is within the V8 code range represented by code_range or
10663  * embedded_code_range in |unwind_state|.
10664  *
10665  * If this returns false, then calling UnwindV8Frames() with the same PC
10666  * and unwind_state will always fail. If it returns true, then unwinding may
10667  * (but not necessarily) be successful.
10668  */
10669  // TODO(petermarshall): Remove this API
10670  V8_DEPRECATED("Use code_pages version.")
10671  static bool PCIsInV8(const UnwindState& unwind_state, void* pc);
10672 
10673  /**
10674  * The same as above, but is available on x64, ARM64 and ARM32. See the
10675  * comment on TryUnwindV8Frames.
10676  */
10677  static bool PCIsInV8(size_t code_pages_length, const MemoryRange* code_pages,
10678  void* pc);
10679 };
10680 
10681 // --- Implementation ---
10682 
10683 template <class T>
10684 Local<T> Local<T>::New(Isolate* isolate, Local<T> that) {
10685  return New(isolate, that.val_);
10686 }
10687 
10688 template <class T>
10689 Local<T> Local<T>::New(Isolate* isolate, const PersistentBase<T>& that) {
10690  return New(isolate, that.val_);
10691 }
10692 
10693 template <class T>
10694 Local<T> Local<T>::New(Isolate* isolate, const TracedReferenceBase<T>& that) {
10695  return New(isolate, that.val_);
10696 }
10697 
10698 template <class T>
10699 Local<T> Local<T>::New(Isolate* isolate, T* that) {
10700  if (that == nullptr) return Local<T>();
10701  T* that_ptr = that;
10702  internal::Address* p = reinterpret_cast<internal::Address*>(that_ptr);
10703  return Local<T>(reinterpret_cast<T*>(HandleScope::CreateHandle(
10704  reinterpret_cast<internal::Isolate*>(isolate), *p)));
10705 }
10706 
10707 
10708 template<class T>
10709 template<class S>
10710 void Eternal<T>::Set(Isolate* isolate, Local<S> handle) {
10711  static_assert(std::is_base_of<T, S>::value, "type check");
10712  val_ = reinterpret_cast<T*>(
10713  V8::Eternalize(isolate, reinterpret_cast<Value*>(*handle)));
10714 }
10715 
10716 template <class T>
10717 Local<T> Eternal<T>::Get(Isolate* isolate) const {
10718  // The eternal handle will never go away, so as with the roots, we don't even
10719  // need to open a handle.
10720  return Local<T>(val_);
10721 }
10722 
10723 
10724 template <class T>
10726  if (V8_UNLIKELY(val_ == nullptr)) V8::ToLocalEmpty();
10727  return Local<T>(val_);
10728 }
10729 
10730 
10731 template <class T>
10732 void* WeakCallbackInfo<T>::GetInternalField(int index) const {
10733 #ifdef V8_ENABLE_CHECKS
10734  if (index < 0 || index >= kEmbedderFieldsInWeakCallback) {
10735  V8::InternalFieldOutOfBounds(index);
10736  }
10737 #endif
10738  return embedder_fields_[index];
10739 }
10740 
10741 
10742 template <class T>
10743 T* PersistentBase<T>::New(Isolate* isolate, T* that) {
10744  if (that == nullptr) return nullptr;
10745  internal::Address* p = reinterpret_cast<internal::Address*>(that);
10746  return reinterpret_cast<T*>(
10747  V8::GlobalizeReference(reinterpret_cast<internal::Isolate*>(isolate),
10748  p));
10749 }
10750 
10751 
10752 template <class T, class M>
10753 template <class S, class M2>
10754 void Persistent<T, M>::Copy(const Persistent<S, M2>& that) {
10755  static_assert(std::is_base_of<T, S>::value, "type check");
10756  this->Reset();
10757  if (that.IsEmpty()) return;
10758  internal::Address* p = reinterpret_cast<internal::Address*>(that.val_);
10759  this->val_ = reinterpret_cast<T*>(V8::CopyGlobalReference(p));
10760  M::Copy(that, this);
10761 }
10762 
10763 template <class T>
10764 bool PersistentBase<T>::IsWeak() const {
10765  typedef internal::Internals I;
10766  if (this->IsEmpty()) return false;
10767  return I::GetNodeState(reinterpret_cast<internal::Address*>(this->val_)) ==
10769 }
10770 
10771 
10772 template <class T>
10773 void PersistentBase<T>::Reset() {
10774  if (this->IsEmpty()) return;
10775  V8::DisposeGlobal(reinterpret_cast<internal::Address*>(this->val_));
10776  val_ = nullptr;
10777 }
10778 
10779 
10780 template <class T>
10781 template <class S>
10782 void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) {
10783  static_assert(std::is_base_of<T, S>::value, "type check");
10784  Reset();
10785  if (other.IsEmpty()) return;
10786  this->val_ = New(isolate, other.val_);
10787 }
10788 
10789 
10790 template <class T>
10791 template <class S>
10792 void PersistentBase<T>::Reset(Isolate* isolate,
10793  const PersistentBase<S>& other) {
10794  static_assert(std::is_base_of<T, S>::value, "type check");
10795  Reset();
10796  if (other.IsEmpty()) return;
10797  this->val_ = New(isolate, other.val_);
10798 }
10799 
10800 
10801 template <class T>
10802 template <typename P>
10804  P* parameter, typename WeakCallbackInfo<P>::Callback callback,
10805  WeakCallbackType type) {
10806  typedef typename WeakCallbackInfo<void>::Callback Callback;
10807  V8::MakeWeak(reinterpret_cast<internal::Address*>(this->val_), parameter,
10808  reinterpret_cast<Callback>(callback), type);
10809 }
10810 
10811 template <class T>
10813  V8::MakeWeak(reinterpret_cast<internal::Address**>(&this->val_));
10814 }
10815 
10816 template <class T>
10817 template <typename P>
10818 P* PersistentBase<T>::ClearWeak() {
10819  return reinterpret_cast<P*>(
10820  V8::ClearWeak(reinterpret_cast<internal::Address*>(this->val_)));
10821 }
10822 
10823 template <class T>
10824 void PersistentBase<T>::AnnotateStrongRetainer(const char* label) {
10825  V8::AnnotateStrongRetainer(reinterpret_cast<internal::Address*>(this->val_),
10826  label);
10827 }
10828 
10829 template <class T>
10830 void PersistentBase<T>::SetWrapperClassId(uint16_t class_id) {
10831  typedef internal::Internals I;
10832  if (this->IsEmpty()) return;
10833  internal::Address* obj = reinterpret_cast<internal::Address*>(this->val_);
10834  uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
10835  *reinterpret_cast<uint16_t*>(addr) = class_id;
10836 }
10837 
10838 
10839 template <class T>
10840 uint16_t PersistentBase<T>::WrapperClassId() const {
10841  typedef internal::Internals I;
10842  if (this->IsEmpty()) return 0;
10843  internal::Address* obj = reinterpret_cast<internal::Address*>(this->val_);
10844  uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
10845  return *reinterpret_cast<uint16_t*>(addr);
10846 }
10847 
10848 template <class T>
10849 Global<T>::Global(Global&& other) : PersistentBase<T>(other.val_) {
10850  if (other.val_ != nullptr) {
10851  V8::MoveGlobalReference(reinterpret_cast<internal::Address**>(&other.val_),
10852  reinterpret_cast<internal::Address**>(&this->val_));
10853  other.val_ = nullptr;
10854  }
10855 }
10856 
10857 template <class T>
10858 template <class S>
10859 Global<T>& Global<T>::operator=(Global<S>&& rhs) {
10860  static_assert(std::is_base_of<T, S>::value, "type check");
10861  if (this != &rhs) {
10862  this->Reset();
10863  if (rhs.val_ != nullptr) {
10864  this->val_ = rhs.val_;
10865  V8::MoveGlobalReference(
10866  reinterpret_cast<internal::Address**>(&rhs.val_),
10867  reinterpret_cast<internal::Address**>(&this->val_));
10868  rhs.val_ = nullptr;
10869  }
10870  }
10871  return *this;
10872 }
10873 
10874 template <class T>
10875 T* TracedReferenceBase<T>::New(Isolate* isolate, T* that, void* slot,
10876  DestructionMode destruction_mode) {
10877  if (that == nullptr) return nullptr;
10878  internal::Address* p = reinterpret_cast<internal::Address*>(that);
10879  return reinterpret_cast<T*>(V8::GlobalizeTracedReference(
10880  reinterpret_cast<internal::Isolate*>(isolate), p,
10881  reinterpret_cast<internal::Address*>(slot),
10882  destruction_mode == kWithDestructor));
10883 }
10884 
10885 template <class T>
10887  if (IsEmpty()) return;
10888  V8::DisposeTracedGlobal(reinterpret_cast<internal::Address*>(val_));
10889  val_ = nullptr;
10890 }
10891 
10892 template <class T>
10893 template <class S>
10894 void TracedGlobal<T>::Reset(Isolate* isolate, const Local<S>& other) {
10895  static_assert(std::is_base_of<T, S>::value, "type check");
10896  Reset();
10897  if (other.IsEmpty()) return;
10898  this->val_ = this->New(isolate, other.val_, &this->val_,
10899  TracedReferenceBase<T>::kWithDestructor);
10900 }
10901 
10902 template <class T>
10903 template <class S>
10905  static_assert(std::is_base_of<T, S>::value, "type check");
10906  *this = std::move(rhs.template As<T>());
10907  return *this;
10908 }
10909 
10910 template <class T>
10911 template <class S>
10913  static_assert(std::is_base_of<T, S>::value, "type check");
10914  *this = rhs.template As<T>();
10915  return *this;
10916 }
10917 
10918 template <class T>
10920  if (this != &rhs) {
10921  V8::MoveTracedGlobalReference(
10922  reinterpret_cast<internal::Address**>(&rhs.val_),
10923  reinterpret_cast<internal::Address**>(&this->val_));
10924  }
10925  return *this;
10926 }
10927 
10928 template <class T>
10930  if (this != &rhs) {
10931  this->Reset();
10932  if (rhs.val_ != nullptr) {
10933  V8::CopyTracedGlobalReference(
10934  reinterpret_cast<const internal::Address* const*>(&rhs.val_),
10935  reinterpret_cast<internal::Address**>(&this->val_));
10936  }
10937  }
10938  return *this;
10939 }
10940 
10941 template <class T>
10942 template <class S>
10943 void TracedReference<T>::Reset(Isolate* isolate, const Local<S>& other) {
10944  static_assert(std::is_base_of<T, S>::value, "type check");
10945  Reset();
10946  if (other.IsEmpty()) return;
10947  this->val_ = this->New(isolate, other.val_, &this->val_,
10948  TracedReferenceBase<T>::kWithoutDestructor);
10949 }
10950 
10951 template <class T>
10952 template <class S>
10954  static_assert(std::is_base_of<T, S>::value, "type check");
10955  *this = std::move(rhs.template As<T>());
10956  return *this;
10957 }
10958 
10959 template <class T>
10960 template <class S>
10962  const TracedReference<S>& rhs) {
10963  static_assert(std::is_base_of<T, S>::value, "type check");
10964  *this = rhs.template As<T>();
10965  return *this;
10966 }
10967 
10968 template <class T>
10970  if (this != &rhs) {
10971  V8::MoveTracedGlobalReference(
10972  reinterpret_cast<internal::Address**>(&rhs.val_),
10973  reinterpret_cast<internal::Address**>(&this->val_));
10974  }
10975  return *this;
10976 }
10977 
10978 template <class T>
10980  if (this != &rhs) {
10981  this->Reset();
10982  if (rhs.val_ != nullptr) {
10983  V8::CopyTracedGlobalReference(
10984  reinterpret_cast<const internal::Address* const*>(&rhs.val_),
10985  reinterpret_cast<internal::Address**>(&this->val_));
10986  }
10987  }
10988  return *this;
10989 }
10990 
10991 template <class T>
10992 void TracedReferenceBase<T>::SetWrapperClassId(uint16_t class_id) {
10993  typedef internal::Internals I;
10994  if (IsEmpty()) return;
10995  internal::Address* obj = reinterpret_cast<internal::Address*>(val_);
10996  uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
10997  *reinterpret_cast<uint16_t*>(addr) = class_id;
10998 }
10999 
11000 template <class T>
11001 uint16_t TracedReferenceBase<T>::WrapperClassId() const {
11002  typedef internal::Internals I;
11003  if (IsEmpty()) return 0;
11004  internal::Address* obj = reinterpret_cast<internal::Address*>(val_);
11005  uint8_t* addr = reinterpret_cast<uint8_t*>(obj) + I::kNodeClassIdOffset;
11006  return *reinterpret_cast<uint16_t*>(addr);
11007 }
11008 
11009 template <class T>
11011  void* parameter, typename WeakCallbackInfo<void>::Callback callback) {
11012  V8::SetFinalizationCallbackTraced(
11013  reinterpret_cast<internal::Address*>(this->val_), parameter, callback);
11014 }
11015 
11016 template <typename T>
11017 ReturnValue<T>::ReturnValue(internal::Address* slot) : value_(slot) {}
11018 
11019 template <typename T>
11020 template <typename S>
11021 void ReturnValue<T>::Set(const Global<S>& handle) {
11022  static_assert(std::is_base_of<T, S>::value, "type check");
11023  if (V8_UNLIKELY(handle.IsEmpty())) {
11024  *value_ = GetDefaultValue();
11025  } else {
11026  *value_ = *reinterpret_cast<internal::Address*>(*handle);
11027  }
11028 }
11029 
11030 template <typename T>
11031 template <typename S>
11032 void ReturnValue<T>::Set(const TracedReferenceBase<S>& handle) {
11033  static_assert(std::is_base_of<T, S>::value, "type check");
11034  if (V8_UNLIKELY(handle.IsEmpty())) {
11035  *value_ = GetDefaultValue();
11036  } else {
11037  *value_ = *reinterpret_cast<internal::Address*>(handle.val_);
11038  }
11039 }
11040 
11041 template <typename T>
11042 template <typename S>
11043 void ReturnValue<T>::Set(const Local<S> handle) {
11044  static_assert(std::is_void<T>::value || std::is_base_of<T, S>::value,
11045  "type check");
11046  if (V8_UNLIKELY(handle.IsEmpty())) {
11047  *value_ = GetDefaultValue();
11048  } else {
11049  *value_ = *reinterpret_cast<internal::Address*>(*handle);
11050  }
11051 }
11052 
11053 template<typename T>
11054 void ReturnValue<T>::Set(double i) {
11055  static_assert(std::is_base_of<T, Number>::value, "type check");
11057 }
11058 
11059 template<typename T>
11060 void ReturnValue<T>::Set(int32_t i) {
11061  static_assert(std::is_base_of<T, Integer>::value, "type check");
11062  typedef internal::Internals I;
11063  if (V8_LIKELY(I::IsValidSmi(i))) {
11064  *value_ = I::IntToSmi(i);
11065  return;
11066  }
11068 }
11069 
11070 template<typename T>
11071 void ReturnValue<T>::Set(uint32_t i) {
11072  static_assert(std::is_base_of<T, Integer>::value, "type check");
11073  // Can't simply use INT32_MAX here for whatever reason.
11074  bool fits_into_int32_t = (i & (1U << 31)) == 0;
11075  if (V8_LIKELY(fits_into_int32_t)) {
11076  Set(static_cast<int32_t>(i));
11077  return;
11078  }
11080 }
11081 
11082 template<typename T>
11083 void ReturnValue<T>::Set(bool value) {
11084  static_assert(std::is_base_of<T, Boolean>::value, "type check");
11085  typedef internal::Internals I;
11086  int root_index;
11087  if (value) {
11088  root_index = I::kTrueValueRootIndex;
11089  } else {
11090  root_index = I::kFalseValueRootIndex;
11091  }
11092  *value_ = *I::GetRoot(GetIsolate(), root_index);
11093 }
11094 
11095 template<typename T>
11096 void ReturnValue<T>::SetNull() {
11097  static_assert(std::is_base_of<T, Primitive>::value, "type check");
11098  typedef internal::Internals I;
11100 }
11101 
11102 template<typename T>
11104  static_assert(std::is_base_of<T, Primitive>::value, "type check");
11105  typedef internal::Internals I;
11107 }
11108 
11109 template<typename T>
11111  static_assert(std::is_base_of<T, String>::value, "type check");
11112  typedef internal::Internals I;
11114 }
11115 
11116 template <typename T>
11118  // Isolate is always the pointer below the default value on the stack.
11119  return *reinterpret_cast<Isolate**>(&value_[-2]);
11120 }
11121 
11122 template <typename T>
11123 Local<Value> ReturnValue<T>::Get() const {
11124  typedef internal::Internals I;
11126  return Local<Value>(*Undefined(GetIsolate()));
11127  return Local<Value>::New(GetIsolate(), reinterpret_cast<Value*>(value_));
11128 }
11129 
11130 template <typename T>
11131 template <typename S>
11132 void ReturnValue<T>::Set(S* whatever) {
11133  static_assert(sizeof(S) < 0, "incompilable to prevent inadvertent misuse");
11134 }
11135 
11136 template <typename T>
11137 internal::Address ReturnValue<T>::GetDefaultValue() {
11138  // Default value is always the pointer below value_ on the stack.
11139  return value_[-1];
11140 }
11141 
11142 template <typename T>
11144  internal::Address* values,
11145  int length)
11146  : implicit_args_(implicit_args), values_(values), length_(length) {}
11147 
11148 template<typename T>
11150  // values_ points to the first argument (not the receiver).
11151  if (i < 0 || length_ <= i) return Local<Value>(*Undefined(GetIsolate()));
11152 #ifdef V8_REVERSE_JSARGS
11153  return Local<Value>(reinterpret_cast<Value*>(values_ + i));
11154 #else
11155  return Local<Value>(reinterpret_cast<Value*>(values_ - i));
11156 #endif
11157 }
11158 
11159 
11160 template<typename T>
11162  // values_ points to the first argument (not the receiver).
11163 #ifdef V8_REVERSE_JSARGS
11164  return Local<Object>(reinterpret_cast<Object*>(values_ - 1));
11165 #else
11166  return Local<Object>(reinterpret_cast<Object*>(values_ + 1));
11167 #endif
11168 }
11169 
11170 
11171 template<typename T>
11173  return Local<Object>(reinterpret_cast<Object*>(
11175 }
11176 
11177 template <typename T>
11179  return Local<Value>(
11180  reinterpret_cast<Value*>(&implicit_args_[kNewTargetIndex]));
11181 }
11182 
11183 template <typename T>
11185  return Local<Value>(reinterpret_cast<Value*>(&implicit_args_[kDataIndex]));
11186 }
11187 
11188 
11189 template<typename T>
11191  return *reinterpret_cast<Isolate**>(&implicit_args_[kIsolateIndex]);
11192 }
11193 
11194 
11195 template<typename T>
11198 }
11199 
11200 
11201 template<typename T>
11203  return !NewTarget()->IsUndefined();
11204 }
11205 
11206 
11207 template<typename T>
11208 int FunctionCallbackInfo<T>::Length() const {
11209  return length_;
11210 }
11211 
11213  Local<Integer> resource_line_offset,
11214  Local<Integer> resource_column_offset,
11215  Local<Boolean> resource_is_shared_cross_origin,
11216  Local<Integer> script_id,
11217  Local<Value> source_map_url,
11218  Local<Boolean> resource_is_opaque,
11219  Local<Boolean> is_wasm, Local<Boolean> is_module,
11220  Local<PrimitiveArray> host_defined_options)
11221  : resource_name_(resource_name),
11222  resource_line_offset_(resource_line_offset),
11223  resource_column_offset_(resource_column_offset),
11224  options_(!resource_is_shared_cross_origin.IsEmpty() &&
11225  resource_is_shared_cross_origin->IsTrue(),
11226  !resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue(),
11227  !is_wasm.IsEmpty() && is_wasm->IsTrue(),
11228  !is_module.IsEmpty() && is_module->IsTrue()),
11229  script_id_(script_id),
11230  source_map_url_(source_map_url),
11231  host_defined_options_(host_defined_options) {}
11232 
11233 Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; }
11234 
11236  return host_defined_options_;
11237 }
11238 
11240  return resource_line_offset_;
11241 }
11242 
11243 
11245  return resource_column_offset_;
11246 }
11247 
11248 
11249 Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; }
11250 
11251 
11252 Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; }
11253 
11255  CachedData* data)
11256  : source_string(string),
11257  resource_name(origin.ResourceName()),
11258  resource_line_offset(origin.ResourceLineOffset()),
11259  resource_column_offset(origin.ResourceColumnOffset()),
11260  resource_options(origin.Options()),
11261  source_map_url(origin.SourceMapUrl()),
11262  host_defined_options(origin.HostDefinedOptions()),
11263  cached_data(data) {}
11264 
11266  CachedData* data)
11267  : source_string(string), cached_data(data) {}
11268 
11269 
11271  delete cached_data;
11272 }
11273 
11274 
11276  const {
11277  return cached_data;
11278 }
11279 
11281  return resource_options;
11282 }
11283 
11284 Local<Boolean> Boolean::New(Isolate* isolate, bool value) {
11285  return value ? True(isolate) : False(isolate);
11286 }
11287 
11288 void Template::Set(Isolate* isolate, const char* name, Local<Data> value) {
11291  value);
11292 }
11293 
11295 #ifdef V8_ENABLE_CHECKS
11296  CheckCast(data);
11297 #endif
11298  return reinterpret_cast<FunctionTemplate*>(data);
11299 }
11300 
11302 #ifdef V8_ENABLE_CHECKS
11303  CheckCast(data);
11304 #endif
11305  return reinterpret_cast<ObjectTemplate*>(data);
11306 }
11307 
11309 #ifdef V8_ENABLE_CHECKS
11310  CheckCast(data);
11311 #endif
11312  return reinterpret_cast<Signature*>(data);
11313 }
11314 
11316 #ifdef V8_ENABLE_CHECKS
11317  CheckCast(data);
11318 #endif
11319  return reinterpret_cast<AccessorSignature*>(data);
11320 }
11321 
11323 #ifndef V8_ENABLE_CHECKS
11324  typedef internal::Address A;
11325  typedef internal::Internals I;
11326  A obj = *reinterpret_cast<A*>(this);
11327  // Fast path: If the object is a plain JSObject, which is the common case, we
11328  // know where to find the internal fields and can return the value directly.
11329  auto instance_type = I::GetInstanceType(obj);
11330  if (instance_type == I::kJSObjectType ||
11331  instance_type == I::kJSApiObjectType ||
11332  instance_type == I::kJSSpecialApiObjectType) {
11333  int offset = I::kJSObjectHeaderSize + (I::kEmbedderDataSlotSize * index);
11334  A value = I::ReadRawField<A>(obj, offset);
11335 #ifdef V8_COMPRESS_POINTERS
11336  // We read the full pointer value and then decompress it in order to avoid
11337  // dealing with potential endiannes issues.
11338  value = I::DecompressTaggedAnyField(obj, static_cast<uint32_t>(value));
11339 #endif
11340  internal::Isolate* isolate =
11342  A* result = HandleScope::CreateHandle(isolate, value);
11343  return Local<Value>(reinterpret_cast<Value*>(result));
11344  }
11345 #endif
11346  return SlowGetInternalField(index);
11347 }
11348 
11349 
11351 #ifndef V8_ENABLE_CHECKS
11352  typedef internal::Address A;
11353  typedef internal::Internals I;
11354  A obj = *reinterpret_cast<A*>(this);
11355  // Fast path: If the object is a plain JSObject, which is the common case, we
11356  // know where to find the internal fields and can return the value directly.
11357  auto instance_type = I::GetInstanceType(obj);
11358  if (V8_LIKELY(instance_type == I::kJSObjectType ||
11359  instance_type == I::kJSApiObjectType ||
11360  instance_type == I::kJSSpecialApiObjectType)) {
11361  int offset = I::kJSObjectHeaderSize + (I::kEmbedderDataSlotSize * index);
11362  internal::Isolate* isolate = I::GetIsolateForHeapSandbox(obj);
11363  A value = I::ReadExternalPointerField(isolate, obj, offset);
11364  return reinterpret_cast<void*>(value);
11365  }
11366 #endif
11367  return SlowGetAlignedPointerFromInternalField(index);
11368 }
11369 
11370 String* String::Cast(v8::Value* value) {
11371 #ifdef V8_ENABLE_CHECKS
11372  CheckCast(value);
11373 #endif
11374  return static_cast<String*>(value);
11375 }
11376 
11377 
11379  typedef internal::Address S;
11380  typedef internal::Internals I;
11381  I::CheckInitialized(isolate);
11382  S* slot = I::GetRoot(isolate, I::kEmptyStringRootIndex);
11383  return Local<String>(reinterpret_cast<String*>(slot));
11384 }
11385 
11386 
11388  typedef internal::Address A;
11389  typedef internal::Internals I;
11390  A obj = *reinterpret_cast<const A*>(this);
11391 
11392  ExternalStringResource* result;
11394  internal::Isolate* isolate = I::GetIsolateForHeapSandbox(obj);
11395  A value =
11397  result = reinterpret_cast<String::ExternalStringResource*>(value);
11398  } else {
11399  result = GetExternalStringResourceSlow();
11400  }
11401 #ifdef V8_ENABLE_CHECKS
11402  VerifyExternalStringResource(result);
11403 #endif
11404  return result;
11405 }
11406 
11407 
11409  String::Encoding* encoding_out) const {
11410  typedef internal::Address A;
11411  typedef internal::Internals I;
11412  A obj = *reinterpret_cast<const A*>(this);
11414  *encoding_out = static_cast<Encoding>(type & I::kStringEncodingMask);
11415  ExternalStringResourceBase* resource;
11416  if (type == I::kExternalOneByteRepresentationTag ||
11418  internal::Isolate* isolate = I::GetIsolateForHeapSandbox(obj);
11419  A value =
11421  resource = reinterpret_cast<ExternalStringResourceBase*>(value);
11422  } else {
11423  resource = GetExternalStringResourceBaseSlow(encoding_out);
11424  }
11425 #ifdef V8_ENABLE_CHECKS
11426  VerifyExternalStringResourceBase(resource, *encoding_out);
11427 #endif
11428  return resource;
11429 }
11430 
11431 
11432 bool Value::IsUndefined() const {
11433 #ifdef V8_ENABLE_CHECKS
11434  return FullIsUndefined();
11435 #else
11436  return QuickIsUndefined();
11437 #endif
11438 }
11439 
11440 bool Value::QuickIsUndefined() const {
11441  typedef internal::Address A;
11442  typedef internal::Internals I;
11443  A obj = *reinterpret_cast<const A*>(this);
11444  if (!I::HasHeapObjectTag(obj)) return false;
11445  if (I::GetInstanceType(obj) != I::kOddballType) return false;
11447 }
11448 
11449 
11450 bool Value::IsNull() const {
11451 #ifdef V8_ENABLE_CHECKS
11452  return FullIsNull();
11453 #else
11454  return QuickIsNull();
11455 #endif
11456 }
11457 
11458 bool Value::QuickIsNull() const {
11459  typedef internal::Address A;
11460  typedef internal::Internals I;
11461  A obj = *reinterpret_cast<const A*>(this);
11462  if (!I::HasHeapObjectTag(obj)) return false;
11463  if (I::GetInstanceType(obj) != I::kOddballType) return false;
11464  return (I::GetOddballKind(obj) == I::kNullOddballKind);
11465 }
11466 
11467 bool Value::IsNullOrUndefined() const {
11468 #ifdef V8_ENABLE_CHECKS
11469  return FullIsNull() || FullIsUndefined();
11470 #else
11471  return QuickIsNullOrUndefined();
11472 #endif
11473 }
11474 
11475 bool Value::QuickIsNullOrUndefined() const {
11476  typedef internal::Address A;
11477  typedef internal::Internals I;
11478  A obj = *reinterpret_cast<const A*>(this);
11479  if (!I::HasHeapObjectTag(obj)) return false;
11480  if (I::GetInstanceType(obj) != I::kOddballType) return false;
11481  int kind = I::GetOddballKind(obj);
11482  return kind == I::kNullOddballKind || kind == I::kUndefinedOddballKind;
11483 }
11484 
11485 bool Value::IsString() const {
11486 #ifdef V8_ENABLE_CHECKS
11487  return FullIsString();
11488 #else
11489  return QuickIsString();
11490 #endif
11491 }
11492 
11493 bool Value::QuickIsString() const {
11494  typedef internal::Address A;
11495  typedef internal::Internals I;
11496  A obj = *reinterpret_cast<const A*>(this);
11497  if (!I::HasHeapObjectTag(obj)) return false;
11499 }
11500 
11501 
11502 template <class T> Value* Value::Cast(T* value) {
11503  return static_cast<Value*>(value);
11504 }
11505 
11506 
11508 #ifdef V8_ENABLE_CHECKS
11509  CheckCast(value);
11510 #endif
11511  return static_cast<Boolean*>(value);
11512 }
11513 
11514 
11515 Name* Name::Cast(v8::Value* value) {
11516 #ifdef V8_ENABLE_CHECKS
11517  CheckCast(value);
11518 #endif
11519  return static_cast<Name*>(value);
11520 }
11521 
11522 
11523 Symbol* Symbol::Cast(v8::Value* value) {
11524 #ifdef V8_ENABLE_CHECKS
11525  CheckCast(value);
11526 #endif
11527  return static_cast<Symbol*>(value);
11528 }
11529 
11530 
11532 #ifdef V8_ENABLE_CHECKS
11533  CheckCast(data);
11534 #endif
11535  return reinterpret_cast<Private*>(data);
11536 }
11537 
11538 
11539 Number* Number::Cast(v8::Value* value) {
11540 #ifdef V8_ENABLE_CHECKS
11541  CheckCast(value);
11542 #endif
11543  return static_cast<Number*>(value);
11544 }
11545 
11546 
11548 #ifdef V8_ENABLE_CHECKS
11549  CheckCast(value);
11550 #endif
11551  return static_cast<Integer*>(value);
11552 }
11553 
11554 
11555 Int32* Int32::Cast(v8::Value* value) {
11556 #ifdef V8_ENABLE_CHECKS
11557  CheckCast(value);
11558 #endif
11559  return static_cast<Int32*>(value);
11560 }
11561 
11562 
11563 Uint32* Uint32::Cast(v8::Value* value) {
11564 #ifdef V8_ENABLE_CHECKS
11565  CheckCast(value);
11566 #endif
11567  return static_cast<Uint32*>(value);
11568 }
11569 
11570 BigInt* BigInt::Cast(v8::Value* value) {
11571 #ifdef V8_ENABLE_CHECKS
11572  CheckCast(value);
11573 #endif
11574  return static_cast<BigInt*>(value);
11575 }
11576 
11577 Date* Date::Cast(v8::Value* value) {
11578 #ifdef V8_ENABLE_CHECKS
11579  CheckCast(value);
11580 #endif
11581  return static_cast<Date*>(value);
11582 }
11583 
11584 
11586 #ifdef V8_ENABLE_CHECKS
11587  CheckCast(value);
11588 #endif
11589  return static_cast<StringObject*>(value);
11590 }
11591 
11592 
11594 #ifdef V8_ENABLE_CHECKS
11595  CheckCast(value);
11596 #endif
11597  return static_cast<SymbolObject*>(value);
11598 }
11599 
11600 
11602 #ifdef V8_ENABLE_CHECKS
11603  CheckCast(value);
11604 #endif
11605  return static_cast<NumberObject*>(value);
11606 }
11607 
11609 #ifdef V8_ENABLE_CHECKS
11610  CheckCast(value);
11611 #endif
11612  return static_cast<BigIntObject*>(value);
11613 }
11614 
11616 #ifdef V8_ENABLE_CHECKS
11617  CheckCast(value);
11618 #endif
11619  return static_cast<BooleanObject*>(value);
11620 }
11621 
11622 
11623 RegExp* RegExp::Cast(v8::Value* value) {
11624 #ifdef V8_ENABLE_CHECKS
11625  CheckCast(value);
11626 #endif
11627  return static_cast<RegExp*>(value);
11628 }
11629 
11630 
11631 Object* Object::Cast(v8::Value* value) {
11632 #ifdef V8_ENABLE_CHECKS
11633  CheckCast(value);
11634 #endif
11635  return static_cast<Object*>(value);
11636 }
11637 
11638 
11639 Array* Array::Cast(v8::Value* value) {
11640 #ifdef V8_ENABLE_CHECKS
11641  CheckCast(value);
11642 #endif
11643  return static_cast<Array*>(value);
11644 }
11645 
11646 
11647 Map* Map::Cast(v8::Value* value) {
11648 #ifdef V8_ENABLE_CHECKS
11649  CheckCast(value);
11650 #endif
11651  return static_cast<Map*>(value);
11652 }
11653 
11654 
11655 Set* Set::Cast(v8::Value* value) {
11656 #ifdef V8_ENABLE_CHECKS
11657  CheckCast(value);
11658 #endif
11659  return static_cast<Set*>(value);
11660 }
11661 
11662 
11664 #ifdef V8_ENABLE_CHECKS
11665  CheckCast(value);
11666 #endif
11667  return static_cast<Promise*>(value);
11668 }
11669 
11670 
11671 Proxy* Proxy::Cast(v8::Value* value) {
11672 #ifdef V8_ENABLE_CHECKS
11673  CheckCast(value);
11674 #endif
11675  return static_cast<Proxy*>(value);
11676 }
11677 
11679 #ifdef V8_ENABLE_CHECKS
11680  CheckCast(value);
11681 #endif
11682  return static_cast<WasmModuleObject*>(value);
11683 }
11684 
11686 #ifdef V8_ENABLE_CHECKS
11687  CheckCast(value);
11688 #endif
11689  return static_cast<Promise::Resolver*>(value);
11690 }
11691 
11692 
11694 #ifdef V8_ENABLE_CHECKS
11695  CheckCast(value);
11696 #endif
11697  return static_cast<ArrayBuffer*>(value);
11698 }
11699 
11700 
11702 #ifdef V8_ENABLE_CHECKS
11703  CheckCast(value);
11704 #endif
11705  return static_cast<ArrayBufferView*>(value);
11706 }
11707 
11708 
11710 #ifdef V8_ENABLE_CHECKS
11711  CheckCast(value);
11712 #endif
11713  return static_cast<TypedArray*>(value);
11714 }
11715 
11716 
11718 #ifdef V8_ENABLE_CHECKS
11719  CheckCast(value);
11720 #endif
11721  return static_cast<Uint8Array*>(value);
11722 }
11723 
11724 
11726 #ifdef V8_ENABLE_CHECKS
11727  CheckCast(value);
11728 #endif
11729  return static_cast<Int8Array*>(value);
11730 }
11731 
11732 
11734 #ifdef V8_ENABLE_CHECKS
11735  CheckCast(value);
11736 #endif
11737  return static_cast<Uint16Array*>(value);
11738 }
11739 
11740 
11742 #ifdef V8_ENABLE_CHECKS
11743  CheckCast(value);
11744 #endif
11745  return static_cast<Int16Array*>(value);
11746 }
11747 
11748 
11750 #ifdef V8_ENABLE_CHECKS
11751  CheckCast(value);
11752 #endif
11753  return static_cast<Uint32Array*>(value);
11754 }
11755 
11756 
11758 #ifdef V8_ENABLE_CHECKS
11759  CheckCast(value);
11760 #endif
11761  return static_cast<Int32Array*>(value);
11762 }
11763 
11764 
11766 #ifdef V8_ENABLE_CHECKS
11767  CheckCast(value);
11768 #endif
11769  return static_cast<Float32Array*>(value);
11770 }
11771 
11772 
11774 #ifdef V8_ENABLE_CHECKS
11775  CheckCast(value);
11776 #endif
11777  return static_cast<Float64Array*>(value);
11778 }
11779 
11781 #ifdef V8_ENABLE_CHECKS
11782  CheckCast(value);
11783 #endif
11784  return static_cast<BigInt64Array*>(value);
11785 }
11786 
11788 #ifdef V8_ENABLE_CHECKS
11789  CheckCast(value);
11790 #endif
11791  return static_cast<BigUint64Array*>(value);
11792 }
11793 
11795 #ifdef V8_ENABLE_CHECKS
11796  CheckCast(value);
11797 #endif
11798  return static_cast<Uint8ClampedArray*>(value);
11799 }
11800 
11801 
11803 #ifdef V8_ENABLE_CHECKS
11804  CheckCast(value);
11805 #endif
11806  return static_cast<DataView*>(value);
11807 }
11808 
11809 
11811 #ifdef V8_ENABLE_CHECKS
11812  CheckCast(value);
11813 #endif
11814  return static_cast<SharedArrayBuffer*>(value);
11815 }
11816 
11817 
11819 #ifdef V8_ENABLE_CHECKS
11820  CheckCast(value);
11821 #endif
11822  return static_cast<Function*>(value);
11823 }
11824 
11825 
11827 #ifdef V8_ENABLE_CHECKS
11828  CheckCast(value);
11829 #endif
11830  return static_cast<External*>(value);
11831 }
11832 
11833 
11834 template<typename T>
11836  return *reinterpret_cast<Isolate**>(&args_[kIsolateIndex]);
11837 }
11838 
11839 
11840 template<typename T>
11842  return Local<Value>(reinterpret_cast<Value*>(&args_[kDataIndex]));
11843 }
11844 
11845 
11846 template<typename T>
11848  return Local<Object>(reinterpret_cast<Object*>(&args_[kThisIndex]));
11849 }
11850 
11851 
11852 template<typename T>
11854  return Local<Object>(reinterpret_cast<Object*>(&args_[kHolderIndex]));
11855 }
11856 
11857 
11858 template<typename T>
11860  return ReturnValue<T>(&args_[kReturnValueIndex]);
11861 }
11862 
11863 template <typename T>
11865  typedef internal::Internals I;
11869  }
11871  reinterpret_cast<v8::internal::Isolate*>(GetIsolate()));
11872 }
11873 
11875  typedef internal::Address S;
11876  typedef internal::Internals I;
11877  I::CheckInitialized(isolate);
11878  S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex);
11879  return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
11880 }
11881 
11882 
11884  typedef internal::Address S;
11885  typedef internal::Internals I;
11886  I::CheckInitialized(isolate);
11887  S* slot = I::GetRoot(isolate, I::kNullValueRootIndex);
11888  return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
11889 }
11890 
11891 
11893  typedef internal::Address S;
11894  typedef internal::Internals I;
11895  I::CheckInitialized(isolate);
11896  S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex);
11897  return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
11898 }
11899 
11900 
11902  typedef internal::Address S;
11903  typedef internal::Internals I;
11904  I::CheckInitialized(isolate);
11905  S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex);
11906  return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
11907 }
11908 
11909 
11910 void Isolate::SetData(uint32_t slot, void* data) {
11911  typedef internal::Internals I;
11912  I::SetEmbedderData(this, slot, data);
11913 }
11914 
11915 
11916 void* Isolate::GetData(uint32_t slot) {
11917  typedef internal::Internals I;
11918  return I::GetEmbedderData(this, slot);
11919 }
11920 
11921 
11923  typedef internal::Internals I;
11924  return I::kNumIsolateDataSlots;
11925 }
11926 
11927 template <class T>
11929  T* data = reinterpret_cast<T*>(GetDataFromSnapshotOnce(index));
11930  if (data) internal::PerformCastCheck(data);
11931  return Local<T>(data);
11932 }
11933 
11935  int64_t change_in_bytes) {
11936  typedef internal::Internals I;
11937  int64_t* external_memory = reinterpret_cast<int64_t*>(
11938  reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryOffset);
11939  int64_t* external_memory_limit = reinterpret_cast<int64_t*>(
11940  reinterpret_cast<uint8_t*>(this) + I::kExternalMemoryLimitOffset);
11941  int64_t* external_memory_low_since_mc =
11942  reinterpret_cast<int64_t*>(reinterpret_cast<uint8_t*>(this) +
11944 
11945  // Embedders are weird: we see both over- and underflows here. Perform the
11946  // addition with unsigned types to avoid undefined behavior.
11947  const int64_t amount =
11948  static_cast<int64_t>(static_cast<uint64_t>(change_in_bytes) +
11949  static_cast<uint64_t>(*external_memory));
11950  *external_memory = amount;
11951 
11952  if (amount < *external_memory_low_since_mc) {
11953  *external_memory_low_since_mc = amount;
11954  *external_memory_limit = amount + I::kExternalAllocationSoftLimit;
11955  }
11956 
11957  if (change_in_bytes <= 0) return *external_memory;
11958 
11959  if (amount > *external_memory_limit) {
11960  ReportExternalAllocationLimitReached();
11961  }
11962  return *external_memory;
11963 }
11964 
11966 #ifndef V8_ENABLE_CHECKS
11967  typedef internal::Address A;
11968  typedef internal::Internals I;
11969  A ctx = *reinterpret_cast<const A*>(this);
11970  A embedder_data =
11972  int value_offset =
11974  A value = I::ReadRawField<A>(embedder_data, value_offset);
11975 #ifdef V8_COMPRESS_POINTERS
11976  // We read the full pointer value and then decompress it in order to avoid
11977  // dealing with potential endiannes issues.
11978  value =
11979  I::DecompressTaggedAnyField(embedder_data, static_cast<uint32_t>(value));
11980 #endif
11982  *reinterpret_cast<A*>(this));
11983  A* result = HandleScope::CreateHandle(isolate, value);
11984  return Local<Value>(reinterpret_cast<Value*>(result));
11985 #else
11986  return SlowGetEmbedderData(index);
11987 #endif
11988 }
11989 
11990 
11992 #ifndef V8_ENABLE_CHECKS
11993  typedef internal::Address A;
11994  typedef internal::Internals I;
11995  A ctx = *reinterpret_cast<const A*>(this);
11996  A embedder_data =
11998  int value_offset =
12000  internal::Isolate* isolate = I::GetIsolateForHeapSandbox(ctx);
12001  return reinterpret_cast<void*>(
12002  I::ReadExternalPointerField(isolate, embedder_data, value_offset));
12003 #else
12004  return SlowGetAlignedPointerFromEmbedderData(index);
12005 #endif
12006 }
12007 
12008 template <class T>
12010  T* data = reinterpret_cast<T*>(GetDataFromSnapshotOnce(index));
12011  if (data) internal::PerformCastCheck(data);
12012  return Local<T>(data);
12013 }
12014 
12015 template <class T>
12016 size_t SnapshotCreator::AddData(Local<Context> context, Local<T> object) {
12017  T* object_ptr = *object;
12018  internal::Address* p = reinterpret_cast<internal::Address*>(object_ptr);
12019  return AddData(context, *p);
12020 }
12021 
12022 template <class T>
12023 size_t SnapshotCreator::AddData(Local<T> object) {
12024  T* object_ptr = *object;
12025  internal::Address* p = reinterpret_cast<internal::Address*>(object_ptr);
12026  return AddData(*p);
12027 }
12028 
12029 /**
12030  * \example shell.cc
12031  * A simple shell that takes a list of expressions on the
12032  * command-line and executes them.
12033  */
12034 
12035 
12036 /**
12037  * \example process.cc
12038  */
12039 
12040 
12041 } // namespace v8
12042 
12043 #endif // INCLUDE_V8_H_